diff --git a/Godeps/Godeps.json b/Godeps/Godeps.json index 9e0290c78f..1fa0d8a3de 100644 --- a/Godeps/Godeps.json +++ b/Godeps/Godeps.json @@ -101,8 +101,13 @@ }, { "ImportPath": "github.com/Microsoft/go-winio", - "Comment": "v0.4.2", - "Rev": "f533f7a102197536779ea3a8cb881d639e21ec5a" + "Comment": "v0.4.5", + "Rev": "78439966b38d69bf38227fbf57ac8a6fee70f69a" + }, + { + "ImportPath": "github.com/Microsoft/hcsshim", + "Comment": "V0.6.3", + "Rev": "6ea7fe54f719d95721e7d9b26ac0add224c9b923" }, { "ImportPath": "github.com/NYTimes/gziphandler", diff --git a/Godeps/LICENSES b/Godeps/LICENSES index a1d6c00de7..9696e91425 100644 --- a/Godeps/LICENSES +++ b/Godeps/LICENSES @@ -68207,6 +68207,34 @@ SOFTWARE. ================================================================================ +================================================================================ += vendor/github.com/Microsoft/hcsshim licensed under: = + +The MIT License (MIT) + +Copyright (c) 2015 Microsoft + +Permission is hereby granted, free of charge, to any person obtaining a copy +of this software and associated documentation files (the "Software"), to deal +in the Software without restriction, including without limitation the rights +to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the Software is +furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in all +copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE +SOFTWARE. += vendor/github.com/Microsoft/hcsshim/LICENSE d4c2cbbea5ee1e7c86dff68a7073718e - +================================================================================ + + ================================================================================ = vendor/github.com/miekg/coredns/middleware/etcd/msg licensed under: = @@ -80979,6 +81007,35 @@ THE SOFTWARE. ================================================================================ +================================================================================ += vendor/github.com/sirupsen/logrus licensed under: = + +The MIT License (MIT) + +Copyright (c) 2014 Simon Eskildsen + +Permission is hereby granted, free of charge, to any person obtaining a copy +of this software and associated documentation files (the "Software"), to deal +in the Software without restriction, including without limitation the rights +to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the Software is +furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in +all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN +THE SOFTWARE. + += vendor/github.com/sirupsen/logrus/LICENSE 8dadfef729c08ec4e631c4f6fc5d43a0 - +================================================================================ + + ================================================================================ = vendor/github.com/spf13/afero licensed under: = diff --git a/cmd/kube-proxy/app/BUILD b/cmd/kube-proxy/app/BUILD index 2beec9ddc1..06540166fc 100644 --- a/cmd/kube-proxy/app/BUILD +++ b/cmd/kube-proxy/app/BUILD @@ -11,8 +11,15 @@ go_library( srcs = [ "conntrack.go", "server.go", - "server_linux.go", - ], + ] + select({ + "@io_bazel_rules_go//go/platform:linux_amd64": [ + "server_linux.go", + ], + "@io_bazel_rules_go//go/platform:windows_amd64": [ + "server_windows.go", + ], + "//conditions:default": [], + }), deps = [ "//pkg/api:go_default_library", "//pkg/apis/componentconfig:go_default_library", @@ -30,7 +37,6 @@ go_library( "//pkg/proxy/ipvs:go_default_library", "//pkg/proxy/userspace:go_default_library", "//pkg/util/configz:go_default_library", - "//pkg/util/dbus:go_default_library", "//pkg/util/iptables:go_default_library", "//pkg/util/ipvs:go_default_library", "//pkg/util/mount:go_default_library", @@ -49,8 +55,6 @@ go_library( "//vendor/k8s.io/apimachinery/pkg/runtime:go_default_library", "//vendor/k8s.io/apimachinery/pkg/runtime/serializer:go_default_library", "//vendor/k8s.io/apimachinery/pkg/runtime/serializer/json:go_default_library", - "//vendor/k8s.io/apimachinery/pkg/types:go_default_library", - "//vendor/k8s.io/apimachinery/pkg/util/net:go_default_library", "//vendor/k8s.io/apimachinery/pkg/util/runtime:go_default_library", "//vendor/k8s.io/apimachinery/pkg/util/wait:go_default_library", "//vendor/k8s.io/apiserver/pkg/server/healthz:go_default_library", @@ -60,8 +64,23 @@ go_library( "//vendor/k8s.io/client-go/tools/clientcmd:go_default_library", "//vendor/k8s.io/client-go/tools/clientcmd/api:go_default_library", "//vendor/k8s.io/client-go/tools/record:go_default_library", - "//vendor/k8s.io/utils/exec:go_default_library", - ], + ] + select({ + "@io_bazel_rules_go//go/platform:linux_amd64": [ + "//pkg/util/dbus:go_default_library", + "//vendor/k8s.io/apimachinery/pkg/types:go_default_library", + "//vendor/k8s.io/apimachinery/pkg/util/net:go_default_library", + "//vendor/k8s.io/utils/exec:go_default_library", + ], + "@io_bazel_rules_go//go/platform:windows_amd64": [ + "//pkg/proxy/winkernel:go_default_library", + "//pkg/proxy/winuserspace:go_default_library", + "//pkg/util/netsh:go_default_library", + "//vendor/k8s.io/apimachinery/pkg/types:go_default_library", + "//vendor/k8s.io/apimachinery/pkg/util/net:go_default_library", + "//vendor/k8s.io/utils/exec:go_default_library", + ], + "//conditions:default": [], + }), ) go_test( diff --git a/pkg/proxy/winkernel/BUILD b/pkg/proxy/winkernel/BUILD index 96b2652cbb..f60ceb4efb 100644 --- a/pkg/proxy/winkernel/BUILD +++ b/pkg/proxy/winkernel/BUILD @@ -1,59 +1,64 @@ -package(default_visibility = ["//visibility:public"]) - -licenses(["notice"]) - -load( - "@io_bazel_rules_go//go:def.bzl", - "go_library", - "go_test", -) - -go_test( - name = "go_default_test", - srcs = ["proxier_test.go"], - library = ":go_default_library", - tags = ["automanaged"], - deps = [ - "//pkg/api:go_default_library", - "//pkg/proxy:go_default_library", - "//pkg/util/async:go_default_library", - "//pkg/util/iptables:go_default_library", - "//pkg/util/iptables/testing:go_default_library", - "//vendor/github.com/davecgh/go-spew/spew:go_default_library", - "//vendor/k8s.io/apimachinery/pkg/apis/meta/v1:go_default_library", - "//vendor/k8s.io/apimachinery/pkg/types:go_default_library", - "//vendor/k8s.io/apimachinery/pkg/util/intstr:go_default_library", - "//vendor/k8s.io/apimachinery/pkg/util/sets:go_default_library", - "//vendor/k8s.io/utils/exec:go_default_library", - "//vendor/k8s.io/utils/exec/testing:go_default_library", - ], -) +load("@io_bazel_rules_go//go:def.bzl", "go_library", "go_test") go_library( name = "go_default_library", srcs = [ "metrics.go", - "proxier.go", - ], - tags = ["automanaged"], + ] + select({ + "@io_bazel_rules_go//go/platform:windows_amd64": [ + "proxier.go", + ], + "//conditions:default": [], + }), + visibility = ["//visibility:public"], deps = [ - "//pkg/api:go_default_library", - "//pkg/api/helper:go_default_library", - "//pkg/api/service:go_default_library", - "//pkg/features:go_default_library", - "//pkg/proxy:go_default_library", - "//pkg/proxy/healthcheck:go_default_library", - "//pkg/util/async:go_default_library", - "//vendor/github.com/Microsoft/hcsshim:go_default_library", - "//vendor/github.com/davecgh/go-spew/spew:go_default_library", - "//vendor/github.com/golang/glog:go_default_library", "//vendor/github.com/prometheus/client_golang/prometheus:go_default_library", - "//vendor/k8s.io/apimachinery/pkg/types:go_default_library", - "//vendor/k8s.io/apimachinery/pkg/util/sets:go_default_library", - "//vendor/k8s.io/apimachinery/pkg/util/wait:go_default_library", - "//vendor/k8s.io/apiserver/pkg/util/feature:go_default_library", - "//vendor/k8s.io/client-go/tools/record:go_default_library", - ], + ] + select({ + "@io_bazel_rules_go//go/platform:windows_amd64": [ + "//pkg/api:go_default_library", + "//pkg/api/helper:go_default_library", + "//pkg/api/service:go_default_library", + "//pkg/features:go_default_library", + "//pkg/proxy:go_default_library", + "//pkg/proxy/healthcheck:go_default_library", + "//pkg/util/async:go_default_library", + "//vendor/github.com/Microsoft/hcsshim:go_default_library", + "//vendor/github.com/davecgh/go-spew/spew:go_default_library", + "//vendor/github.com/golang/glog:go_default_library", + "//vendor/k8s.io/apimachinery/pkg/types:go_default_library", + "//vendor/k8s.io/apimachinery/pkg/util/sets:go_default_library", + "//vendor/k8s.io/apimachinery/pkg/util/wait:go_default_library", + "//vendor/k8s.io/apiserver/pkg/util/feature:go_default_library", + "//vendor/k8s.io/client-go/tools/record:go_default_library", + ], + "//conditions:default": [], + }), +) + +go_test( + name = "go_default_test", + srcs = select({ + "@io_bazel_rules_go//go/platform:windows_amd64": [ + "proxier_test.go", + ], + "//conditions:default": [], + }), + library = ":go_default_library", + deps = select({ + "@io_bazel_rules_go//go/platform:windows_amd64": [ + "//pkg/api:go_default_library", + "//pkg/proxy:go_default_library", + "//pkg/util/async:go_default_library", + "//vendor/github.com/davecgh/go-spew/spew:go_default_library", + "//vendor/k8s.io/apimachinery/pkg/apis/meta/v1:go_default_library", + "//vendor/k8s.io/apimachinery/pkg/types:go_default_library", + "//vendor/k8s.io/apimachinery/pkg/util/intstr:go_default_library", + "//vendor/k8s.io/apimachinery/pkg/util/sets:go_default_library", + "//vendor/k8s.io/utils/exec:go_default_library", + "//vendor/k8s.io/utils/exec/testing:go_default_library", + ], + "//conditions:default": [], + }), ) filegroup( @@ -67,4 +72,5 @@ filegroup( name = "all-srcs", srcs = [":package-srcs"], tags = ["automanaged"], + visibility = ["//visibility:public"], ) diff --git a/pkg/proxy/winkernel/proxier.go b/pkg/proxy/winkernel/proxier.go index d440dc410b..dc36003ce2 100644 --- a/pkg/proxy/winkernel/proxier.go +++ b/pkg/proxy/winkernel/proxier.go @@ -1,3 +1,5 @@ +// +build windows + /* Copyright 2015 The Kubernetes Authors. @@ -63,7 +65,7 @@ func CanUseWinKernelProxier(kcompat KernelCompatTester) (bool, error) { type WindowsKernelCompatTester struct{} -// TODO : Fix the below API to query the OS version +// Todo : Fix the below API to query the OS version func (lkct WindowsKernelCompatTester) IsCompatible() error { return nil } diff --git a/pkg/proxy/winkernel/proxier_test.go b/pkg/proxy/winkernel/proxier_test.go index 7ccce60022..24987bc7b5 100644 --- a/pkg/proxy/winkernel/proxier_test.go +++ b/pkg/proxy/winkernel/proxier_test.go @@ -1,3 +1,5 @@ +// +build windows + /* Copyright 2015 The Kubernetes Authors. @@ -17,9 +19,7 @@ limitations under the License. package winkernel import ( - "bytes" "reflect" - "strconv" "testing" "time" @@ -36,150 +36,14 @@ import ( "k8s.io/kubernetes/pkg/api" "k8s.io/kubernetes/pkg/proxy" "k8s.io/kubernetes/pkg/util/async" - utiliptables "k8s.io/kubernetes/pkg/util/iptables" - iptablestest "k8s.io/kubernetes/pkg/util/iptables/testing" "k8s.io/utils/exec" fakeexec "k8s.io/utils/exec/testing" ) -func checkAllLines(t *testing.T, table utiliptables.Table, save []byte, expectedLines map[utiliptables.Chain]string) { - chainLines := utiliptables.GetChainLines(table, save) - for chain, line := range chainLines { - if expected, exists := expectedLines[chain]; exists { - if expected != line { - t.Errorf("getChainLines expected chain line not present. For chain: %s Expected: %s Got: %s", chain, expected, line) - } - } else { - t.Errorf("getChainLines expected chain not present: %s", chain) - } - } -} - -func TestReadLinesFromByteBuffer(t *testing.T) { - testFn := func(byteArray []byte, expected []string) { - index := 0 - readIndex := 0 - for ; readIndex < len(byteArray); index++ { - line, n := utiliptables.ReadLine(readIndex, byteArray) - readIndex = n - if expected[index] != line { - t.Errorf("expected:%q, actual:%q", expected[index], line) - } - } // for - if readIndex < len(byteArray) { - t.Errorf("Byte buffer was only partially read. Buffer length is:%d, readIndex is:%d", len(byteArray), readIndex) - } - if index < len(expected) { - t.Errorf("All expected strings were not compared. expected arr length:%d, matched count:%d", len(expected), index-1) - } - } - - byteArray1 := []byte("\n Line 1 \n\n\n L ine4 \nLine 5 \n \n") - expected1 := []string{"", "Line 1", "", "", "L ine4", "Line 5", ""} - testFn(byteArray1, expected1) - - byteArray1 = []byte("") - expected1 = []string{} - testFn(byteArray1, expected1) - - byteArray1 = []byte("\n\n") - expected1 = []string{"", ""} - testFn(byteArray1, expected1) -} - -func TestGetChainLines(t *testing.T) { - iptables_save := `# Generated by iptables-save v1.4.7 on Wed Oct 29 14:56:01 2014 - *nat - :PREROUTING ACCEPT [2136997:197881818] - :POSTROUTING ACCEPT [4284525:258542680] - :OUTPUT ACCEPT [5901660:357267963] - -A PREROUTING -m addrtype --dst-type LOCAL -j DOCKER - COMMIT - # Completed on Wed Oct 29 14:56:01 2014` - expected := map[utiliptables.Chain]string{ - utiliptables.ChainPrerouting: ":PREROUTING ACCEPT [2136997:197881818]", - utiliptables.ChainPostrouting: ":POSTROUTING ACCEPT [4284525:258542680]", - utiliptables.ChainOutput: ":OUTPUT ACCEPT [5901660:357267963]", - } - checkAllLines(t, utiliptables.TableNAT, []byte(iptables_save), expected) -} - -func TestGetChainLinesMultipleTables(t *testing.T) { - iptables_save := `# Generated by iptables-save v1.4.21 on Fri Aug 7 14:47:37 2015 - *nat - :PREROUTING ACCEPT [2:138] - :INPUT ACCEPT [0:0] - :OUTPUT ACCEPT [0:0] - :POSTROUTING ACCEPT [0:0] - :DOCKER - [0:0] - :KUBE-NODEPORT-CONTAINER - [0:0] - :KUBE-NODEPORT-HOST - [0:0] - :KUBE-PORTALS-CONTAINER - [0:0] - :KUBE-PORTALS-HOST - [0:0] - :KUBE-SVC-1111111111111111 - [0:0] - :KUBE-SVC-2222222222222222 - [0:0] - :KUBE-SVC-3333333333333333 - [0:0] - :KUBE-SVC-4444444444444444 - [0:0] - :KUBE-SVC-5555555555555555 - [0:0] - :KUBE-SVC-6666666666666666 - [0:0] - -A PREROUTING -m comment --comment "handle ClusterIPs; NOTE: this must be before the NodePort rules" -j KUBE-PORTALS-CONTAINER - -A PREROUTING -m addrtype --dst-type LOCAL -j DOCKER - -A PREROUTING -m addrtype --dst-type LOCAL -m comment --comment "handle service NodePorts; NOTE: this must be the last rule in the chain" -j KUBE-NODEPORT-CONTAINER - -A OUTPUT -m comment --comment "handle ClusterIPs; NOTE: this must be before the NodePort rules" -j KUBE-PORTALS-HOST - -A OUTPUT ! -d 127.0.0.0/8 -m addrtype --dst-type LOCAL -j DOCKER - -A OUTPUT -m addrtype --dst-type LOCAL -m comment --comment "handle service NodePorts; NOTE: this must be the last rule in the chain" -j KUBE-NODEPORT-HOST - -A POSTROUTING -s 10.246.1.0/24 ! -o cbr0 -j MASQUERADE - -A POSTROUTING -s 10.0.2.15/32 -d 10.0.2.15/32 -m comment --comment "handle pod connecting to self" -j MASQUERADE - -A KUBE-PORTALS-CONTAINER -d 10.247.0.1/32 -p tcp -m comment --comment "portal for default/kubernetes:" -m state --state NEW -m tcp --dport 443 -j KUBE-SVC-5555555555555555 - -A KUBE-PORTALS-CONTAINER -d 10.247.0.10/32 -p udp -m comment --comment "portal for kube-system/kube-dns:dns" -m state --state NEW -m udp --dport 53 -j KUBE-SVC-6666666666666666 - -A KUBE-PORTALS-CONTAINER -d 10.247.0.10/32 -p tcp -m comment --comment "portal for kube-system/kube-dns:dns-tcp" -m state --state NEW -m tcp --dport 53 -j KUBE-SVC-2222222222222222 - -A KUBE-PORTALS-HOST -d 10.247.0.1/32 -p tcp -m comment --comment "portal for default/kubernetes:" -m state --state NEW -m tcp --dport 443 -j KUBE-SVC-5555555555555555 - -A KUBE-PORTALS-HOST -d 10.247.0.10/32 -p udp -m comment --comment "portal for kube-system/kube-dns:dns" -m state --state NEW -m udp --dport 53 -j KUBE-SVC-6666666666666666 - -A KUBE-PORTALS-HOST -d 10.247.0.10/32 -p tcp -m comment --comment "portal for kube-system/kube-dns:dns-tcp" -m state --state NEW -m tcp --dport 53 -j KUBE-SVC-2222222222222222 - -A KUBE-SVC-1111111111111111 -p udp -m comment --comment "kube-system/kube-dns:dns" -m recent --set --name KUBE-SVC-1111111111111111 --mask 255.255.255.255 --rsource -j DNAT --to-destination 10.246.1.2:53 - -A KUBE-SVC-2222222222222222 -m comment --comment "kube-system/kube-dns:dns-tcp" -j KUBE-SVC-3333333333333333 - -A KUBE-SVC-3333333333333333 -p tcp -m comment --comment "kube-system/kube-dns:dns-tcp" -m recent --set --name KUBE-SVC-3333333333333333 --mask 255.255.255.255 --rsource -j DNAT --to-destination 10.246.1.2:53 - -A KUBE-SVC-4444444444444444 -p tcp -m comment --comment "default/kubernetes:" -m recent --set --name KUBE-SVC-4444444444444444 --mask 255.255.255.255 --rsource -j DNAT --to-destination 10.245.1.2:443 - -A KUBE-SVC-5555555555555555 -m comment --comment "default/kubernetes:" -j KUBE-SVC-4444444444444444 - -A KUBE-SVC-6666666666666666 -m comment --comment "kube-system/kube-dns:dns" -j KUBE-SVC-1111111111111111 - COMMIT - # Completed on Fri Aug 7 14:47:37 2015 - # Generated by iptables-save v1.4.21 on Fri Aug 7 14:47:37 2015 - *filter - :INPUT ACCEPT [17514:83115836] - :FORWARD ACCEPT [0:0] - :OUTPUT ACCEPT [8909:688225] - :DOCKER - [0:0] - -A FORWARD -o cbr0 -j DOCKER - -A FORWARD -o cbr0 -m conntrack --ctstate RELATED,ESTABLISHED -j ACCEPT - -A FORWARD -i cbr0 ! -o cbr0 -j ACCEPT - -A FORWARD -i cbr0 -o cbr0 -j ACCEPT - COMMIT - ` - expected := map[utiliptables.Chain]string{ - utiliptables.ChainPrerouting: ":PREROUTING ACCEPT [2:138]", - utiliptables.Chain("INPUT"): ":INPUT ACCEPT [0:0]", - utiliptables.Chain("OUTPUT"): ":OUTPUT ACCEPT [0:0]", - utiliptables.ChainPostrouting: ":POSTROUTING ACCEPT [0:0]", - utiliptables.Chain("DOCKER"): ":DOCKER - [0:0]", - utiliptables.Chain("KUBE-NODEPORT-CONTAINER"): ":KUBE-NODEPORT-CONTAINER - [0:0]", - utiliptables.Chain("KUBE-NODEPORT-HOST"): ":KUBE-NODEPORT-HOST - [0:0]", - utiliptables.Chain("KUBE-PORTALS-CONTAINER"): ":KUBE-PORTALS-CONTAINER - [0:0]", - utiliptables.Chain("KUBE-PORTALS-HOST"): ":KUBE-PORTALS-HOST - [0:0]", - utiliptables.Chain("KUBE-SVC-1111111111111111"): ":KUBE-SVC-1111111111111111 - [0:0]", - utiliptables.Chain("KUBE-SVC-2222222222222222"): ":KUBE-SVC-2222222222222222 - [0:0]", - utiliptables.Chain("KUBE-SVC-3333333333333333"): ":KUBE-SVC-3333333333333333 - [0:0]", - utiliptables.Chain("KUBE-SVC-4444444444444444"): ":KUBE-SVC-4444444444444444 - [0:0]", - utiliptables.Chain("KUBE-SVC-5555555555555555"): ":KUBE-SVC-5555555555555555 - [0:0]", - utiliptables.Chain("KUBE-SVC-6666666666666666"): ":KUBE-SVC-6666666666666666 - [0:0]", - } - checkAllLines(t, utiliptables.TableNAT, []byte(iptables_save), expected) -} - func newFakeServiceInfo(service proxy.ServicePortName, ip net.IP, port int, protocol api.Protocol, onlyNodeLocalEndpoints bool) *serviceInfo { return &serviceInfo{ sessionAffinityType: api.ServiceAffinityNone, // default - stickyMaxAgeMinutes: 180, // TODO: paramaterize this in the API. + stickyMaxAgeMinutes: 180, clusterIP: ip, port: port, protocol: protocol, @@ -381,187 +245,34 @@ func (fake *fakeHealthChecker) SyncEndpoints(newEndpoints map[types.NamespacedNa return nil } +func getFakeHnsNetwork() *hnsNetworkInfo { + return &hnsNetworkInfo{ + id: "00000000-0000-0000-0000-000000000001", + name: "fakeNetwork", + }, nil +} + const testHostname = "test-hostname" -func NewFakeProxier(ipt utiliptables.Interface) *Proxier { +func NewFakeProxier() *Proxier { + fakeHnsNetwork := getFakeHnsNetwork() // TODO: Call NewProxier after refactoring out the goroutine // invocation into a Run() method. p := &Proxier{ - exec: &fakeexec.FakeExec{}, - serviceMap: make(proxyServiceMap), - serviceChanges: newServiceChangeMap(), - endpointsMap: make(proxyEndpointsMap), - endpointsChanges: newEndpointsChangeMap(testHostname), - iptables: ipt, - clusterCIDR: "10.0.0.0/24", - hostname: testHostname, - portsMap: make(map[localPort]closeable), - portMapper: &fakePortOpener{[]*localPort{}}, - healthChecker: newFakeHealthChecker(), - precomputedProbabilities: make([]string, 0, 1001), - iptablesData: bytes.NewBuffer(nil), - filterChains: bytes.NewBuffer(nil), - filterRules: bytes.NewBuffer(nil), - natChains: bytes.NewBuffer(nil), - natRules: bytes.NewBuffer(nil), + serviceMap: make(proxyServiceMap), + serviceChanges: newServiceChangeMap(), + endpointsMap: make(proxyEndpointsMap), + endpointsChanges: newEndpointsChangeMap(testHostname), + clusterCIDR: "10.0.0.0/24", + hostname: testHostname, + portsMap: make(map[localPort]closeable), + healthChecker: newFakeHealthChecker(), + network: fakeHnsNetwork, } p.syncRunner = async.NewBoundedFrequencyRunner("test-sync-runner", p.syncProxyRules, 0, time.Minute, 1) return p } -func hasJump(rules []iptablestest.Rule, destChain, destIP string, destPort int) bool { - destPortStr := strconv.Itoa(destPort) - match := false - for _, r := range rules { - if r[iptablestest.Jump] == destChain { - match = true - if destIP != "" { - if strings.Contains(r[iptablestest.Destination], destIP) && (strings.Contains(r[iptablestest.DPort], destPortStr) || r[iptablestest.DPort] == "") { - return true - } - match = false - } - if destPort != 0 { - if strings.Contains(r[iptablestest.DPort], destPortStr) && (strings.Contains(r[iptablestest.Destination], destIP) || r[iptablestest.Destination] == "") { - return true - } - match = false - } - } - } - return match -} - -func TestHasJump(t *testing.T) { - testCases := map[string]struct { - rules []iptablestest.Rule - destChain string - destIP string - destPort int - expected bool - }{ - "case 1": { - // Match the 1st rule(both dest IP and dest Port) - rules: []iptablestest.Rule{ - {"-d ": "10.20.30.41/32", "--dport ": "80", "-p ": "tcp", "-j ": "REJECT"}, - {"--dport ": "3001", "-p ": "tcp", "-j ": "KUBE-MARK-MASQ"}, - }, - destChain: "REJECT", - destIP: "10.20.30.41", - destPort: 80, - expected: true, - }, - "case 2": { - // Match the 2nd rule(dest Port) - rules: []iptablestest.Rule{ - {"-d ": "10.20.30.41/32", "-p ": "tcp", "-j ": "REJECT"}, - {"--dport ": "3001", "-p ": "tcp", "-j ": "REJECT"}, - }, - destChain: "REJECT", - destIP: "", - destPort: 3001, - expected: true, - }, - "case 3": { - // Match both dest IP and dest Port - rules: []iptablestest.Rule{ - {"-d ": "1.2.3.4/32", "--dport ": "80", "-p ": "tcp", "-j ": "KUBE-XLB-GF53O3C2HZEXL2XN"}, - }, - destChain: "KUBE-XLB-GF53O3C2HZEXL2XN", - destIP: "1.2.3.4", - destPort: 80, - expected: true, - }, - "case 4": { - // Match dest IP but doesn't match dest Port - rules: []iptablestest.Rule{ - {"-d ": "1.2.3.4/32", "--dport ": "80", "-p ": "tcp", "-j ": "KUBE-XLB-GF53O3C2HZEXL2XN"}, - }, - destChain: "KUBE-XLB-GF53O3C2HZEXL2XN", - destIP: "1.2.3.4", - destPort: 8080, - expected: false, - }, - "case 5": { - // Match dest Port but doesn't match dest IP - rules: []iptablestest.Rule{ - {"-d ": "1.2.3.4/32", "--dport ": "80", "-p ": "tcp", "-j ": "KUBE-XLB-GF53O3C2HZEXL2XN"}, - }, - destChain: "KUBE-XLB-GF53O3C2HZEXL2XN", - destIP: "10.20.30.40", - destPort: 80, - expected: false, - }, - "case 6": { - // Match the 2nd rule(dest IP) - rules: []iptablestest.Rule{ - {"-d ": "10.20.30.41/32", "-p ": "tcp", "-j ": "REJECT"}, - {"-d ": "1.2.3.4/32", "-p ": "tcp", "-j ": "REJECT"}, - {"--dport ": "3001", "-p ": "tcp", "-j ": "REJECT"}, - }, - destChain: "REJECT", - destIP: "1.2.3.4", - destPort: 8080, - expected: true, - }, - "case 7": { - // Match the 2nd rule(dest Port) - rules: []iptablestest.Rule{ - {"-d ": "10.20.30.41/32", "-p ": "tcp", "-j ": "REJECT"}, - {"--dport ": "3001", "-p ": "tcp", "-j ": "REJECT"}, - }, - destChain: "REJECT", - destIP: "1.2.3.4", - destPort: 3001, - expected: true, - }, - "case 8": { - // Match the 1st rule(dest IP) - rules: []iptablestest.Rule{ - {"-d ": "10.20.30.41/32", "-p ": "tcp", "-j ": "REJECT"}, - {"--dport ": "3001", "-p ": "tcp", "-j ": "REJECT"}, - }, - destChain: "REJECT", - destIP: "10.20.30.41", - destPort: 8080, - expected: true, - }, - "case 9": { - rules: []iptablestest.Rule{ - {"-j ": "KUBE-SEP-LWSOSDSHMKPJHHJV"}, - }, - destChain: "KUBE-SEP-LWSOSDSHMKPJHHJV", - destIP: "", - destPort: 0, - expected: true, - }, - "case 10": { - rules: []iptablestest.Rule{ - {"-j ": "KUBE-SEP-FOO"}, - }, - destChain: "KUBE-SEP-BAR", - destIP: "", - destPort: 0, - expected: false, - }, - } - - for k, tc := range testCases { - if got := hasJump(tc.rules, tc.destChain, tc.destIP, tc.destPort); got != tc.expected { - t.Errorf("%v: expected %v, got %v", k, tc.expected, got) - } - } -} - -func hasDNAT(rules []iptablestest.Rule, endpoint string) bool { - for _, r := range rules { - if r[iptablestest.ToDest] == endpoint { - return true - } - } - return false -} - func errorf(msg string, rules []iptablestest.Rule, t *testing.T) { for _, r := range rules { t.Logf("%q", r) @@ -569,100 +280,8 @@ func errorf(msg string, rules []iptablestest.Rule, t *testing.T) { t.Errorf("%v", msg) } -func TestClusterIPReject(t *testing.T) { - ipt := iptablestest.NewFake() - fp := NewFakeProxier(ipt) - svcIP := "10.20.30.41" - svcPort := 80 - svcPortName := proxy.ServicePortName{ - NamespacedName: makeNSN("ns1", "svc1"), - Port: "p80", - } - - makeServiceMap(fp, - makeTestService(svcPortName.Namespace, svcPortName.Namespace, func(svc *api.Service) { - svc.Spec.ClusterIP = svcIP - svc.Spec.Ports = []api.ServicePort{{ - Name: svcPortName.Port, - Port: int32(svcPort), - Protocol: api.ProtocolTCP, - }} - }), - ) - makeEndpointsMap(fp) - fp.syncProxyRules() - - svcChain := string(servicePortChainName(svcPortName.String(), strings.ToLower(string(api.ProtocolTCP)))) - svcRules := ipt.GetRules(svcChain) - if len(svcRules) != 0 { - errorf(fmt.Sprintf("Unexpected rule for chain %v service %v without endpoints", svcChain, svcPortName), svcRules, t) - } - kubeSvcRules := ipt.GetRules(string(kubeServicesChain)) - if !hasJump(kubeSvcRules, iptablestest.Reject, svcIP, svcPort) { - errorf(fmt.Sprintf("Failed to find a %v rule for service %v with no endpoints", iptablestest.Reject, svcPortName), kubeSvcRules, t) - } -} - -func TestClusterIPEndpointsJump(t *testing.T) { - ipt := iptablestest.NewFake() - fp := NewFakeProxier(ipt) - svcIP := "10.20.30.41" - svcPort := 80 - svcPortName := proxy.ServicePortName{ - NamespacedName: makeNSN("ns1", "svc1"), - Port: "p80", - } - - makeServiceMap(fp, - makeTestService(svcPortName.Namespace, svcPortName.Name, func(svc *api.Service) { - svc.Spec.ClusterIP = svcIP - svc.Spec.Ports = []api.ServicePort{{ - Name: svcPortName.Port, - Port: int32(svcPort), - Protocol: api.ProtocolTCP, - }} - }), - ) - - epIP := "10.180.0.1" - makeEndpointsMap(fp, - makeTestEndpoints(svcPortName.Namespace, svcPortName.Name, func(ept *api.Endpoints) { - ept.Subsets = []api.EndpointSubset{{ - Addresses: []api.EndpointAddress{{ - IP: epIP, - }}, - Ports: []api.EndpointPort{{ - Name: svcPortName.Port, - Port: int32(svcPort), - }}, - }} - }), - ) - - fp.syncProxyRules() - - epStr := fmt.Sprintf("%s:%d", epIP, svcPort) - svcChain := string(servicePortChainName(svcPortName.String(), strings.ToLower(string(api.ProtocolTCP)))) - epChain := string(servicePortEndpointChainName(svcPortName.String(), strings.ToLower(string(api.ProtocolTCP)), epStr)) - - kubeSvcRules := ipt.GetRules(string(kubeServicesChain)) - if !hasJump(kubeSvcRules, svcChain, svcIP, svcPort) { - errorf(fmt.Sprintf("Failed to find jump from KUBE-SERVICES to %v chain", svcChain), kubeSvcRules, t) - } - - svcRules := ipt.GetRules(svcChain) - if !hasJump(svcRules, epChain, "", 0) { - errorf(fmt.Sprintf("Failed to jump to ep chain %v", epChain), svcRules, t) - } - epRules := ipt.GetRules(epChain) - if !hasDNAT(epRules, epStr) { - errorf(fmt.Sprintf("Endpoint chain %v lacks DNAT to %v", epChain, epStr), epRules, t) - } -} - func TestLoadBalancer(t *testing.T) { - ipt := iptablestest.NewFake() - fp := NewFakeProxier(ipt) + fp := NewFakeProxier() svcIP := "10.20.30.41" svcPort := 80 svcNodePort := 3001 @@ -710,20 +329,13 @@ func TestLoadBalancer(t *testing.T) { svcChain := string(servicePortChainName(svcPortName.String(), proto)) //lbChain := string(serviceLBChainName(svcPortName.String(), proto)) - kubeSvcRules := ipt.GetRules(string(kubeServicesChain)) - if !hasJump(kubeSvcRules, fwChain, svcLBIP, svcPort) { - errorf(fmt.Sprintf("Failed to find jump to firewall chain %v", fwChain), kubeSvcRules, t) - } + // TODO - fwRules := ipt.GetRules(fwChain) - if !hasJump(fwRules, svcChain, "", 0) || !hasJump(fwRules, string(KubeMarkMasqChain), "", 0) { - errorf(fmt.Sprintf("Failed to find jump from firewall chain %v to svc chain %v", fwChain, svcChain), fwRules, t) - } } func TestNodePort(t *testing.T) { - ipt := iptablestest.NewFake() - fp := NewFakeProxier(ipt) + + fp := NewFakeProxier() svcIP := "10.20.30.41" svcPort := 80 svcNodePort := 3001 @@ -765,15 +377,12 @@ func TestNodePort(t *testing.T) { proto := strings.ToLower(string(api.ProtocolTCP)) svcChain := string(servicePortChainName(svcPortName.String(), proto)) - kubeNodePortRules := ipt.GetRules(string(kubeNodePortsChain)) - if !hasJump(kubeNodePortRules, svcChain, "", svcNodePort) { - errorf(fmt.Sprintf("Failed to find jump to svc chain %v", svcChain), kubeNodePortRules, t) - } + // TODO } func TestExternalIPsReject(t *testing.T) { - ipt := iptablestest.NewFake() - fp := NewFakeProxier(ipt) + + fp := NewFakeProxier() svcIP := "10.20.30.41" svcPort := 80 svcExternalIPs := "50.60.70.81" @@ -799,15 +408,11 @@ func TestExternalIPsReject(t *testing.T) { fp.syncProxyRules() - kubeSvcRules := ipt.GetRules(string(kubeServicesChain)) - if !hasJump(kubeSvcRules, iptablestest.Reject, svcExternalIPs, svcPort) { - errorf(fmt.Sprintf("Failed to a %v rule for externalIP %v with no endpoints", iptablestest.Reject, svcPortName), kubeSvcRules, t) - } } func TestNodePortReject(t *testing.T) { - ipt := iptablestest.NewFake() - fp := NewFakeProxier(ipt) + + fp := NewFakeProxier() svcIP := "10.20.30.41" svcPort := 80 svcNodePort := 3001 @@ -832,10 +437,7 @@ func TestNodePortReject(t *testing.T) { fp.syncProxyRules() - kubeSvcRules := ipt.GetRules(string(kubeServicesChain)) - if !hasJump(kubeSvcRules, iptablestest.Reject, svcIP, svcNodePort) { - errorf(fmt.Sprintf("Failed to find a %v rule for service %v with no endpoints", iptablestest.Reject, svcPortName), kubeSvcRules, t) - } + // TODO } func strPtr(s string) *string { @@ -843,8 +445,8 @@ func strPtr(s string) *string { } func TestOnlyLocalLoadBalancing(t *testing.T) { - ipt := iptablestest.NewFake() - fp := NewFakeProxier(ipt) + + fp := NewFakeProxier() svcIP := "10.20.30.41" svcPort := 80 svcNodePort := 3001 @@ -902,43 +504,24 @@ func TestOnlyLocalLoadBalancing(t *testing.T) { nonLocalEpChain := string(servicePortEndpointChainName(svcPortName.String(), strings.ToLower(string(api.ProtocolTCP)), epStrLocal)) localEpChain := string(servicePortEndpointChainName(svcPortName.String(), strings.ToLower(string(api.ProtocolTCP)), epStrNonLocal)) - kubeSvcRules := ipt.GetRules(string(kubeServicesChain)) - if !hasJump(kubeSvcRules, fwChain, svcLBIP, svcPort) { - errorf(fmt.Sprintf("Failed to find jump to firewall chain %v", fwChain), kubeSvcRules, t) - } - - fwRules := ipt.GetRules(fwChain) - if !hasJump(fwRules, lbChain, "", 0) { - errorf(fmt.Sprintf("Failed to find jump from firewall chain %v to svc chain %v", fwChain, lbChain), fwRules, t) - } - if hasJump(fwRules, string(KubeMarkMasqChain), "", 0) { - errorf(fmt.Sprintf("Found jump from fw chain %v to MASQUERADE", fwChain), fwRules, t) - } - - lbRules := ipt.GetRules(lbChain) - if hasJump(lbRules, nonLocalEpChain, "", 0) { - errorf(fmt.Sprintf("Found jump from lb chain %v to non-local ep %v", lbChain, epStrLocal), lbRules, t) - } - if !hasJump(lbRules, localEpChain, "", 0) { - errorf(fmt.Sprintf("Didn't find jump from lb chain %v to local ep %v", lbChain, epStrNonLocal), lbRules, t) - } + // TODO } func TestOnlyLocalNodePortsNoClusterCIDR(t *testing.T) { - ipt := iptablestest.NewFake() - fp := NewFakeProxier(ipt) + + fp := NewFakeProxier() // set cluster CIDR to empty before test fp.clusterCIDR = "" - onlyLocalNodePorts(t, fp, ipt) + onlyLocalNodePorts(t, fp) } func TestOnlyLocalNodePorts(t *testing.T) { - ipt := iptablestest.NewFake() - fp := NewFakeProxier(ipt) - onlyLocalNodePorts(t, fp, ipt) + + fp := NewFakeProxier() + onlyLocalNodePorts(t, fp) } -func onlyLocalNodePorts(t *testing.T, fp *Proxier, ipt *iptablestest.FakeIPTables) { +func onlyLocalNodePorts(t *testing.T, fp *Proxier) { shouldLBTOSVCRuleExist := len(fp.clusterCIDR) > 0 svcIP := "10.20.30.41" svcPort := 80 @@ -986,32 +569,7 @@ func onlyLocalNodePorts(t *testing.T, fp *Proxier, ipt *iptablestest.FakeIPTable fp.syncProxyRules() - proto := strings.ToLower(string(api.ProtocolTCP)) - lbChain := string(serviceLBChainName(svcPortName.String(), proto)) - - nonLocalEpChain := string(servicePortEndpointChainName(svcPortName.String(), proto, epStrLocal)) - localEpChain := string(servicePortEndpointChainName(svcPortName.String(), proto, epStrNonLocal)) - - kubeNodePortRules := ipt.GetRules(string(kubeNodePortsChain)) - if !hasJump(kubeNodePortRules, lbChain, "", svcNodePort) { - errorf(fmt.Sprintf("Failed to find jump to lb chain %v", lbChain), kubeNodePortRules, t) - } - - svcChain := string(servicePortChainName(svcPortName.String(), proto)) - lbRules := ipt.GetRules(lbChain) - if hasJump(lbRules, nonLocalEpChain, "", 0) { - errorf(fmt.Sprintf("Found jump from lb chain %v to non-local ep %v", lbChain, epStrLocal), lbRules, t) - } - if hasJump(lbRules, svcChain, "", 0) != shouldLBTOSVCRuleExist { - prefix := "Did not find " - if !shouldLBTOSVCRuleExist { - prefix = "Found " - } - errorf(fmt.Sprintf("%s jump from lb chain %v to svc %v", prefix, lbChain, svcChain), lbRules, t) - } - if !hasJump(lbRules, localEpChain, "", 0) { - errorf(fmt.Sprintf("Didn't find jump from lb chain %v to local ep %v", lbChain, epStrLocal), lbRules, t) - } + // TODO } func makeTestService(namespace, name string, svcFunc func(*api.Service)) *api.Service { @@ -1040,8 +598,8 @@ func addTestPort(array []api.ServicePort, name string, protocol api.Protocol, po } func TestBuildServiceMapAddRemove(t *testing.T) { - ipt := iptablestest.NewFake() - fp := NewFakeProxier(ipt) + + fp := NewFakeProxier() services := []*api.Service{ makeTestService("somewhere-else", "cluster-ip", func(svc *api.Service) { @@ -1146,8 +704,8 @@ func TestBuildServiceMapAddRemove(t *testing.T) { } func TestBuildServiceMapServiceHeadless(t *testing.T) { - ipt := iptablestest.NewFake() - fp := NewFakeProxier(ipt) + + fp := NewFakeProxier() makeServiceMap(fp, makeTestService("somewhere-else", "headless", func(svc *api.Service) { @@ -1178,8 +736,8 @@ func TestBuildServiceMapServiceHeadless(t *testing.T) { } func TestBuildServiceMapServiceTypeExternalName(t *testing.T) { - ipt := iptablestest.NewFake() - fp := NewFakeProxier(ipt) + + fp := NewFakeProxier() makeServiceMap(fp, makeTestService("somewhere-else", "external-name", func(svc *api.Service) { @@ -1204,8 +762,7 @@ func TestBuildServiceMapServiceTypeExternalName(t *testing.T) { } func TestBuildServiceMapServiceUpdate(t *testing.T) { - ipt := iptablestest.NewFake() - fp := NewFakeProxier(ipt) + fp := NewFakeProxier() servicev1 := makeTestService("somewhere", "some-service", func(svc *api.Service) { svc.Spec.Type = api.ServiceTypeClusterIP @@ -2415,8 +1972,8 @@ func Test_updateEndpointsMap(t *testing.T) { } for tci, tc := range testCases { - ipt := iptablestest.NewFake() - fp := NewFakeProxier(ipt) + + fp := NewFakeProxier() fp.hostname = nodeName // First check that after adding all previous versions of endpoints, diff --git a/vendor/github.com/Microsoft/go-winio/BUILD b/vendor/github.com/Microsoft/go-winio/BUILD index 1b01469a49..ba46acfa21 100644 --- a/vendor/github.com/Microsoft/go-winio/BUILD +++ b/vendor/github.com/Microsoft/go-winio/BUILD @@ -3,6 +3,7 @@ load("@io_bazel_rules_go//go:def.bzl", "go_library") go_library( name = "go_default_library", srcs = [ + "ea.go", "reparse.go", "syscall.go", ] + select({ diff --git a/vendor/github.com/Microsoft/go-winio/backup.go b/vendor/github.com/Microsoft/go-winio/backup.go index 27d6ace0c9..2be34af431 100644 --- a/vendor/github.com/Microsoft/go-winio/backup.go +++ b/vendor/github.com/Microsoft/go-winio/backup.go @@ -68,10 +68,20 @@ func NewBackupStreamReader(r io.Reader) *BackupStreamReader { return &BackupStreamReader{r, 0} } -// Next returns the next backup stream and prepares for calls to Write(). It skips the remainder of the current stream if +// Next returns the next backup stream and prepares for calls to Read(). It skips the remainder of the current stream if // it was not completely read. func (r *BackupStreamReader) Next() (*BackupHeader, error) { if r.bytesLeft > 0 { + if s, ok := r.r.(io.Seeker); ok { + // Make sure Seek on io.SeekCurrent sometimes succeeds + // before trying the actual seek. + if _, err := s.Seek(0, io.SeekCurrent); err == nil { + if _, err = s.Seek(r.bytesLeft, io.SeekCurrent); err != nil { + return nil, err + } + r.bytesLeft = 0 + } + } if _, err := io.Copy(ioutil.Discard, r); err != nil { return nil, err } @@ -220,7 +230,7 @@ type BackupFileWriter struct { ctx uintptr } -// NewBackupFileWrtier returns a new BackupFileWriter from a file handle. If includeSecurity is true, +// NewBackupFileWriter returns a new BackupFileWriter from a file handle. If includeSecurity is true, // Write() will attempt to restore the security descriptor from the stream. func NewBackupFileWriter(f *os.File, includeSecurity bool) *BackupFileWriter { w := &BackupFileWriter{f, includeSecurity, 0} diff --git a/vendor/github.com/Microsoft/go-winio/ea.go b/vendor/github.com/Microsoft/go-winio/ea.go new file mode 100644 index 0000000000..b37e930d6a --- /dev/null +++ b/vendor/github.com/Microsoft/go-winio/ea.go @@ -0,0 +1,137 @@ +package winio + +import ( + "bytes" + "encoding/binary" + "errors" +) + +type fileFullEaInformation struct { + NextEntryOffset uint32 + Flags uint8 + NameLength uint8 + ValueLength uint16 +} + +var ( + fileFullEaInformationSize = binary.Size(&fileFullEaInformation{}) + + errInvalidEaBuffer = errors.New("invalid extended attribute buffer") + errEaNameTooLarge = errors.New("extended attribute name too large") + errEaValueTooLarge = errors.New("extended attribute value too large") +) + +// ExtendedAttribute represents a single Windows EA. +type ExtendedAttribute struct { + Name string + Value []byte + Flags uint8 +} + +func parseEa(b []byte) (ea ExtendedAttribute, nb []byte, err error) { + var info fileFullEaInformation + err = binary.Read(bytes.NewReader(b), binary.LittleEndian, &info) + if err != nil { + err = errInvalidEaBuffer + return + } + + nameOffset := fileFullEaInformationSize + nameLen := int(info.NameLength) + valueOffset := nameOffset + int(info.NameLength) + 1 + valueLen := int(info.ValueLength) + nextOffset := int(info.NextEntryOffset) + if valueLen+valueOffset > len(b) || nextOffset < 0 || nextOffset > len(b) { + err = errInvalidEaBuffer + return + } + + ea.Name = string(b[nameOffset : nameOffset+nameLen]) + ea.Value = b[valueOffset : valueOffset+valueLen] + ea.Flags = info.Flags + if info.NextEntryOffset != 0 { + nb = b[info.NextEntryOffset:] + } + return +} + +// DecodeExtendedAttributes decodes a list of EAs from a FILE_FULL_EA_INFORMATION +// buffer retrieved from BackupRead, ZwQueryEaFile, etc. +func DecodeExtendedAttributes(b []byte) (eas []ExtendedAttribute, err error) { + for len(b) != 0 { + ea, nb, err := parseEa(b) + if err != nil { + return nil, err + } + + eas = append(eas, ea) + b = nb + } + return +} + +func writeEa(buf *bytes.Buffer, ea *ExtendedAttribute, last bool) error { + if int(uint8(len(ea.Name))) != len(ea.Name) { + return errEaNameTooLarge + } + if int(uint16(len(ea.Value))) != len(ea.Value) { + return errEaValueTooLarge + } + entrySize := uint32(fileFullEaInformationSize + len(ea.Name) + 1 + len(ea.Value)) + withPadding := (entrySize + 3) &^ 3 + nextOffset := uint32(0) + if !last { + nextOffset = withPadding + } + info := fileFullEaInformation{ + NextEntryOffset: nextOffset, + Flags: ea.Flags, + NameLength: uint8(len(ea.Name)), + ValueLength: uint16(len(ea.Value)), + } + + err := binary.Write(buf, binary.LittleEndian, &info) + if err != nil { + return err + } + + _, err = buf.Write([]byte(ea.Name)) + if err != nil { + return err + } + + err = buf.WriteByte(0) + if err != nil { + return err + } + + _, err = buf.Write(ea.Value) + if err != nil { + return err + } + + _, err = buf.Write([]byte{0, 0, 0}[0 : withPadding-entrySize]) + if err != nil { + return err + } + + return nil +} + +// EncodeExtendedAttributes encodes a list of EAs into a FILE_FULL_EA_INFORMATION +// buffer for use with BackupWrite, ZwSetEaFile, etc. +func EncodeExtendedAttributes(eas []ExtendedAttribute) ([]byte, error) { + var buf bytes.Buffer + for i := range eas { + last := false + if i == len(eas)-1 { + last = true + } + + err := writeEa(&buf, &eas[i], last) + if err != nil { + return nil, err + } + } + return buf.Bytes(), nil +} diff --git a/vendor/github.com/Microsoft/go-winio/file.go b/vendor/github.com/Microsoft/go-winio/file.go index 613f31b520..57ac3696a9 100644 --- a/vendor/github.com/Microsoft/go-winio/file.go +++ b/vendor/github.com/Microsoft/go-winio/file.go @@ -23,6 +23,13 @@ type atomicBool int32 func (b *atomicBool) isSet() bool { return atomic.LoadInt32((*int32)(b)) != 0 } func (b *atomicBool) setFalse() { atomic.StoreInt32((*int32)(b), 0) } func (b *atomicBool) setTrue() { atomic.StoreInt32((*int32)(b), 1) } +func (b *atomicBool) swap(new bool) bool { + var newInt int32 + if new { + newInt = 1 + } + return atomic.SwapInt32((*int32)(b), newInt) == 1 +} const ( cFILE_SKIP_COMPLETION_PORT_ON_SUCCESS = 1 @@ -71,7 +78,8 @@ func initIo() { type win32File struct { handle syscall.Handle wg sync.WaitGroup - closing bool + wgLock sync.RWMutex + closing atomicBool readDeadline deadlineHandler writeDeadline deadlineHandler } @@ -107,14 +115,18 @@ func MakeOpenFile(h syscall.Handle) (io.ReadWriteCloser, error) { // closeHandle closes the resources associated with a Win32 handle func (f *win32File) closeHandle() { - if !f.closing { + f.wgLock.Lock() + // Atomically set that we are closing, releasing the resources only once. + if !f.closing.swap(true) { + f.wgLock.Unlock() // cancel all IO and wait for it to complete - f.closing = true cancelIoEx(f.handle, nil) f.wg.Wait() // at this point, no new IO can start syscall.Close(f.handle) f.handle = 0 + } else { + f.wgLock.Unlock() } } @@ -127,10 +139,13 @@ func (f *win32File) Close() error { // prepareIo prepares for a new IO operation. // The caller must call f.wg.Done() when the IO is finished, prior to Close() returning. func (f *win32File) prepareIo() (*ioOperation, error) { - f.wg.Add(1) - if f.closing { + f.wgLock.RLock() + if f.closing.isSet() { + f.wgLock.RUnlock() return nil, ErrFileClosed } + f.wg.Add(1) + f.wgLock.RUnlock() c := &ioOperation{} c.ch = make(chan ioResult) return c, nil @@ -159,7 +174,7 @@ func (f *win32File) asyncIo(c *ioOperation, d *deadlineHandler, bytes uint32, er return int(bytes), err } - if f.closing { + if f.closing.isSet() { cancelIoEx(f.handle, &c.o) } @@ -175,7 +190,7 @@ func (f *win32File) asyncIo(c *ioOperation, d *deadlineHandler, bytes uint32, er case r = <-c.ch: err = r.err if err == syscall.ERROR_OPERATION_ABORTED { - if f.closing { + if f.closing.isSet() { err = ErrFileClosed } } diff --git a/vendor/github.com/Microsoft/go-winio/pipe.go b/vendor/github.com/Microsoft/go-winio/pipe.go index da706cc8a7..44340b8167 100644 --- a/vendor/github.com/Microsoft/go-winio/pipe.go +++ b/vendor/github.com/Microsoft/go-winio/pipe.go @@ -265,9 +265,9 @@ func (l *win32PipeListener) listenerRoutine() { if err == nil { // Wait for the client to connect. ch := make(chan error) - go func() { + go func(p *win32File) { ch <- connectPipe(p) - }() + }(p) select { case err = <-ch: if err != nil { diff --git a/vendor/github.com/Microsoft/hcsshim/BUILD b/vendor/github.com/Microsoft/hcsshim/BUILD new file mode 100644 index 0000000000..966f658b69 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/BUILD @@ -0,0 +1,63 @@ +load("@io_bazel_rules_go//go:def.bzl", "go_library") + +go_library( + name = "go_default_library", + srcs = [ + "activatelayer.go", + "baselayer.go", + "callback.go", + "cgo.go", + "container.go", + "createlayer.go", + "createsandboxlayer.go", + "deactivatelayer.go", + "destroylayer.go", + "errors.go", + "expandsandboxsize.go", + "exportlayer.go", + "getlayermountpath.go", + "getsharedbaseimages.go", + "guid.go", + "hcsshim.go", + "hnsendpoint.go", + "hnsfuncs.go", + "hnsnetwork.go", + "hnspolicy.go", + "hnspolicylist.go", + "importlayer.go", + "interface.go", + "layerexists.go", + "layerutils.go", + "legacy.go", + "nametoguid.go", + "preparelayer.go", + "process.go", + "processimage.go", + "unpreparelayer.go", + "utils.go", + "version.go", + "waithelper.go", + "zhcsshim.go", + ], + cgo = True, + visibility = ["//visibility:public"], + deps = [ + "//vendor/github.com/Microsoft/go-winio:go_default_library", + "//vendor/github.com/sirupsen/logrus:go_default_library", + "//vendor/golang.org/x/sys/windows:go_default_library", + ], +) + +filegroup( + name = "package-srcs", + srcs = glob(["**"]), + tags = ["automanaged"], + visibility = ["//visibility:private"], +) + +filegroup( + name = "all-srcs", + srcs = [":package-srcs"], + tags = ["automanaged"], + visibility = ["//visibility:public"], +) diff --git a/vendor/github.com/Microsoft/hcsshim/LICENSE b/vendor/github.com/Microsoft/hcsshim/LICENSE new file mode 100644 index 0000000000..49d21669ae --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/LICENSE @@ -0,0 +1,21 @@ +The MIT License (MIT) + +Copyright (c) 2015 Microsoft + +Permission is hereby granted, free of charge, to any person obtaining a copy +of this software and associated documentation files (the "Software"), to deal +in the Software without restriction, including without limitation the rights +to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the Software is +furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in all +copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE +SOFTWARE. \ No newline at end of file diff --git a/vendor/github.com/Microsoft/hcsshim/README.md b/vendor/github.com/Microsoft/hcsshim/README.md new file mode 100644 index 0000000000..30991a12e4 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/README.md @@ -0,0 +1,12 @@ +# hcsshim + +This package supports launching Windows Server containers from Go. It is +primarily used in the [Docker Engine](https://github.com/docker/docker) project, +but it can be freely used by other projects as well. + +This project has adopted the [Microsoft Open Source Code of +Conduct](https://opensource.microsoft.com/codeofconduct/). For more information +see the [Code of Conduct +FAQ](https://opensource.microsoft.com/codeofconduct/faq/) or contact +[opencode@microsoft.com](mailto:opencode@microsoft.com) with any additional +questions or comments. diff --git a/vendor/github.com/Microsoft/hcsshim/activatelayer.go b/vendor/github.com/Microsoft/hcsshim/activatelayer.go new file mode 100644 index 0000000000..6d824d7a79 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/activatelayer.go @@ -0,0 +1,28 @@ +package hcsshim + +import "github.com/sirupsen/logrus" + +// ActivateLayer will find the layer with the given id and mount it's filesystem. +// For a read/write layer, the mounted filesystem will appear as a volume on the +// host, while a read-only layer is generally expected to be a no-op. +// An activated layer must later be deactivated via DeactivateLayer. +func ActivateLayer(info DriverInfo, id string) error { + title := "hcsshim::ActivateLayer " + logrus.Debugf(title+"Flavour %d ID %s", info.Flavour, id) + + infop, err := convertDriverInfo(info) + if err != nil { + logrus.Error(err) + return err + } + + err = activateLayer(&infop, id) + if err != nil { + err = makeErrorf(err, title, "id=%s flavour=%d", id, info.Flavour) + logrus.Error(err) + return err + } + + logrus.Debugf(title+" - succeeded id=%s flavour=%d", id, info.Flavour) + return nil +} diff --git a/vendor/github.com/Microsoft/hcsshim/baselayer.go b/vendor/github.com/Microsoft/hcsshim/baselayer.go new file mode 100644 index 0000000000..9babd4e18a --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/baselayer.go @@ -0,0 +1,183 @@ +package hcsshim + +import ( + "errors" + "os" + "path/filepath" + "syscall" + + "github.com/Microsoft/go-winio" +) + +type baseLayerWriter struct { + root string + f *os.File + bw *winio.BackupFileWriter + err error + hasUtilityVM bool + dirInfo []dirInfo +} + +type dirInfo struct { + path string + fileInfo winio.FileBasicInfo +} + +// reapplyDirectoryTimes reapplies directory modification, creation, etc. times +// after processing of the directory tree has completed. The times are expected +// to be ordered such that parent directories come before child directories. +func reapplyDirectoryTimes(dis []dirInfo) error { + for i := range dis { + di := &dis[len(dis)-i-1] // reverse order: process child directories first + f, err := winio.OpenForBackup(di.path, syscall.GENERIC_READ|syscall.GENERIC_WRITE, syscall.FILE_SHARE_READ, syscall.OPEN_EXISTING) + if err != nil { + return err + } + + err = winio.SetFileBasicInfo(f, &di.fileInfo) + f.Close() + if err != nil { + return err + } + } + return nil +} + +func (w *baseLayerWriter) closeCurrentFile() error { + if w.f != nil { + err := w.bw.Close() + err2 := w.f.Close() + w.f = nil + w.bw = nil + if err != nil { + return err + } + if err2 != nil { + return err2 + } + } + return nil +} + +func (w *baseLayerWriter) Add(name string, fileInfo *winio.FileBasicInfo) (err error) { + defer func() { + if err != nil { + w.err = err + } + }() + + err = w.closeCurrentFile() + if err != nil { + return err + } + + if filepath.ToSlash(name) == `UtilityVM/Files` { + w.hasUtilityVM = true + } + + path := filepath.Join(w.root, name) + path, err = makeLongAbsPath(path) + if err != nil { + return err + } + + var f *os.File + defer func() { + if f != nil { + f.Close() + } + }() + + createmode := uint32(syscall.CREATE_NEW) + if fileInfo.FileAttributes&syscall.FILE_ATTRIBUTE_DIRECTORY != 0 { + err := os.Mkdir(path, 0) + if err != nil && !os.IsExist(err) { + return err + } + createmode = syscall.OPEN_EXISTING + if fileInfo.FileAttributes&syscall.FILE_ATTRIBUTE_REPARSE_POINT == 0 { + w.dirInfo = append(w.dirInfo, dirInfo{path, *fileInfo}) + } + } + + mode := uint32(syscall.GENERIC_READ | syscall.GENERIC_WRITE | winio.WRITE_DAC | winio.WRITE_OWNER | winio.ACCESS_SYSTEM_SECURITY) + f, err = winio.OpenForBackup(path, mode, syscall.FILE_SHARE_READ, createmode) + if err != nil { + return makeError(err, "Failed to OpenForBackup", path) + } + + err = winio.SetFileBasicInfo(f, fileInfo) + if err != nil { + return makeError(err, "Failed to SetFileBasicInfo", path) + } + + w.f = f + w.bw = winio.NewBackupFileWriter(f, true) + f = nil + return nil +} + +func (w *baseLayerWriter) AddLink(name string, target string) (err error) { + defer func() { + if err != nil { + w.err = err + } + }() + + err = w.closeCurrentFile() + if err != nil { + return err + } + + linkpath, err := makeLongAbsPath(filepath.Join(w.root, name)) + if err != nil { + return err + } + + linktarget, err := makeLongAbsPath(filepath.Join(w.root, target)) + if err != nil { + return err + } + + return os.Link(linktarget, linkpath) +} + +func (w *baseLayerWriter) Remove(name string) error { + return errors.New("base layer cannot have tombstones") +} + +func (w *baseLayerWriter) Write(b []byte) (int, error) { + n, err := w.bw.Write(b) + if err != nil { + w.err = err + } + return n, err +} + +func (w *baseLayerWriter) Close() error { + err := w.closeCurrentFile() + if err != nil { + return err + } + if w.err == nil { + // Restore the file times of all the directories, since they may have + // been modified by creating child directories. + err = reapplyDirectoryTimes(w.dirInfo) + if err != nil { + return err + } + + err = ProcessBaseLayer(w.root) + if err != nil { + return err + } + + if w.hasUtilityVM { + err = ProcessUtilityVMImage(filepath.Join(w.root, "UtilityVM")) + if err != nil { + return err + } + } + } + return w.err +} diff --git a/vendor/github.com/Microsoft/hcsshim/callback.go b/vendor/github.com/Microsoft/hcsshim/callback.go new file mode 100644 index 0000000000..e8c2b00c8a --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/callback.go @@ -0,0 +1,79 @@ +package hcsshim + +import ( + "sync" + "syscall" +) + +var ( + nextCallback uintptr + callbackMap = map[uintptr]*notifcationWatcherContext{} + callbackMapLock = sync.RWMutex{} + + notificationWatcherCallback = syscall.NewCallback(notificationWatcher) + + // Notifications for HCS_SYSTEM handles + hcsNotificationSystemExited hcsNotification = 0x00000001 + hcsNotificationSystemCreateCompleted hcsNotification = 0x00000002 + hcsNotificationSystemStartCompleted hcsNotification = 0x00000003 + hcsNotificationSystemPauseCompleted hcsNotification = 0x00000004 + hcsNotificationSystemResumeCompleted hcsNotification = 0x00000005 + + // Notifications for HCS_PROCESS handles + hcsNotificationProcessExited hcsNotification = 0x00010000 + + // Common notifications + hcsNotificationInvalid hcsNotification = 0x00000000 + hcsNotificationServiceDisconnect hcsNotification = 0x01000000 +) + +type hcsNotification uint32 +type notificationChannel chan error + +type notifcationWatcherContext struct { + channels notificationChannels + handle hcsCallback +} + +type notificationChannels map[hcsNotification]notificationChannel + +func newChannels() notificationChannels { + channels := make(notificationChannels) + + channels[hcsNotificationSystemExited] = make(notificationChannel, 1) + channels[hcsNotificationSystemCreateCompleted] = make(notificationChannel, 1) + channels[hcsNotificationSystemStartCompleted] = make(notificationChannel, 1) + channels[hcsNotificationSystemPauseCompleted] = make(notificationChannel, 1) + channels[hcsNotificationSystemResumeCompleted] = make(notificationChannel, 1) + channels[hcsNotificationProcessExited] = make(notificationChannel, 1) + channels[hcsNotificationServiceDisconnect] = make(notificationChannel, 1) + return channels +} +func closeChannels(channels notificationChannels) { + close(channels[hcsNotificationSystemExited]) + close(channels[hcsNotificationSystemCreateCompleted]) + close(channels[hcsNotificationSystemStartCompleted]) + close(channels[hcsNotificationSystemPauseCompleted]) + close(channels[hcsNotificationSystemResumeCompleted]) + close(channels[hcsNotificationProcessExited]) + close(channels[hcsNotificationServiceDisconnect]) +} + +func notificationWatcher(notificationType hcsNotification, callbackNumber uintptr, notificationStatus uintptr, notificationData *uint16) uintptr { + var result error + if int32(notificationStatus) < 0 { + result = syscall.Errno(win32FromHresult(notificationStatus)) + } + + callbackMapLock.RLock() + context := callbackMap[callbackNumber] + callbackMapLock.RUnlock() + + if context == nil { + return 0 + } + + context.channels[notificationType] <- result + + return 0 +} diff --git a/vendor/github.com/Microsoft/hcsshim/cgo.go b/vendor/github.com/Microsoft/hcsshim/cgo.go new file mode 100644 index 0000000000..2003332330 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/cgo.go @@ -0,0 +1,7 @@ +package hcsshim + +import "C" + +// This import is needed to make the library compile as CGO because HCSSHIM +// only works with CGO due to callbacks from HCS comming back from a C thread +// which is not supported without CGO. See https://github.com/golang/go/issues/10973 diff --git a/vendor/github.com/Microsoft/hcsshim/container.go b/vendor/github.com/Microsoft/hcsshim/container.go new file mode 100644 index 0000000000..b924d39f46 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/container.go @@ -0,0 +1,794 @@ +package hcsshim + +import ( + "encoding/json" + "fmt" + "os" + "sync" + "syscall" + "time" + + "github.com/sirupsen/logrus" +) + +var ( + defaultTimeout = time.Minute * 4 +) + +const ( + pendingUpdatesQuery = `{ "PropertyTypes" : ["PendingUpdates"]}` + statisticsQuery = `{ "PropertyTypes" : ["Statistics"]}` + processListQuery = `{ "PropertyTypes" : ["ProcessList"]}` + mappedVirtualDiskQuery = `{ "PropertyTypes" : ["MappedVirtualDisk"]}` +) + +type container struct { + handleLock sync.RWMutex + handle hcsSystem + id string + callbackNumber uintptr +} + +// ContainerProperties holds the properties for a container and the processes running in that container +type ContainerProperties struct { + ID string `json:"Id"` + Name string + SystemType string + Owner string + SiloGUID string `json:"SiloGuid,omitempty"` + RuntimeID string `json:"RuntimeId,omitempty"` + IsRuntimeTemplate bool `json:",omitempty"` + RuntimeImagePath string `json:",omitempty"` + Stopped bool `json:",omitempty"` + ExitType string `json:",omitempty"` + AreUpdatesPending bool `json:",omitempty"` + ObRoot string `json:",omitempty"` + Statistics Statistics `json:",omitempty"` + ProcessList []ProcessListItem `json:",omitempty"` + MappedVirtualDiskControllers map[int]MappedVirtualDiskController `json:",omitempty"` +} + +// MemoryStats holds the memory statistics for a container +type MemoryStats struct { + UsageCommitBytes uint64 `json:"MemoryUsageCommitBytes,omitempty"` + UsageCommitPeakBytes uint64 `json:"MemoryUsageCommitPeakBytes,omitempty"` + UsagePrivateWorkingSetBytes uint64 `json:"MemoryUsagePrivateWorkingSetBytes,omitempty"` +} + +// ProcessorStats holds the processor statistics for a container +type ProcessorStats struct { + TotalRuntime100ns uint64 `json:",omitempty"` + RuntimeUser100ns uint64 `json:",omitempty"` + RuntimeKernel100ns uint64 `json:",omitempty"` +} + +// StorageStats holds the storage statistics for a container +type StorageStats struct { + ReadCountNormalized uint64 `json:",omitempty"` + ReadSizeBytes uint64 `json:",omitempty"` + WriteCountNormalized uint64 `json:",omitempty"` + WriteSizeBytes uint64 `json:",omitempty"` +} + +// NetworkStats holds the network statistics for a container +type NetworkStats struct { + BytesReceived uint64 `json:",omitempty"` + BytesSent uint64 `json:",omitempty"` + PacketsReceived uint64 `json:",omitempty"` + PacketsSent uint64 `json:",omitempty"` + DroppedPacketsIncoming uint64 `json:",omitempty"` + DroppedPacketsOutgoing uint64 `json:",omitempty"` + EndpointId string `json:",omitempty"` + InstanceId string `json:",omitempty"` +} + +// Statistics is the structure returned by a statistics call on a container +type Statistics struct { + Timestamp time.Time `json:",omitempty"` + ContainerStartTime time.Time `json:",omitempty"` + Uptime100ns uint64 `json:",omitempty"` + Memory MemoryStats `json:",omitempty"` + Processor ProcessorStats `json:",omitempty"` + Storage StorageStats `json:",omitempty"` + Network []NetworkStats `json:",omitempty"` +} + +// ProcessList is the structure of an item returned by a ProcessList call on a container +type ProcessListItem struct { + CreateTimestamp time.Time `json:",omitempty"` + ImageName string `json:",omitempty"` + KernelTime100ns uint64 `json:",omitempty"` + MemoryCommitBytes uint64 `json:",omitempty"` + MemoryWorkingSetPrivateBytes uint64 `json:",omitempty"` + MemoryWorkingSetSharedBytes uint64 `json:",omitempty"` + ProcessId uint32 `json:",omitempty"` + UserTime100ns uint64 `json:",omitempty"` +} + +// MappedVirtualDiskController is the structure of an item returned by a MappedVirtualDiskList call on a container +type MappedVirtualDiskController struct { + MappedVirtualDisks map[int]MappedVirtualDisk `json:",omitempty"` +} + +// Type of Request Support in ModifySystem +type RequestType string + +// Type of Resource Support in ModifySystem +type ResourceType string + +// RequestType const +const ( + Add RequestType = "Add" + Remove RequestType = "Remove" + Network ResourceType = "Network" +) + +// ResourceModificationRequestResponse is the structure used to send request to the container to modify the system +// Supported resource types are Network and Request Types are Add/Remove +type ResourceModificationRequestResponse struct { + Resource ResourceType `json:"ResourceType"` + Data interface{} `json:"Settings"` + Request RequestType `json:"RequestType,omitempty"` +} + +// createContainerAdditionalJSON is read from the environment at initialisation +// time. It allows an environment variable to define additional JSON which +// is merged in the CreateContainer call to HCS. +var createContainerAdditionalJSON string + +func init() { + createContainerAdditionalJSON = os.Getenv("HCSSHIM_CREATECONTAINER_ADDITIONALJSON") +} + +// CreateContainer creates a new container with the given configuration but does not start it. +func CreateContainer(id string, c *ContainerConfig) (Container, error) { + return createContainerWithJSON(id, c, "") +} + +// CreateContainerWithJSON creates a new container with the given configuration but does not start it. +// It is identical to CreateContainer except that optional additional JSON can be merged before passing to HCS. +func CreateContainerWithJSON(id string, c *ContainerConfig, additionalJSON string) (Container, error) { + return createContainerWithJSON(id, c, additionalJSON) +} + +func createContainerWithJSON(id string, c *ContainerConfig, additionalJSON string) (Container, error) { + operation := "CreateContainer" + title := "HCSShim::" + operation + + container := &container{ + id: id, + } + + configurationb, err := json.Marshal(c) + if err != nil { + return nil, err + } + + configuration := string(configurationb) + logrus.Debugf(title+" id=%s config=%s", id, configuration) + + // Merge any additional JSON. Priority is given to what is passed in explicitly, + // falling back to what's set in the environment. + if additionalJSON == "" && createContainerAdditionalJSON != "" { + additionalJSON = createContainerAdditionalJSON + } + if additionalJSON != "" { + configurationMap := map[string]interface{}{} + if err := json.Unmarshal([]byte(configuration), &configurationMap); err != nil { + return nil, fmt.Errorf("failed to unmarshal %s: %s", configuration, err) + } + + additionalMap := map[string]interface{}{} + if err := json.Unmarshal([]byte(additionalJSON), &additionalMap); err != nil { + return nil, fmt.Errorf("failed to unmarshal %s: %s", additionalJSON, err) + } + + mergedMap := mergeMaps(additionalMap, configurationMap) + mergedJSON, err := json.Marshal(mergedMap) + if err != nil { + return nil, fmt.Errorf("failed to marshal merged configuration map %+v: %s", mergedMap, err) + } + + configuration = string(mergedJSON) + logrus.Debugf(title+" id=%s merged config=%s", id, configuration) + } + + var ( + resultp *uint16 + identity syscall.Handle + ) + createError := hcsCreateComputeSystem(id, configuration, identity, &container.handle, &resultp) + + if createError == nil || IsPending(createError) { + if err := container.registerCallback(); err != nil { + return nil, makeContainerError(container, operation, "", err) + } + } + + err = processAsyncHcsResult(createError, resultp, container.callbackNumber, hcsNotificationSystemCreateCompleted, &defaultTimeout) + if err != nil { + return nil, makeContainerError(container, operation, configuration, err) + } + + logrus.Debugf(title+" succeeded id=%s handle=%d", id, container.handle) + return container, nil +} + +// mergeMaps recursively merges map `fromMap` into map `ToMap`. Any pre-existing values +// in ToMap are overwritten. Values in fromMap are added to ToMap. +// From http://stackoverflow.com/questions/40491438/merging-two-json-strings-in-golang +func mergeMaps(fromMap, ToMap interface{}) interface{} { + switch fromMap := fromMap.(type) { + case map[string]interface{}: + ToMap, ok := ToMap.(map[string]interface{}) + if !ok { + return fromMap + } + for keyToMap, valueToMap := range ToMap { + if valueFromMap, ok := fromMap[keyToMap]; ok { + fromMap[keyToMap] = mergeMaps(valueFromMap, valueToMap) + } else { + fromMap[keyToMap] = valueToMap + } + } + case nil: + // merge(nil, map[string]interface{...}) -> map[string]interface{...} + ToMap, ok := ToMap.(map[string]interface{}) + if ok { + return ToMap + } + } + return fromMap +} + +// OpenContainer opens an existing container by ID. +func OpenContainer(id string) (Container, error) { + operation := "OpenContainer" + title := "HCSShim::" + operation + logrus.Debugf(title+" id=%s", id) + + container := &container{ + id: id, + } + + var ( + handle hcsSystem + resultp *uint16 + ) + err := hcsOpenComputeSystem(id, &handle, &resultp) + err = processHcsResult(err, resultp) + if err != nil { + return nil, makeContainerError(container, operation, "", err) + } + + container.handle = handle + + if err := container.registerCallback(); err != nil { + return nil, makeContainerError(container, operation, "", err) + } + + logrus.Debugf(title+" succeeded id=%s handle=%d", id, handle) + return container, nil +} + +// GetContainers gets a list of the containers on the system that match the query +func GetContainers(q ComputeSystemQuery) ([]ContainerProperties, error) { + operation := "GetContainers" + title := "HCSShim::" + operation + + queryb, err := json.Marshal(q) + if err != nil { + return nil, err + } + + query := string(queryb) + logrus.Debugf(title+" query=%s", query) + + var ( + resultp *uint16 + computeSystemsp *uint16 + ) + err = hcsEnumerateComputeSystems(query, &computeSystemsp, &resultp) + err = processHcsResult(err, resultp) + if err != nil { + return nil, err + } + + if computeSystemsp == nil { + return nil, ErrUnexpectedValue + } + computeSystemsRaw := convertAndFreeCoTaskMemBytes(computeSystemsp) + computeSystems := []ContainerProperties{} + if err := json.Unmarshal(computeSystemsRaw, &computeSystems); err != nil { + return nil, err + } + + logrus.Debugf(title + " succeeded") + return computeSystems, nil +} + +// Start synchronously starts the container. +func (container *container) Start() error { + container.handleLock.RLock() + defer container.handleLock.RUnlock() + operation := "Start" + title := "HCSShim::Container::" + operation + logrus.Debugf(title+" id=%s", container.id) + + if container.handle == 0 { + return makeContainerError(container, operation, "", ErrAlreadyClosed) + } + + var resultp *uint16 + err := hcsStartComputeSystem(container.handle, "", &resultp) + err = processAsyncHcsResult(err, resultp, container.callbackNumber, hcsNotificationSystemStartCompleted, &defaultTimeout) + if err != nil { + return makeContainerError(container, operation, "", err) + } + + logrus.Debugf(title+" succeeded id=%s", container.id) + return nil +} + +// Shutdown requests a container shutdown, if IsPending() on the error returned is true, +// it may not actually be shut down until Wait() succeeds. +func (container *container) Shutdown() error { + container.handleLock.RLock() + defer container.handleLock.RUnlock() + operation := "Shutdown" + title := "HCSShim::Container::" + operation + logrus.Debugf(title+" id=%s", container.id) + + if container.handle == 0 { + return makeContainerError(container, operation, "", ErrAlreadyClosed) + } + + var resultp *uint16 + err := hcsShutdownComputeSystem(container.handle, "", &resultp) + err = processHcsResult(err, resultp) + if err != nil { + return makeContainerError(container, operation, "", err) + } + + logrus.Debugf(title+" succeeded id=%s", container.id) + return nil +} + +// Terminate requests a container terminate, if IsPending() on the error returned is true, +// it may not actually be shut down until Wait() succeeds. +func (container *container) Terminate() error { + container.handleLock.RLock() + defer container.handleLock.RUnlock() + operation := "Terminate" + title := "HCSShim::Container::" + operation + logrus.Debugf(title+" id=%s", container.id) + + if container.handle == 0 { + return makeContainerError(container, operation, "", ErrAlreadyClosed) + } + + var resultp *uint16 + err := hcsTerminateComputeSystem(container.handle, "", &resultp) + err = processHcsResult(err, resultp) + if err != nil { + return makeContainerError(container, operation, "", err) + } + + logrus.Debugf(title+" succeeded id=%s", container.id) + return nil +} + +// Wait synchronously waits for the container to shutdown or terminate. +func (container *container) Wait() error { + operation := "Wait" + title := "HCSShim::Container::" + operation + logrus.Debugf(title+" id=%s", container.id) + + err := waitForNotification(container.callbackNumber, hcsNotificationSystemExited, nil) + if err != nil { + return makeContainerError(container, operation, "", err) + } + + logrus.Debugf(title+" succeeded id=%s", container.id) + return nil +} + +// WaitTimeout synchronously waits for the container to terminate or the duration to elapse. +// If the timeout expires, IsTimeout(err) == true +func (container *container) WaitTimeout(timeout time.Duration) error { + operation := "WaitTimeout" + title := "HCSShim::Container::" + operation + logrus.Debugf(title+" id=%s", container.id) + + err := waitForNotification(container.callbackNumber, hcsNotificationSystemExited, &timeout) + if err != nil { + return makeContainerError(container, operation, "", err) + } + + logrus.Debugf(title+" succeeded id=%s", container.id) + return nil +} + +func (container *container) properties(query string) (*ContainerProperties, error) { + var ( + resultp *uint16 + propertiesp *uint16 + ) + err := hcsGetComputeSystemProperties(container.handle, query, &propertiesp, &resultp) + err = processHcsResult(err, resultp) + if err != nil { + return nil, err + } + + if propertiesp == nil { + return nil, ErrUnexpectedValue + } + propertiesRaw := convertAndFreeCoTaskMemBytes(propertiesp) + properties := &ContainerProperties{} + if err := json.Unmarshal(propertiesRaw, properties); err != nil { + return nil, err + } + return properties, nil +} + +// HasPendingUpdates returns true if the container has updates pending to install +func (container *container) HasPendingUpdates() (bool, error) { + container.handleLock.RLock() + defer container.handleLock.RUnlock() + operation := "HasPendingUpdates" + title := "HCSShim::Container::" + operation + logrus.Debugf(title+" id=%s", container.id) + + if container.handle == 0 { + return false, makeContainerError(container, operation, "", ErrAlreadyClosed) + } + + properties, err := container.properties(pendingUpdatesQuery) + if err != nil { + return false, makeContainerError(container, operation, "", err) + } + + logrus.Debugf(title+" succeeded id=%s", container.id) + return properties.AreUpdatesPending, nil +} + +// Statistics returns statistics for the container +func (container *container) Statistics() (Statistics, error) { + container.handleLock.RLock() + defer container.handleLock.RUnlock() + operation := "Statistics" + title := "HCSShim::Container::" + operation + logrus.Debugf(title+" id=%s", container.id) + + if container.handle == 0 { + return Statistics{}, makeContainerError(container, operation, "", ErrAlreadyClosed) + } + + properties, err := container.properties(statisticsQuery) + if err != nil { + return Statistics{}, makeContainerError(container, operation, "", err) + } + + logrus.Debugf(title+" succeeded id=%s", container.id) + return properties.Statistics, nil +} + +// ProcessList returns an array of ProcessListItems for the container +func (container *container) ProcessList() ([]ProcessListItem, error) { + container.handleLock.RLock() + defer container.handleLock.RUnlock() + operation := "ProcessList" + title := "HCSShim::Container::" + operation + logrus.Debugf(title+" id=%s", container.id) + + if container.handle == 0 { + return nil, makeContainerError(container, operation, "", ErrAlreadyClosed) + } + + properties, err := container.properties(processListQuery) + if err != nil { + return nil, makeContainerError(container, operation, "", err) + } + + logrus.Debugf(title+" succeeded id=%s", container.id) + return properties.ProcessList, nil +} + +// MappedVirtualDisks returns a map of the controllers and the disks mapped +// to a container. +// +// Example of JSON returned by the query. +//{ +// "Id":"1126e8d7d279c707a666972a15976371d365eaf622c02cea2c442b84f6f550a3_svm", +// "SystemType":"Container", +// "RuntimeOsType":"Linux", +// "RuntimeId":"00000000-0000-0000-0000-000000000000", +// "State":"Running", +// "MappedVirtualDiskControllers":{ +// "0":{ +// "MappedVirtualDisks":{ +// "2":{ +// "HostPath":"C:\\lcow\\lcow\\scratch\\1126e8d7d279c707a666972a15976371d365eaf622c02cea2c442b84f6f550a3.vhdx", +// "ContainerPath":"/mnt/gcs/LinuxServiceVM/scratch", +// "Lun":2, +// "CreateInUtilityVM":true +// }, +// "3":{ +// "HostPath":"C:\\lcow\\lcow\\1126e8d7d279c707a666972a15976371d365eaf622c02cea2c442b84f6f550a3\\sandbox.vhdx", +// "Lun":3, +// "CreateInUtilityVM":true, +// "AttachOnly":true +// } +// } +// } +// } +//} +func (container *container) MappedVirtualDisks() (map[int]MappedVirtualDiskController, error) { + container.handleLock.RLock() + defer container.handleLock.RUnlock() + operation := "MappedVirtualDiskList" + title := "HCSShim::Container::" + operation + logrus.Debugf(title+" id=%s", container.id) + + if container.handle == 0 { + return nil, makeContainerError(container, operation, "", ErrAlreadyClosed) + } + + properties, err := container.properties(mappedVirtualDiskQuery) + if err != nil { + return nil, makeContainerError(container, operation, "", err) + } + + logrus.Debugf(title+" succeeded id=%s", container.id) + return properties.MappedVirtualDiskControllers, nil +} + +// Pause pauses the execution of the container. This feature is not enabled in TP5. +func (container *container) Pause() error { + container.handleLock.RLock() + defer container.handleLock.RUnlock() + operation := "Pause" + title := "HCSShim::Container::" + operation + logrus.Debugf(title+" id=%s", container.id) + + if container.handle == 0 { + return makeContainerError(container, operation, "", ErrAlreadyClosed) + } + + var resultp *uint16 + err := hcsPauseComputeSystem(container.handle, "", &resultp) + err = processAsyncHcsResult(err, resultp, container.callbackNumber, hcsNotificationSystemPauseCompleted, &defaultTimeout) + if err != nil { + return makeContainerError(container, operation, "", err) + } + + logrus.Debugf(title+" succeeded id=%s", container.id) + return nil +} + +// Resume resumes the execution of the container. This feature is not enabled in TP5. +func (container *container) Resume() error { + container.handleLock.RLock() + defer container.handleLock.RUnlock() + operation := "Resume" + title := "HCSShim::Container::" + operation + logrus.Debugf(title+" id=%s", container.id) + + if container.handle == 0 { + return makeContainerError(container, operation, "", ErrAlreadyClosed) + } + + var resultp *uint16 + err := hcsResumeComputeSystem(container.handle, "", &resultp) + err = processAsyncHcsResult(err, resultp, container.callbackNumber, hcsNotificationSystemResumeCompleted, &defaultTimeout) + if err != nil { + return makeContainerError(container, operation, "", err) + } + + logrus.Debugf(title+" succeeded id=%s", container.id) + return nil +} + +// CreateProcess launches a new process within the container. +func (container *container) CreateProcess(c *ProcessConfig) (Process, error) { + container.handleLock.RLock() + defer container.handleLock.RUnlock() + operation := "CreateProcess" + title := "HCSShim::Container::" + operation + var ( + processInfo hcsProcessInformation + processHandle hcsProcess + resultp *uint16 + ) + + if container.handle == 0 { + return nil, makeContainerError(container, operation, "", ErrAlreadyClosed) + } + + // If we are not emulating a console, ignore any console size passed to us + if !c.EmulateConsole { + c.ConsoleSize[0] = 0 + c.ConsoleSize[1] = 0 + } + + configurationb, err := json.Marshal(c) + if err != nil { + return nil, makeContainerError(container, operation, "", err) + } + + configuration := string(configurationb) + logrus.Debugf(title+" id=%s config=%s", container.id, configuration) + + err = hcsCreateProcess(container.handle, configuration, &processInfo, &processHandle, &resultp) + err = processHcsResult(err, resultp) + if err != nil { + return nil, makeContainerError(container, operation, configuration, err) + } + + process := &process{ + handle: processHandle, + processID: int(processInfo.ProcessId), + container: container, + cachedPipes: &cachedPipes{ + stdIn: processInfo.StdInput, + stdOut: processInfo.StdOutput, + stdErr: processInfo.StdError, + }, + } + + if err := process.registerCallback(); err != nil { + return nil, makeContainerError(container, operation, "", err) + } + + logrus.Debugf(title+" succeeded id=%s processid=%d", container.id, process.processID) + return process, nil +} + +// OpenProcess gets an interface to an existing process within the container. +func (container *container) OpenProcess(pid int) (Process, error) { + container.handleLock.RLock() + defer container.handleLock.RUnlock() + operation := "OpenProcess" + title := "HCSShim::Container::" + operation + logrus.Debugf(title+" id=%s, processid=%d", container.id, pid) + var ( + processHandle hcsProcess + resultp *uint16 + ) + + if container.handle == 0 { + return nil, makeContainerError(container, operation, "", ErrAlreadyClosed) + } + + err := hcsOpenProcess(container.handle, uint32(pid), &processHandle, &resultp) + err = processHcsResult(err, resultp) + if err != nil { + return nil, makeContainerError(container, operation, "", err) + } + + process := &process{ + handle: processHandle, + processID: pid, + container: container, + } + + if err := process.registerCallback(); err != nil { + return nil, makeContainerError(container, operation, "", err) + } + + logrus.Debugf(title+" succeeded id=%s processid=%s", container.id, process.processID) + return process, nil +} + +// Close cleans up any state associated with the container but does not terminate or wait for it. +func (container *container) Close() error { + container.handleLock.Lock() + defer container.handleLock.Unlock() + operation := "Close" + title := "HCSShim::Container::" + operation + logrus.Debugf(title+" id=%s", container.id) + + // Don't double free this + if container.handle == 0 { + return nil + } + + if err := container.unregisterCallback(); err != nil { + return makeContainerError(container, operation, "", err) + } + + if err := hcsCloseComputeSystem(container.handle); err != nil { + return makeContainerError(container, operation, "", err) + } + + container.handle = 0 + + logrus.Debugf(title+" succeeded id=%s", container.id) + return nil +} + +func (container *container) registerCallback() error { + context := ¬ifcationWatcherContext{ + channels: newChannels(), + } + + callbackMapLock.Lock() + callbackNumber := nextCallback + nextCallback++ + callbackMap[callbackNumber] = context + callbackMapLock.Unlock() + + var callbackHandle hcsCallback + err := hcsRegisterComputeSystemCallback(container.handle, notificationWatcherCallback, callbackNumber, &callbackHandle) + if err != nil { + return err + } + context.handle = callbackHandle + container.callbackNumber = callbackNumber + + return nil +} + +func (container *container) unregisterCallback() error { + callbackNumber := container.callbackNumber + + callbackMapLock.RLock() + context := callbackMap[callbackNumber] + callbackMapLock.RUnlock() + + if context == nil { + return nil + } + + handle := context.handle + + if handle == 0 { + return nil + } + + // hcsUnregisterComputeSystemCallback has its own syncronization + // to wait for all callbacks to complete. We must NOT hold the callbackMapLock. + err := hcsUnregisterComputeSystemCallback(handle) + if err != nil { + return err + } + + closeChannels(context.channels) + + callbackMapLock.Lock() + callbackMap[callbackNumber] = nil + callbackMapLock.Unlock() + + handle = 0 + + return nil +} + +// Modifies the System by sending a request to HCS +func (container *container) Modify(config *ResourceModificationRequestResponse) error { + container.handleLock.RLock() + defer container.handleLock.RUnlock() + operation := "Modify" + title := "HCSShim::Container::" + operation + + if container.handle == 0 { + return makeContainerError(container, operation, "", ErrAlreadyClosed) + } + + requestJSON, err := json.Marshal(config) + if err != nil { + return err + } + + requestString := string(requestJSON) + logrus.Debugf(title+" id=%s request=%s", container.id, requestString) + + var resultp *uint16 + err = hcsModifyComputeSystem(container.handle, requestString, &resultp) + err = processHcsResult(err, resultp) + if err != nil { + return makeContainerError(container, operation, "", err) + } + logrus.Debugf(title+" succeeded id=%s", container.id) + return nil +} diff --git a/vendor/github.com/Microsoft/hcsshim/createlayer.go b/vendor/github.com/Microsoft/hcsshim/createlayer.go new file mode 100644 index 0000000000..035d9c3947 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/createlayer.go @@ -0,0 +1,27 @@ +package hcsshim + +import "github.com/sirupsen/logrus" + +// CreateLayer creates a new, empty, read-only layer on the filesystem based on +// the parent layer provided. +func CreateLayer(info DriverInfo, id, parent string) error { + title := "hcsshim::CreateLayer " + logrus.Debugf(title+"Flavour %d ID %s parent %s", info.Flavour, id, parent) + + // Convert info to API calling convention + infop, err := convertDriverInfo(info) + if err != nil { + logrus.Error(err) + return err + } + + err = createLayer(&infop, id, parent) + if err != nil { + err = makeErrorf(err, title, "id=%s parent=%s flavour=%d", id, parent, info.Flavour) + logrus.Error(err) + return err + } + + logrus.Debugf(title+" - succeeded id=%s parent=%s flavour=%d", id, parent, info.Flavour) + return nil +} diff --git a/vendor/github.com/Microsoft/hcsshim/createsandboxlayer.go b/vendor/github.com/Microsoft/hcsshim/createsandboxlayer.go new file mode 100644 index 0000000000..7a6a8854cf --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/createsandboxlayer.go @@ -0,0 +1,35 @@ +package hcsshim + +import "github.com/sirupsen/logrus" + +// CreateSandboxLayer creates and populates new read-write layer for use by a container. +// This requires both the id of the direct parent layer, as well as the full list +// of paths to all parent layers up to the base (and including the direct parent +// whose id was provided). +func CreateSandboxLayer(info DriverInfo, layerId, parentId string, parentLayerPaths []string) error { + title := "hcsshim::CreateSandboxLayer " + logrus.Debugf(title+"layerId %s parentId %s", layerId, parentId) + + // Generate layer descriptors + layers, err := layerPathsToDescriptors(parentLayerPaths) + if err != nil { + return err + } + + // Convert info to API calling convention + infop, err := convertDriverInfo(info) + if err != nil { + logrus.Error(err) + return err + } + + err = createSandboxLayer(&infop, layerId, parentId, layers) + if err != nil { + err = makeErrorf(err, title, "layerId=%s parentId=%s", layerId, parentId) + logrus.Error(err) + return err + } + + logrus.Debugf(title+"- succeeded layerId=%s parentId=%s", layerId, parentId) + return nil +} diff --git a/vendor/github.com/Microsoft/hcsshim/deactivatelayer.go b/vendor/github.com/Microsoft/hcsshim/deactivatelayer.go new file mode 100644 index 0000000000..fd785030fb --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/deactivatelayer.go @@ -0,0 +1,26 @@ +package hcsshim + +import "github.com/sirupsen/logrus" + +// DeactivateLayer will dismount a layer that was mounted via ActivateLayer. +func DeactivateLayer(info DriverInfo, id string) error { + title := "hcsshim::DeactivateLayer " + logrus.Debugf(title+"Flavour %d ID %s", info.Flavour, id) + + // Convert info to API calling convention + infop, err := convertDriverInfo(info) + if err != nil { + logrus.Error(err) + return err + } + + err = deactivateLayer(&infop, id) + if err != nil { + err = makeErrorf(err, title, "id=%s flavour=%d", id, info.Flavour) + logrus.Error(err) + return err + } + + logrus.Debugf(title+"succeeded flavour=%d id=%s", info.Flavour, id) + return nil +} diff --git a/vendor/github.com/Microsoft/hcsshim/destroylayer.go b/vendor/github.com/Microsoft/hcsshim/destroylayer.go new file mode 100644 index 0000000000..b1e3b89fc7 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/destroylayer.go @@ -0,0 +1,27 @@ +package hcsshim + +import "github.com/sirupsen/logrus" + +// DestroyLayer will remove the on-disk files representing the layer with the given +// id, including that layer's containing folder, if any. +func DestroyLayer(info DriverInfo, id string) error { + title := "hcsshim::DestroyLayer " + logrus.Debugf(title+"Flavour %d ID %s", info.Flavour, id) + + // Convert info to API calling convention + infop, err := convertDriverInfo(info) + if err != nil { + logrus.Error(err) + return err + } + + err = destroyLayer(&infop, id) + if err != nil { + err = makeErrorf(err, title, "id=%s flavour=%d", id, info.Flavour) + logrus.Error(err) + return err + } + + logrus.Debugf(title+"succeeded flavour=%d id=%s", info.Flavour, id) + return nil +} diff --git a/vendor/github.com/Microsoft/hcsshim/errors.go b/vendor/github.com/Microsoft/hcsshim/errors.go new file mode 100644 index 0000000000..d2f9cc8bd2 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/errors.go @@ -0,0 +1,239 @@ +package hcsshim + +import ( + "errors" + "fmt" + "syscall" +) + +var ( + // ErrComputeSystemDoesNotExist is an error encountered when the container being operated on no longer exists + ErrComputeSystemDoesNotExist = syscall.Errno(0xc037010e) + + // ErrElementNotFound is an error encountered when the object being referenced does not exist + ErrElementNotFound = syscall.Errno(0x490) + + // ErrElementNotFound is an error encountered when the object being referenced does not exist + ErrNotSupported = syscall.Errno(0x32) + + // ErrInvalidData is an error encountered when the request being sent to hcs is invalid/unsupported + // decimal -2147024883 / hex 0x8007000d + ErrInvalidData = syscall.Errno(0xd) + + // ErrHandleClose is an error encountered when the handle generating the notification being waited on has been closed + ErrHandleClose = errors.New("hcsshim: the handle generating this notification has been closed") + + // ErrAlreadyClosed is an error encountered when using a handle that has been closed by the Close method + ErrAlreadyClosed = errors.New("hcsshim: the handle has already been closed") + + // ErrInvalidNotificationType is an error encountered when an invalid notification type is used + ErrInvalidNotificationType = errors.New("hcsshim: invalid notification type") + + // ErrInvalidProcessState is an error encountered when the process is not in a valid state for the requested operation + ErrInvalidProcessState = errors.New("the process is in an invalid state for the attempted operation") + + // ErrTimeout is an error encountered when waiting on a notification times out + ErrTimeout = errors.New("hcsshim: timeout waiting for notification") + + // ErrUnexpectedContainerExit is the error encountered when a container exits while waiting for + // a different expected notification + ErrUnexpectedContainerExit = errors.New("unexpected container exit") + + // ErrUnexpectedProcessAbort is the error encountered when communication with the compute service + // is lost while waiting for a notification + ErrUnexpectedProcessAbort = errors.New("lost communication with compute service") + + // ErrUnexpectedValue is an error encountered when hcs returns an invalid value + ErrUnexpectedValue = errors.New("unexpected value returned from hcs") + + // ErrVmcomputeAlreadyStopped is an error encountered when a shutdown or terminate request is made on a stopped container + ErrVmcomputeAlreadyStopped = syscall.Errno(0xc0370110) + + // ErrVmcomputeOperationPending is an error encountered when the operation is being completed asynchronously + ErrVmcomputeOperationPending = syscall.Errno(0xC0370103) + + // ErrVmcomputeOperationInvalidState is an error encountered when the compute system is not in a valid state for the requested operation + ErrVmcomputeOperationInvalidState = syscall.Errno(0xc0370105) + + // ErrProcNotFound is an error encountered when the the process cannot be found + ErrProcNotFound = syscall.Errno(0x7f) + + // ErrVmcomputeOperationAccessIsDenied is an error which can be encountered when enumerating compute systems in RS1/RS2 + // builds when the underlying silo might be in the process of terminating. HCS was fixed in RS3. + ErrVmcomputeOperationAccessIsDenied = syscall.Errno(0x5) + + // ErrVmcomputeInvalidJSON is an error encountered when the compute system does not support/understand the messages sent by management + ErrVmcomputeInvalidJSON = syscall.Errno(0xc037010d) + + // ErrVmcomputeUnknownMessage is an error encountered guest compute system doesn't support the message + ErrVmcomputeUnknownMessage = syscall.Errno(0xc037010b) + + // ErrNotSupported is an error encountered when hcs doesn't support the request + ErrPlatformNotSupported = errors.New("unsupported platform request") +) + +// ProcessError is an error encountered in HCS during an operation on a Process object +type ProcessError struct { + Process *process + Operation string + ExtraInfo string + Err error +} + +// ContainerError is an error encountered in HCS during an operation on a Container object +type ContainerError struct { + Container *container + Operation string + ExtraInfo string + Err error +} + +func (e *ContainerError) Error() string { + if e == nil { + return "" + } + + if e.Container == nil { + return "unexpected nil container for error: " + e.Err.Error() + } + + s := "container " + e.Container.id + + if e.Operation != "" { + s += " encountered an error during " + e.Operation + } + + switch e.Err.(type) { + case nil: + break + case syscall.Errno: + s += fmt.Sprintf(": failure in a Windows system call: %s (0x%x)", e.Err, win32FromError(e.Err)) + default: + s += fmt.Sprintf(": %s", e.Err.Error()) + } + + if e.ExtraInfo != "" { + s += " extra info: " + e.ExtraInfo + } + + return s +} + +func makeContainerError(container *container, operation string, extraInfo string, err error) error { + // Don't double wrap errors + if _, ok := err.(*ContainerError); ok { + return err + } + containerError := &ContainerError{Container: container, Operation: operation, ExtraInfo: extraInfo, Err: err} + return containerError +} + +func (e *ProcessError) Error() string { + if e == nil { + return "" + } + + if e.Process == nil { + return "Unexpected nil process for error: " + e.Err.Error() + } + + s := fmt.Sprintf("process %d", e.Process.processID) + + if e.Process.container != nil { + s += " in container " + e.Process.container.id + } + + if e.Operation != "" { + s += " encountered an error during " + e.Operation + } + + switch e.Err.(type) { + case nil: + break + case syscall.Errno: + s += fmt.Sprintf(": failure in a Windows system call: %s (0x%x)", e.Err, win32FromError(e.Err)) + default: + s += fmt.Sprintf(": %s", e.Err.Error()) + } + + return s +} + +func makeProcessError(process *process, operation string, extraInfo string, err error) error { + // Don't double wrap errors + if _, ok := err.(*ProcessError); ok { + return err + } + processError := &ProcessError{Process: process, Operation: operation, ExtraInfo: extraInfo, Err: err} + return processError +} + +// IsNotExist checks if an error is caused by the Container or Process not existing. +// Note: Currently, ErrElementNotFound can mean that a Process has either +// already exited, or does not exist. Both IsAlreadyStopped and IsNotExist +// will currently return true when the error is ErrElementNotFound or ErrProcNotFound. +func IsNotExist(err error) bool { + err = getInnerError(err) + return err == ErrComputeSystemDoesNotExist || + err == ErrElementNotFound || + err == ErrProcNotFound +} + +// IsAlreadyClosed checks if an error is caused by the Container or Process having been +// already closed by a call to the Close() method. +func IsAlreadyClosed(err error) bool { + err = getInnerError(err) + return err == ErrAlreadyClosed +} + +// IsPending returns a boolean indicating whether the error is that +// the requested operation is being completed in the background. +func IsPending(err error) bool { + err = getInnerError(err) + return err == ErrVmcomputeOperationPending +} + +// IsTimeout returns a boolean indicating whether the error is caused by +// a timeout waiting for the operation to complete. +func IsTimeout(err error) bool { + err = getInnerError(err) + return err == ErrTimeout +} + +// IsAlreadyStopped returns a boolean indicating whether the error is caused by +// a Container or Process being already stopped. +// Note: Currently, ErrElementNotFound can mean that a Process has either +// already exited, or does not exist. Both IsAlreadyStopped and IsNotExist +// will currently return true when the error is ErrElementNotFound or ErrProcNotFound. +func IsAlreadyStopped(err error) bool { + err = getInnerError(err) + return err == ErrVmcomputeAlreadyStopped || + err == ErrElementNotFound || + err == ErrProcNotFound +} + +// IsNotSupported returns a boolean indicating whether the error is caused by +// unsupported platform requests +// Note: Currently Unsupported platform requests can be mean either +// ErrVmcomputeInvalidJSON, ErrInvalidData, ErrNotSupported or ErrVmcomputeUnknownMessage +// is thrown from the Platform +func IsNotSupported(err error) bool { + err = getInnerError(err) + // If Platform doesn't recognize or support the request sent, below errors are seen + return err == ErrVmcomputeInvalidJSON || + err == ErrInvalidData || + err == ErrNotSupported || + err == ErrVmcomputeUnknownMessage +} + +func getInnerError(err error) error { + switch pe := err.(type) { + case nil: + return nil + case *ContainerError: + err = pe.Err + case *ProcessError: + err = pe.Err + } + return err +} diff --git a/vendor/github.com/Microsoft/hcsshim/expandsandboxsize.go b/vendor/github.com/Microsoft/hcsshim/expandsandboxsize.go new file mode 100644 index 0000000000..6946c6a84f --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/expandsandboxsize.go @@ -0,0 +1,26 @@ +package hcsshim + +import "github.com/sirupsen/logrus" + +// ExpandSandboxSize expands the size of a layer to at least size bytes. +func ExpandSandboxSize(info DriverInfo, layerId string, size uint64) error { + title := "hcsshim::ExpandSandboxSize " + logrus.Debugf(title+"layerId=%s size=%d", layerId, size) + + // Convert info to API calling convention + infop, err := convertDriverInfo(info) + if err != nil { + logrus.Error(err) + return err + } + + err = expandSandboxSize(&infop, layerId, size) + if err != nil { + err = makeErrorf(err, title, "layerId=%s size=%d", layerId, size) + logrus.Error(err) + return err + } + + logrus.Debugf(title+"- succeeded layerId=%s size=%d", layerId, size) + return nil +} diff --git a/vendor/github.com/Microsoft/hcsshim/exportlayer.go b/vendor/github.com/Microsoft/hcsshim/exportlayer.go new file mode 100644 index 0000000000..d7025f20ba --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/exportlayer.go @@ -0,0 +1,156 @@ +package hcsshim + +import ( + "io" + "io/ioutil" + "os" + "syscall" + + "github.com/Microsoft/go-winio" + "github.com/sirupsen/logrus" +) + +// ExportLayer will create a folder at exportFolderPath and fill that folder with +// the transport format version of the layer identified by layerId. This transport +// format includes any metadata required for later importing the layer (using +// ImportLayer), and requires the full list of parent layer paths in order to +// perform the export. +func ExportLayer(info DriverInfo, layerId string, exportFolderPath string, parentLayerPaths []string) error { + title := "hcsshim::ExportLayer " + logrus.Debugf(title+"flavour %d layerId %s folder %s", info.Flavour, layerId, exportFolderPath) + + // Generate layer descriptors + layers, err := layerPathsToDescriptors(parentLayerPaths) + if err != nil { + return err + } + + // Convert info to API calling convention + infop, err := convertDriverInfo(info) + if err != nil { + logrus.Error(err) + return err + } + + err = exportLayer(&infop, layerId, exportFolderPath, layers) + if err != nil { + err = makeErrorf(err, title, "layerId=%s flavour=%d folder=%s", layerId, info.Flavour, exportFolderPath) + logrus.Error(err) + return err + } + + logrus.Debugf(title+"succeeded flavour=%d layerId=%s folder=%s", info.Flavour, layerId, exportFolderPath) + return nil +} + +type LayerReader interface { + Next() (string, int64, *winio.FileBasicInfo, error) + Read(b []byte) (int, error) + Close() error +} + +// FilterLayerReader provides an interface for extracting the contents of an on-disk layer. +type FilterLayerReader struct { + context uintptr +} + +// Next reads the next available file from a layer, ensuring that parent directories are always read +// before child files and directories. +// +// Next returns the file's relative path, size, and basic file metadata. Read() should be used to +// extract a Win32 backup stream with the remainder of the metadata and the data. +func (r *FilterLayerReader) Next() (string, int64, *winio.FileBasicInfo, error) { + var fileNamep *uint16 + fileInfo := &winio.FileBasicInfo{} + var deleted uint32 + var fileSize int64 + err := exportLayerNext(r.context, &fileNamep, fileInfo, &fileSize, &deleted) + if err != nil { + if err == syscall.ERROR_NO_MORE_FILES { + err = io.EOF + } else { + err = makeError(err, "ExportLayerNext", "") + } + return "", 0, nil, err + } + fileName := convertAndFreeCoTaskMemString(fileNamep) + if deleted != 0 { + fileInfo = nil + } + if fileName[0] == '\\' { + fileName = fileName[1:] + } + return fileName, fileSize, fileInfo, nil +} + +// Read reads from the current file's Win32 backup stream. +func (r *FilterLayerReader) Read(b []byte) (int, error) { + var bytesRead uint32 + err := exportLayerRead(r.context, b, &bytesRead) + if err != nil { + return 0, makeError(err, "ExportLayerRead", "") + } + if bytesRead == 0 { + return 0, io.EOF + } + return int(bytesRead), nil +} + +// Close frees resources associated with the layer reader. It will return an +// error if there was an error while reading the layer or of the layer was not +// completely read. +func (r *FilterLayerReader) Close() (err error) { + if r.context != 0 { + err = exportLayerEnd(r.context) + if err != nil { + err = makeError(err, "ExportLayerEnd", "") + } + r.context = 0 + } + return +} + +// NewLayerReader returns a new layer reader for reading the contents of an on-disk layer. +// The caller must have taken the SeBackupPrivilege privilege +// to call this and any methods on the resulting LayerReader. +func NewLayerReader(info DriverInfo, layerID string, parentLayerPaths []string) (LayerReader, error) { + if procExportLayerBegin.Find() != nil { + // The new layer reader is not available on this Windows build. Fall back to the + // legacy export code path. + path, err := ioutil.TempDir("", "hcs") + if err != nil { + return nil, err + } + err = ExportLayer(info, layerID, path, parentLayerPaths) + if err != nil { + os.RemoveAll(path) + return nil, err + } + return &legacyLayerReaderWrapper{newLegacyLayerReader(path)}, nil + } + + layers, err := layerPathsToDescriptors(parentLayerPaths) + if err != nil { + return nil, err + } + infop, err := convertDriverInfo(info) + if err != nil { + return nil, err + } + r := &FilterLayerReader{} + err = exportLayerBegin(&infop, layerID, layers, &r.context) + if err != nil { + return nil, makeError(err, "ExportLayerBegin", "") + } + return r, err +} + +type legacyLayerReaderWrapper struct { + *legacyLayerReader +} + +func (r *legacyLayerReaderWrapper) Close() error { + err := r.legacyLayerReader.Close() + os.RemoveAll(r.root) + return err +} diff --git a/vendor/github.com/Microsoft/hcsshim/getlayermountpath.go b/vendor/github.com/Microsoft/hcsshim/getlayermountpath.go new file mode 100644 index 0000000000..89f8079d0f --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/getlayermountpath.go @@ -0,0 +1,55 @@ +package hcsshim + +import ( + "syscall" + + "github.com/sirupsen/logrus" +) + +// GetLayerMountPath will look for a mounted layer with the given id and return +// the path at which that layer can be accessed. This path may be a volume path +// if the layer is a mounted read-write layer, otherwise it is expected to be the +// folder path at which the layer is stored. +func GetLayerMountPath(info DriverInfo, id string) (string, error) { + title := "hcsshim::GetLayerMountPath " + logrus.Debugf(title+"Flavour %d ID %s", info.Flavour, id) + + // Convert info to API calling convention + infop, err := convertDriverInfo(info) + if err != nil { + logrus.Error(err) + return "", err + } + + var mountPathLength uintptr + mountPathLength = 0 + + // Call the procedure itself. + logrus.Debugf("Calling proc (1)") + err = getLayerMountPath(&infop, id, &mountPathLength, nil) + if err != nil { + err = makeErrorf(err, title, "(first call) id=%s flavour=%d", id, info.Flavour) + logrus.Error(err) + return "", err + } + + // Allocate a mount path of the returned length. + if mountPathLength == 0 { + return "", nil + } + mountPathp := make([]uint16, mountPathLength) + mountPathp[0] = 0 + + // Call the procedure again + logrus.Debugf("Calling proc (2)") + err = getLayerMountPath(&infop, id, &mountPathLength, &mountPathp[0]) + if err != nil { + err = makeErrorf(err, title, "(second call) id=%s flavour=%d", id, info.Flavour) + logrus.Error(err) + return "", err + } + + path := syscall.UTF16ToString(mountPathp[0:]) + logrus.Debugf(title+"succeeded flavour=%d id=%s path=%s", info.Flavour, id, path) + return path, nil +} diff --git a/vendor/github.com/Microsoft/hcsshim/getsharedbaseimages.go b/vendor/github.com/Microsoft/hcsshim/getsharedbaseimages.go new file mode 100644 index 0000000000..05d3d9532a --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/getsharedbaseimages.go @@ -0,0 +1,22 @@ +package hcsshim + +import "github.com/sirupsen/logrus" + +// GetSharedBaseImages will enumerate the images stored in the common central +// image store and return descriptive info about those images for the purpose +// of registering them with the graphdriver, graph, and tagstore. +func GetSharedBaseImages() (imageData string, err error) { + title := "hcsshim::GetSharedBaseImages " + + logrus.Debugf("Calling proc") + var buffer *uint16 + err = getBaseImages(&buffer) + if err != nil { + err = makeError(err, title, "") + logrus.Error(err) + return + } + imageData = convertAndFreeCoTaskMemString(buffer) + logrus.Debugf(title+" - succeeded output=%s", imageData) + return +} diff --git a/vendor/github.com/Microsoft/hcsshim/guid.go b/vendor/github.com/Microsoft/hcsshim/guid.go new file mode 100644 index 0000000000..620aba123c --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/guid.go @@ -0,0 +1,19 @@ +package hcsshim + +import ( + "crypto/sha1" + "fmt" +) + +type GUID [16]byte + +func NewGUID(source string) *GUID { + h := sha1.Sum([]byte(source)) + var g GUID + copy(g[0:], h[0:16]) + return &g +} + +func (g *GUID) ToString() string { + return fmt.Sprintf("%02x%02x%02x%02x-%02x%02x-%02x%02x-%02x-%02x", g[3], g[2], g[1], g[0], g[5], g[4], g[7], g[6], g[8:10], g[10:]) +} diff --git a/vendor/github.com/Microsoft/hcsshim/hcsshim.go b/vendor/github.com/Microsoft/hcsshim/hcsshim.go new file mode 100644 index 0000000000..236ba1fa30 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/hcsshim.go @@ -0,0 +1,166 @@ +// Shim for the Host Compute Service (HCS) to manage Windows Server +// containers and Hyper-V containers. + +package hcsshim + +import ( + "fmt" + "syscall" + "unsafe" + + "github.com/sirupsen/logrus" +) + +//go:generate go run mksyscall_windows.go -output zhcsshim.go hcsshim.go + +//sys coTaskMemFree(buffer unsafe.Pointer) = ole32.CoTaskMemFree +//sys SetCurrentThreadCompartmentId(compartmentId uint32) (hr error) = iphlpapi.SetCurrentThreadCompartmentId + +//sys activateLayer(info *driverInfo, id string) (hr error) = vmcompute.ActivateLayer? +//sys copyLayer(info *driverInfo, srcId string, dstId string, descriptors []WC_LAYER_DESCRIPTOR) (hr error) = vmcompute.CopyLayer? +//sys createLayer(info *driverInfo, id string, parent string) (hr error) = vmcompute.CreateLayer? +//sys createSandboxLayer(info *driverInfo, id string, parent string, descriptors []WC_LAYER_DESCRIPTOR) (hr error) = vmcompute.CreateSandboxLayer? +//sys expandSandboxSize(info *driverInfo, id string, size uint64) (hr error) = vmcompute.ExpandSandboxSize? +//sys deactivateLayer(info *driverInfo, id string) (hr error) = vmcompute.DeactivateLayer? +//sys destroyLayer(info *driverInfo, id string) (hr error) = vmcompute.DestroyLayer? +//sys exportLayer(info *driverInfo, id string, path string, descriptors []WC_LAYER_DESCRIPTOR) (hr error) = vmcompute.ExportLayer? +//sys getLayerMountPath(info *driverInfo, id string, length *uintptr, buffer *uint16) (hr error) = vmcompute.GetLayerMountPath? +//sys getBaseImages(buffer **uint16) (hr error) = vmcompute.GetBaseImages? +//sys importLayer(info *driverInfo, id string, path string, descriptors []WC_LAYER_DESCRIPTOR) (hr error) = vmcompute.ImportLayer? +//sys layerExists(info *driverInfo, id string, exists *uint32) (hr error) = vmcompute.LayerExists? +//sys nameToGuid(name string, guid *GUID) (hr error) = vmcompute.NameToGuid? +//sys prepareLayer(info *driverInfo, id string, descriptors []WC_LAYER_DESCRIPTOR) (hr error) = vmcompute.PrepareLayer? +//sys unprepareLayer(info *driverInfo, id string) (hr error) = vmcompute.UnprepareLayer? +//sys processBaseImage(path string) (hr error) = vmcompute.ProcessBaseImage? +//sys processUtilityImage(path string) (hr error) = vmcompute.ProcessUtilityImage? + +//sys importLayerBegin(info *driverInfo, id string, descriptors []WC_LAYER_DESCRIPTOR, context *uintptr) (hr error) = vmcompute.ImportLayerBegin? +//sys importLayerNext(context uintptr, fileName string, fileInfo *winio.FileBasicInfo) (hr error) = vmcompute.ImportLayerNext? +//sys importLayerWrite(context uintptr, buffer []byte) (hr error) = vmcompute.ImportLayerWrite? +//sys importLayerEnd(context uintptr) (hr error) = vmcompute.ImportLayerEnd? + +//sys exportLayerBegin(info *driverInfo, id string, descriptors []WC_LAYER_DESCRIPTOR, context *uintptr) (hr error) = vmcompute.ExportLayerBegin? +//sys exportLayerNext(context uintptr, fileName **uint16, fileInfo *winio.FileBasicInfo, fileSize *int64, deleted *uint32) (hr error) = vmcompute.ExportLayerNext? +//sys exportLayerRead(context uintptr, buffer []byte, bytesRead *uint32) (hr error) = vmcompute.ExportLayerRead? +//sys exportLayerEnd(context uintptr) (hr error) = vmcompute.ExportLayerEnd? + +//sys hcsEnumerateComputeSystems(query string, computeSystems **uint16, result **uint16) (hr error) = vmcompute.HcsEnumerateComputeSystems? +//sys hcsCreateComputeSystem(id string, configuration string, identity syscall.Handle, computeSystem *hcsSystem, result **uint16) (hr error) = vmcompute.HcsCreateComputeSystem? +//sys hcsOpenComputeSystem(id string, computeSystem *hcsSystem, result **uint16) (hr error) = vmcompute.HcsOpenComputeSystem? +//sys hcsCloseComputeSystem(computeSystem hcsSystem) (hr error) = vmcompute.HcsCloseComputeSystem? +//sys hcsStartComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsStartComputeSystem? +//sys hcsShutdownComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsShutdownComputeSystem? +//sys hcsTerminateComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsTerminateComputeSystem? +//sys hcsPauseComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsPauseComputeSystem? +//sys hcsResumeComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsResumeComputeSystem? +//sys hcsGetComputeSystemProperties(computeSystem hcsSystem, propertyQuery string, properties **uint16, result **uint16) (hr error) = vmcompute.HcsGetComputeSystemProperties? +//sys hcsModifyComputeSystem(computeSystem hcsSystem, configuration string, result **uint16) (hr error) = vmcompute.HcsModifyComputeSystem? +//sys hcsRegisterComputeSystemCallback(computeSystem hcsSystem, callback uintptr, context uintptr, callbackHandle *hcsCallback) (hr error) = vmcompute.HcsRegisterComputeSystemCallback? +//sys hcsUnregisterComputeSystemCallback(callbackHandle hcsCallback) (hr error) = vmcompute.HcsUnregisterComputeSystemCallback? + +//sys hcsCreateProcess(computeSystem hcsSystem, processParameters string, processInformation *hcsProcessInformation, process *hcsProcess, result **uint16) (hr error) = vmcompute.HcsCreateProcess? +//sys hcsOpenProcess(computeSystem hcsSystem, pid uint32, process *hcsProcess, result **uint16) (hr error) = vmcompute.HcsOpenProcess? +//sys hcsCloseProcess(process hcsProcess) (hr error) = vmcompute.HcsCloseProcess? +//sys hcsTerminateProcess(process hcsProcess, result **uint16) (hr error) = vmcompute.HcsTerminateProcess? +//sys hcsGetProcessInfo(process hcsProcess, processInformation *hcsProcessInformation, result **uint16) (hr error) = vmcompute.HcsGetProcessInfo? +//sys hcsGetProcessProperties(process hcsProcess, processProperties **uint16, result **uint16) (hr error) = vmcompute.HcsGetProcessProperties? +//sys hcsModifyProcess(process hcsProcess, settings string, result **uint16) (hr error) = vmcompute.HcsModifyProcess? +//sys hcsGetServiceProperties(propertyQuery string, properties **uint16, result **uint16) (hr error) = vmcompute.HcsGetServiceProperties? +//sys hcsRegisterProcessCallback(process hcsProcess, callback uintptr, context uintptr, callbackHandle *hcsCallback) (hr error) = vmcompute.HcsRegisterProcessCallback? +//sys hcsUnregisterProcessCallback(callbackHandle hcsCallback) (hr error) = vmcompute.HcsUnregisterProcessCallback? + +//sys hcsModifyServiceSettings(settings string, result **uint16) (hr error) = vmcompute.HcsModifyServiceSettings? + +//sys _hnsCall(method string, path string, object string, response **uint16) (hr error) = vmcompute.HNSCall? + +const ( + // Specific user-visible exit codes + WaitErrExecFailed = 32767 + + ERROR_GEN_FAILURE = syscall.Errno(31) + ERROR_SHUTDOWN_IN_PROGRESS = syscall.Errno(1115) + WSAEINVAL = syscall.Errno(10022) + + // Timeout on wait calls + TimeoutInfinite = 0xFFFFFFFF +) + +type HcsError struct { + title string + rest string + Err error +} + +type hcsSystem syscall.Handle +type hcsProcess syscall.Handle +type hcsCallback syscall.Handle + +type hcsProcessInformation struct { + ProcessId uint32 + Reserved uint32 + StdInput syscall.Handle + StdOutput syscall.Handle + StdError syscall.Handle +} + +func makeError(err error, title, rest string) error { + // Pass through DLL errors directly since they do not originate from HCS. + if _, ok := err.(*syscall.DLLError); ok { + return err + } + return &HcsError{title, rest, err} +} + +func makeErrorf(err error, title, format string, a ...interface{}) error { + return makeError(err, title, fmt.Sprintf(format, a...)) +} + +func win32FromError(err error) uint32 { + if herr, ok := err.(*HcsError); ok { + return win32FromError(herr.Err) + } + if code, ok := err.(syscall.Errno); ok { + return uint32(code) + } + return uint32(ERROR_GEN_FAILURE) +} + +func win32FromHresult(hr uintptr) uintptr { + if hr&0x1fff0000 == 0x00070000 { + return hr & 0xffff + } + return hr +} + +func (e *HcsError) Error() string { + s := e.title + if len(s) > 0 && s[len(s)-1] != ' ' { + s += " " + } + s += fmt.Sprintf("failed in Win32: %s (0x%x)", e.Err, win32FromError(e.Err)) + if e.rest != "" { + if e.rest[0] != ' ' { + s += " " + } + s += e.rest + } + return s +} + +func convertAndFreeCoTaskMemString(buffer *uint16) string { + str := syscall.UTF16ToString((*[1 << 30]uint16)(unsafe.Pointer(buffer))[:]) + coTaskMemFree(unsafe.Pointer(buffer)) + return str +} + +func convertAndFreeCoTaskMemBytes(buffer *uint16) []byte { + return []byte(convertAndFreeCoTaskMemString(buffer)) +} + +func processHcsResult(err error, resultp *uint16) error { + if resultp != nil { + result := convertAndFreeCoTaskMemString(resultp) + logrus.Debugf("Result: %s", result) + } + return err +} diff --git a/vendor/github.com/Microsoft/hcsshim/hnsendpoint.go b/vendor/github.com/Microsoft/hcsshim/hnsendpoint.go new file mode 100644 index 0000000000..92afc0c249 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/hnsendpoint.go @@ -0,0 +1,318 @@ +package hcsshim + +import ( + "encoding/json" + "fmt" + "net" + + "github.com/sirupsen/logrus" +) + +// HNSEndpoint represents a network endpoint in HNS +type HNSEndpoint struct { + Id string `json:"ID,omitempty"` + Name string `json:",omitempty"` + VirtualNetwork string `json:",omitempty"` + VirtualNetworkName string `json:",omitempty"` + Policies []json.RawMessage `json:",omitempty"` + MacAddress string `json:",omitempty"` + IPAddress net.IP `json:",omitempty"` + DNSSuffix string `json:",omitempty"` + DNSServerList string `json:",omitempty"` + GatewayAddress string `json:",omitempty"` + EnableInternalDNS bool `json:",omitempty"` + DisableICC bool `json:",omitempty"` + PrefixLength uint8 `json:",omitempty"` + IsRemoteEndpoint bool `json:",omitempty"` +} + +//SystemType represents the type of the system on which actions are done +type SystemType string + +// SystemType const +const ( + ContainerType SystemType = "Container" + VirtualMachineType SystemType = "VirtualMachine" + HostType SystemType = "Host" +) + +// EndpointAttachDetachRequest is the structure used to send request to the container to modify the system +// Supported resource types are Network and Request Types are Add/Remove +type EndpointAttachDetachRequest struct { + ContainerID string `json:"ContainerId,omitempty"` + SystemType SystemType `json:"SystemType"` + CompartmentID uint16 `json:"CompartmentId,omitempty"` + VirtualNICName string `json:"VirtualNicName,omitempty"` +} + +// EndpointResquestResponse is object to get the endpoint request response +type EndpointResquestResponse struct { + Success bool + Error string +} + +// HNSEndpointRequest makes a HNS call to modify/query a network endpoint +func HNSEndpointRequest(method, path, request string) (*HNSEndpoint, error) { + endpoint := &HNSEndpoint{} + err := hnsCall(method, "/endpoints/"+path, request, &endpoint) + if err != nil { + return nil, err + } + + return endpoint, nil +} + +// HNSListEndpointRequest makes a HNS call to query the list of available endpoints +func HNSListEndpointRequest() ([]HNSEndpoint, error) { + var endpoint []HNSEndpoint + err := hnsCall("GET", "/endpoints/", "", &endpoint) + if err != nil { + return nil, err + } + + return endpoint, nil +} + +// HotAttachEndpoint makes a HCS Call to attach the endpoint to the container +func HotAttachEndpoint(containerID string, endpointID string) error { + return modifyNetworkEndpoint(containerID, endpointID, Add) +} + +// HotDetachEndpoint makes a HCS Call to detach the endpoint from the container +func HotDetachEndpoint(containerID string, endpointID string) error { + return modifyNetworkEndpoint(containerID, endpointID, Remove) +} + +// ModifyContainer corresponding to the container id, by sending a request +func modifyContainer(id string, request *ResourceModificationRequestResponse) error { + container, err := OpenContainer(id) + if err != nil { + if IsNotExist(err) { + return ErrComputeSystemDoesNotExist + } + return getInnerError(err) + } + defer container.Close() + err = container.Modify(request) + if err != nil { + if IsNotSupported(err) { + return ErrPlatformNotSupported + } + return getInnerError(err) + } + + return nil +} + +func modifyNetworkEndpoint(containerID string, endpointID string, request RequestType) error { + requestMessage := &ResourceModificationRequestResponse{ + Resource: Network, + Request: request, + Data: endpointID, + } + err := modifyContainer(containerID, requestMessage) + + if err != nil { + return err + } + + return nil +} + +// GetHNSEndpointByID get the Endpoint by ID +func GetHNSEndpointByID(endpointID string) (*HNSEndpoint, error) { + return HNSEndpointRequest("GET", endpointID, "") +} + +// GetHNSEndpointByName gets the endpoint filtered by Name +func GetHNSEndpointByName(endpointName string) (*HNSEndpoint, error) { + hnsResponse, err := HNSListEndpointRequest() + if err != nil { + return nil, err + } + for _, hnsEndpoint := range hnsResponse { + if hnsEndpoint.Name == endpointName { + return &hnsEndpoint, nil + } + } + return nil, fmt.Errorf("Endpoint %v not found", endpointName) +} + +// Create Endpoint by sending EndpointRequest to HNS. TODO: Create a separate HNS interface to place all these methods +func (endpoint *HNSEndpoint) Create() (*HNSEndpoint, error) { + operation := "Create" + title := "HCSShim::HNSEndpoint::" + operation + logrus.Debugf(title+" id=%s", endpoint.Id) + + jsonString, err := json.Marshal(endpoint) + if err != nil { + return nil, err + } + return HNSEndpointRequest("POST", "", string(jsonString)) +} + +// Delete Endpoint by sending EndpointRequest to HNS +func (endpoint *HNSEndpoint) Delete() (*HNSEndpoint, error) { + operation := "Delete" + title := "HCSShim::HNSEndpoint::" + operation + logrus.Debugf(title+" id=%s", endpoint.Id) + + return HNSEndpointRequest("DELETE", endpoint.Id, "") +} + +// Update Endpoint +func (endpoint *HNSEndpoint) Update() (*HNSEndpoint, error) { + operation := "Update" + title := "HCSShim::HNSEndpoint::" + operation + logrus.Debugf(title+" id=%s", endpoint.Id) + jsonString, err := json.Marshal(endpoint) + if err != nil { + return nil, err + } + err = hnsCall("POST", "/endpoints/"+endpoint.Id, string(jsonString), &endpoint) + + return endpoint, err +} + +// ContainerHotAttach attaches an endpoint to a running container +func (endpoint *HNSEndpoint) ContainerHotAttach(containerID string) error { + operation := "ContainerHotAttach" + title := "HCSShim::HNSEndpoint::" + operation + logrus.Debugf(title+" id=%s, containerId=%s", endpoint.Id, containerID) + + return modifyNetworkEndpoint(containerID, endpoint.Id, Add) +} + +// ContainerHotDetach detaches an endpoint from a running container +func (endpoint *HNSEndpoint) ContainerHotDetach(containerID string) error { + operation := "ContainerHotDetach" + title := "HCSShim::HNSEndpoint::" + operation + logrus.Debugf(title+" id=%s, containerId=%s", endpoint.Id, containerID) + + return modifyNetworkEndpoint(containerID, endpoint.Id, Remove) +} + +// ApplyACLPolicy applies Acl Policy on the Endpoint +func (endpoint *HNSEndpoint) ApplyACLPolicy(policy *ACLPolicy) error { + operation := "ApplyACLPolicy" + title := "HCSShim::HNSEndpoint::" + operation + logrus.Debugf(title+" id=%s", endpoint.Id) + + jsonString, err := json.Marshal(policy) + if err != nil { + return err + } + endpoint.Policies[0] = jsonString + _, err = endpoint.Update() + return err +} + +// ContainerAttach attaches an endpoint to container +func (endpoint *HNSEndpoint) ContainerAttach(containerID string, compartmentID uint16) error { + operation := "ContainerAttach" + title := "HCSShim::HNSEndpoint::" + operation + logrus.Debugf(title+" id=%s", endpoint.Id) + + requestMessage := &EndpointAttachDetachRequest{ + ContainerID: containerID, + CompartmentID: compartmentID, + SystemType: ContainerType, + } + response := &EndpointResquestResponse{} + jsonString, err := json.Marshal(requestMessage) + if err != nil { + return err + } + return hnsCall("POST", "/endpoints/"+endpoint.Id+"/attach", string(jsonString), &response) +} + +// ContainerDetach detaches an endpoint from container +func (endpoint *HNSEndpoint) ContainerDetach(containerID string) error { + operation := "ContainerDetach" + title := "HCSShim::HNSEndpoint::" + operation + logrus.Debugf(title+" id=%s", endpoint.Id) + + requestMessage := &EndpointAttachDetachRequest{ + ContainerID: containerID, + SystemType: ContainerType, + } + response := &EndpointResquestResponse{} + + jsonString, err := json.Marshal(requestMessage) + if err != nil { + return err + } + return hnsCall("POST", "/endpoints/"+endpoint.Id+"/detach", string(jsonString), &response) +} + +// HostAttach attaches a nic on the host +func (endpoint *HNSEndpoint) HostAttach(compartmentID uint16) error { + operation := "HostAttach" + title := "HCSShim::HNSEndpoint::" + operation + logrus.Debugf(title+" id=%s", endpoint.Id) + requestMessage := &EndpointAttachDetachRequest{ + CompartmentID: compartmentID, + SystemType: HostType, + } + response := &EndpointResquestResponse{} + + jsonString, err := json.Marshal(requestMessage) + if err != nil { + return err + } + return hnsCall("POST", "/endpoints/"+endpoint.Id+"/attach", string(jsonString), &response) + +} + +// HostDetach detaches a nic on the host +func (endpoint *HNSEndpoint) HostDetach() error { + operation := "HostDetach" + title := "HCSShim::HNSEndpoint::" + operation + logrus.Debugf(title+" id=%s", endpoint.Id) + requestMessage := &EndpointAttachDetachRequest{ + SystemType: HostType, + } + response := &EndpointResquestResponse{} + + jsonString, err := json.Marshal(requestMessage) + if err != nil { + return err + } + return hnsCall("POST", "/endpoints/"+endpoint.Id+"/detach", string(jsonString), &response) +} + +// VirtualMachineNICAttach attaches a endpoint to a virtual machine +func (endpoint *HNSEndpoint) VirtualMachineNICAttach(virtualMachineNICName string) error { + operation := "VirtualMachineNicAttach" + title := "HCSShim::HNSEndpoint::" + operation + logrus.Debugf(title+" id=%s", endpoint.Id) + requestMessage := &EndpointAttachDetachRequest{ + VirtualNICName: virtualMachineNICName, + SystemType: VirtualMachineType, + } + response := &EndpointResquestResponse{} + + jsonString, err := json.Marshal(requestMessage) + if err != nil { + return err + } + return hnsCall("POST", "/endpoints/"+endpoint.Id+"/attach", string(jsonString), &response) +} + +// VirtualMachineNICDetach detaches a endpoint from a virtual machine +func (endpoint *HNSEndpoint) VirtualMachineNICDetach() error { + operation := "VirtualMachineNicDetach" + title := "HCSShim::HNSEndpoint::" + operation + logrus.Debugf(title+" id=%s", endpoint.Id) + + requestMessage := &EndpointAttachDetachRequest{ + SystemType: VirtualMachineType, + } + response := &EndpointResquestResponse{} + + jsonString, err := json.Marshal(requestMessage) + if err != nil { + return err + } + return hnsCall("POST", "/endpoints/"+endpoint.Id+"/detach", string(jsonString), &response) +} diff --git a/vendor/github.com/Microsoft/hcsshim/hnsfuncs.go b/vendor/github.com/Microsoft/hcsshim/hnsfuncs.go new file mode 100644 index 0000000000..2c1b979ae8 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/hnsfuncs.go @@ -0,0 +1,40 @@ +package hcsshim + +import ( + "encoding/json" + "fmt" + + "github.com/sirupsen/logrus" +) + +func hnsCall(method, path, request string, returnResponse interface{}) error { + var responseBuffer *uint16 + logrus.Debugf("[%s]=>[%s] Request : %s", method, path, request) + + err := _hnsCall(method, path, request, &responseBuffer) + if err != nil { + return makeError(err, "hnsCall ", "") + } + response := convertAndFreeCoTaskMemString(responseBuffer) + + hnsresponse := &hnsResponse{} + if err = json.Unmarshal([]byte(response), &hnsresponse); err != nil { + return err + } + + if !hnsresponse.Success { + return fmt.Errorf("HNS failed with error : %s", hnsresponse.Error) + } + + if len(hnsresponse.Output) == 0 { + return nil + } + + logrus.Debugf("Network Response : %s", hnsresponse.Output) + err = json.Unmarshal(hnsresponse.Output, returnResponse) + if err != nil { + return err + } + + return nil +} diff --git a/vendor/github.com/Microsoft/hcsshim/hnsnetwork.go b/vendor/github.com/Microsoft/hcsshim/hnsnetwork.go new file mode 100644 index 0000000000..3345bfa3f2 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/hnsnetwork.go @@ -0,0 +1,142 @@ +package hcsshim + +import ( + "encoding/json" + "fmt" + "net" + + "github.com/sirupsen/logrus" +) + +// Subnet is assoicated with a network and represents a list +// of subnets available to the network +type Subnet struct { + AddressPrefix string `json:",omitempty"` + GatewayAddress string `json:",omitempty"` + Policies []json.RawMessage `json:",omitempty"` +} + +// MacPool is assoicated with a network and represents a list +// of macaddresses available to the network +type MacPool struct { + StartMacAddress string `json:",omitempty"` + EndMacAddress string `json:",omitempty"` +} + +// HNSNetwork represents a network in HNS +type HNSNetwork struct { + Id string `json:"ID,omitempty"` + Name string `json:",omitempty"` + Type string `json:",omitempty"` + NetworkAdapterName string `json:",omitempty"` + SourceMac string `json:",omitempty"` + Policies []json.RawMessage `json:",omitempty"` + MacPools []MacPool `json:",omitempty"` + Subnets []Subnet `json:",omitempty"` + DNSSuffix string `json:",omitempty"` + DNSServerList string `json:",omitempty"` + DNSServerCompartment uint32 `json:",omitempty"` + ManagementIP string `json:",omitempty"` + AutomaticDNS bool `json:",omitempty"` +} + +type hnsNetworkResponse struct { + Success bool + Error string + Output HNSNetwork +} + +type hnsResponse struct { + Success bool + Error string + Output json.RawMessage +} + +// HNSNetworkRequest makes a call into HNS to update/query a single network +func HNSNetworkRequest(method, path, request string) (*HNSNetwork, error) { + var network HNSNetwork + err := hnsCall(method, "/networks/"+path, request, &network) + if err != nil { + return nil, err + } + + return &network, nil +} + +// HNSListNetworkRequest makes a HNS call to query the list of available networks +func HNSListNetworkRequest(method, path, request string) ([]HNSNetwork, error) { + var network []HNSNetwork + err := hnsCall(method, "/networks/"+path, request, &network) + if err != nil { + return nil, err + } + + return network, nil +} + +// GetHNSNetworkByID +func GetHNSNetworkByID(networkID string) (*HNSNetwork, error) { + return HNSNetworkRequest("GET", networkID, "") +} + +// GetHNSNetworkName filtered by Name +func GetHNSNetworkByName(networkName string) (*HNSNetwork, error) { + hsnnetworks, err := HNSListNetworkRequest("GET", "", "") + if err != nil { + return nil, err + } + for _, hnsnetwork := range hsnnetworks { + if hnsnetwork.Name == networkName { + return &hnsnetwork, nil + } + } + return nil, fmt.Errorf("Network %v not found", networkName) +} + +// Create Network by sending NetworkRequest to HNS. +func (network *HNSNetwork) Create() (*HNSNetwork, error) { + operation := "Create" + title := "HCSShim::HNSNetwork::" + operation + logrus.Debugf(title+" id=%s", network.Id) + + jsonString, err := json.Marshal(network) + if err != nil { + return nil, err + } + return HNSNetworkRequest("POST", "", string(jsonString)) +} + +// Delete Network by sending NetworkRequest to HNS +func (network *HNSNetwork) Delete() (*HNSNetwork, error) { + operation := "Delete" + title := "HCSShim::HNSNetwork::" + operation + logrus.Debugf(title+" id=%s", network.Id) + + return HNSNetworkRequest("DELETE", network.Id, "") +} + +// Creates an endpoint on the Network. +func (network *HNSNetwork) NewEndpoint(ipAddress net.IP, macAddress net.HardwareAddr) *HNSEndpoint { + return &HNSEndpoint{ + VirtualNetwork: network.Id, + IPAddress: ipAddress, + MacAddress: string(macAddress), + } +} + +func (network *HNSNetwork) CreateEndpoint(endpoint *HNSEndpoint) (*HNSEndpoint, error) { + operation := "CreateEndpoint" + title := "HCSShim::HNSNetwork::" + operation + logrus.Debugf(title+" id=%s, endpointId=%s", network.Id, endpoint.Id) + + endpoint.VirtualNetwork = network.Id + return endpoint.Create() +} + +func (network *HNSNetwork) CreateRemoteEndpoint(endpoint *HNSEndpoint) (*HNSEndpoint, error) { + operation := "CreateRemoteEndpoint" + title := "HCSShim::HNSNetwork::" + operation + logrus.Debugf(title+" id=%s", network.Id) + endpoint.IsRemoteEndpoint = true + return network.CreateEndpoint(endpoint) +} diff --git a/vendor/github.com/Microsoft/hcsshim/hnspolicy.go b/vendor/github.com/Microsoft/hcsshim/hnspolicy.go new file mode 100644 index 0000000000..ecfbf0eda3 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/hnspolicy.go @@ -0,0 +1,95 @@ +package hcsshim + +// Type of Request Support in ModifySystem +type PolicyType string + +// RequestType const +const ( + Nat PolicyType = "NAT" + ACL PolicyType = "ACL" + PA PolicyType = "PA" + VLAN PolicyType = "VLAN" + VSID PolicyType = "VSID" + VNet PolicyType = "VNET" + L2Driver PolicyType = "L2Driver" + Isolation PolicyType = "Isolation" + QOS PolicyType = "QOS" + OutboundNat PolicyType = "OutBoundNAT" + ExternalLoadBalancer PolicyType = "ELB" + Route PolicyType = "ROUTE" +) + +type NatPolicy struct { + Type PolicyType `json:"Type"` + Protocol string + InternalPort uint16 + ExternalPort uint16 +} + +type QosPolicy struct { + Type PolicyType `json:"Type"` + MaximumOutgoingBandwidthInBytes uint64 +} + +type IsolationPolicy struct { + Type PolicyType `json:"Type"` + VLAN uint + VSID uint + InDefaultIsolation bool +} + +type VlanPolicy struct { + Type PolicyType `json:"Type"` + VLAN uint +} + +type VsidPolicy struct { + Type PolicyType `json:"Type"` + VSID uint +} + +type PaPolicy struct { + Type PolicyType `json:"Type"` + PA string `json:"PA"` +} + +type OutboundNatPolicy struct { + Policy + VIP string `json:"VIP,omitempty"` + Exceptions []string `json:"ExceptionList,omitempty"` +} + +type ActionType string +type DirectionType string +type RuleType string + +const ( + Allow ActionType = "Allow" + Block ActionType = "Block" + + In DirectionType = "In" + Out DirectionType = "Out" + + Host RuleType = "Host" + Switch RuleType = "Switch" +) + +type ACLPolicy struct { + Type PolicyType `json:"Type"` + Protocol uint16 + InternalPort uint16 + Action ActionType + Direction DirectionType + LocalAddress string + RemoteAddress string + LocalPort uint16 + RemotePort uint16 + RuleType RuleType `json:"RuleType,omitempty"` + + Priority uint16 + ServiceName string +} + +type Policy struct { + Type PolicyType `json:"Type"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/hnspolicylist.go b/vendor/github.com/Microsoft/hcsshim/hnspolicylist.go new file mode 100644 index 0000000000..bbd7e1edb0 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/hnspolicylist.go @@ -0,0 +1,200 @@ +package hcsshim + +import ( + "encoding/json" + + "github.com/sirupsen/logrus" +) + +// RoutePolicy is a structure defining schema for Route based Policy +type RoutePolicy struct { + Policy + DestinationPrefix string `json:"DestinationPrefix,omitempty"` + NextHop string `json:"NextHop,omitempty"` + EncapEnabled bool `json:"NeedEncap,omitempty"` +} + +// ELBPolicy is a structure defining schema for ELB LoadBalancing based Policy +type ELBPolicy struct { + LBPolicy + SourceVIP string `json:"SourceVIP,omitempty"` + VIPs []string `json:"VIPs,omitempty"` + ILB bool `json:"ILB,omitempty"` +} + +// LBPolicy is a structure defining schema for LoadBalancing based Policy +type LBPolicy struct { + Policy + Protocol uint16 `json:"Protocol,omitempty"` + InternalPort uint16 + ExternalPort uint16 +} + +// PolicyList is a structure defining schema for Policy list request +type PolicyList struct { + ID string `json:"ID,omitempty"` + EndpointReferences []string `json:"References,omitempty"` + Policies []json.RawMessage `json:"Policies,omitempty"` +} + +// HNSPolicyListRequest makes a call into HNS to update/query a single network +func HNSPolicyListRequest(method, path, request string) (*PolicyList, error) { + var policy PolicyList + err := hnsCall(method, "/policylists/"+path, request, &policy) + if err != nil { + return nil, err + } + + return &policy, nil +} + +// HNSListPolicyListRequest gets all the policy list +func HNSListPolicyListRequest() ([]PolicyList, error) { + var plist []PolicyList + err := hnsCall("GET", "/policylists/", "", &plist) + if err != nil { + return nil, err + } + + return plist, nil +} + +// PolicyListRequest makes a HNS call to modify/query a network policy list +func PolicyListRequest(method, path, request string) (*PolicyList, error) { + policylist := &PolicyList{} + err := hnsCall(method, "/policylists/"+path, request, &policylist) + if err != nil { + return nil, err + } + + return policylist, nil +} + +// GetPolicyListByID get the policy list by ID +func GetPolicyListByID(policyListID string) (*PolicyList, error) { + return PolicyListRequest("GET", policyListID, "") +} + +// Create PolicyList by sending PolicyListRequest to HNS. +func (policylist *PolicyList) Create() (*PolicyList, error) { + operation := "Create" + title := "HCSShim::PolicyList::" + operation + logrus.Debugf(title+" id=%s", policylist.ID) + jsonString, err := json.Marshal(policylist) + if err != nil { + return nil, err + } + return PolicyListRequest("POST", "", string(jsonString)) +} + +// Delete deletes PolicyList +func (policylist *PolicyList) Delete() (*PolicyList, error) { + operation := "Delete" + title := "HCSShim::PolicyList::" + operation + logrus.Debugf(title+" id=%s", policylist.ID) + + return PolicyListRequest("DELETE", policylist.ID, "") +} + +// AddEndpoint add an endpoint to a Policy List +func (policylist *PolicyList) AddEndpoint(endpoint *HNSEndpoint) (*PolicyList, error) { + operation := "AddEndpoint" + title := "HCSShim::PolicyList::" + operation + logrus.Debugf(title+" id=%s, endpointId:%s", policylist.ID, endpoint.Id) + + _, err := policylist.Delete() + if err != nil { + return nil, err + } + + // Add Endpoint to the Existing List + policylist.EndpointReferences = append(policylist.EndpointReferences, "/endpoints/"+endpoint.Id) + + return policylist.Create() +} + +// RemoveEndpoint removes an endpoint from the Policy List +func (policylist *PolicyList) RemoveEndpoint(endpoint *HNSEndpoint) (*PolicyList, error) { + operation := "RemoveEndpoint" + title := "HCSShim::PolicyList::" + operation + logrus.Debugf(title+" id=%s, endpointId:%s", policylist.ID, endpoint.Id) + + _, err := policylist.Delete() + if err != nil { + return nil, err + } + + elementToRemove := "/endpoints/" + endpoint.Id + + var references []string + + for _, endpointReference := range policylist.EndpointReferences { + if endpointReference == elementToRemove { + continue + } + references = append(references, endpointReference) + } + policylist.EndpointReferences = references + return policylist.Create() +} + +// AddLoadBalancer policy list for the specified endpoints +func AddLoadBalancer(endpoints []HNSEndpoint, isILB bool, sourceVIP, vip string, protocol uint16, internalPort uint16, externalPort uint16) (*PolicyList, error) { + operation := "AddLoadBalancer" + title := "HCSShim::PolicyList::" + operation + logrus.Debugf(title+" endpointId=%v, isILB=%v, sourceVIP=%s, vip=%s, protocol=%v, internalPort=%v, externalPort=%v", endpoints, isILB, sourceVIP, vip, protocol, internalPort, externalPort) + + policylist := &PolicyList{} + + elbPolicy := &ELBPolicy{ + SourceVIP: sourceVIP, + ILB: isILB, + } + + if len(vip) > 0 { + elbPolicy.VIPs = []string{vip} + } + elbPolicy.Type = ExternalLoadBalancer + elbPolicy.Protocol = protocol + elbPolicy.InternalPort = internalPort + elbPolicy.ExternalPort = externalPort + + for _, endpoint := range endpoints { + policylist.EndpointReferences = append(policylist.EndpointReferences, "/endpoints/"+endpoint.Id) + } + + jsonString, err := json.Marshal(elbPolicy) + if err != nil { + return nil, err + } + policylist.Policies = append(policylist.Policies, jsonString) + return policylist.Create() +} + +// AddRoute adds route policy list for the specified endpoints +func AddRoute(endpoints []HNSEndpoint, destinationPrefix string, nextHop string, encapEnabled bool) (*PolicyList, error) { + operation := "AddRoute" + title := "HCSShim::PolicyList::" + operation + logrus.Debugf(title+" destinationPrefix:%s", destinationPrefix) + + policylist := &PolicyList{} + + rPolicy := &RoutePolicy{ + DestinationPrefix: destinationPrefix, + NextHop: nextHop, + EncapEnabled: encapEnabled, + } + rPolicy.Type = Route + + for _, endpoint := range endpoints { + policylist.EndpointReferences = append(policylist.EndpointReferences, "/endpoints/"+endpoint.Id) + } + + jsonString, err := json.Marshal(rPolicy) + if err != nil { + return nil, err + } + + policylist.Policies = append(policylist.Policies, jsonString) + return policylist.Create() +} diff --git a/vendor/github.com/Microsoft/hcsshim/importlayer.go b/vendor/github.com/Microsoft/hcsshim/importlayer.go new file mode 100644 index 0000000000..3aed14376a --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/importlayer.go @@ -0,0 +1,212 @@ +package hcsshim + +import ( + "errors" + "io/ioutil" + "os" + "path/filepath" + + "github.com/Microsoft/go-winio" + "github.com/sirupsen/logrus" +) + +// ImportLayer will take the contents of the folder at importFolderPath and import +// that into a layer with the id layerId. Note that in order to correctly populate +// the layer and interperet the transport format, all parent layers must already +// be present on the system at the paths provided in parentLayerPaths. +func ImportLayer(info DriverInfo, layerID string, importFolderPath string, parentLayerPaths []string) error { + title := "hcsshim::ImportLayer " + logrus.Debugf(title+"flavour %d layerId %s folder %s", info.Flavour, layerID, importFolderPath) + + // Generate layer descriptors + layers, err := layerPathsToDescriptors(parentLayerPaths) + if err != nil { + return err + } + + // Convert info to API calling convention + infop, err := convertDriverInfo(info) + if err != nil { + logrus.Error(err) + return err + } + + err = importLayer(&infop, layerID, importFolderPath, layers) + if err != nil { + err = makeErrorf(err, title, "layerId=%s flavour=%d folder=%s", layerID, info.Flavour, importFolderPath) + logrus.Error(err) + return err + } + + logrus.Debugf(title+"succeeded flavour=%d layerId=%s folder=%s", info.Flavour, layerID, importFolderPath) + return nil +} + +// LayerWriter is an interface that supports writing a new container image layer. +type LayerWriter interface { + // Add adds a file to the layer with given metadata. + Add(name string, fileInfo *winio.FileBasicInfo) error + // AddLink adds a hard link to the layer. The target must already have been added. + AddLink(name string, target string) error + // Remove removes a file that was present in a parent layer from the layer. + Remove(name string) error + // Write writes data to the current file. The data must be in the format of a Win32 + // backup stream. + Write(b []byte) (int, error) + // Close finishes the layer writing process and releases any resources. + Close() error +} + +// FilterLayerWriter provides an interface to write the contents of a layer to the file system. +type FilterLayerWriter struct { + context uintptr +} + +// Add adds a file or directory to the layer. The file's parent directory must have already been added. +// +// name contains the file's relative path. fileInfo contains file times and file attributes; the rest +// of the file metadata and the file data must be written as a Win32 backup stream to the Write() method. +// winio.BackupStreamWriter can be used to facilitate this. +func (w *FilterLayerWriter) Add(name string, fileInfo *winio.FileBasicInfo) error { + if name[0] != '\\' { + name = `\` + name + } + err := importLayerNext(w.context, name, fileInfo) + if err != nil { + return makeError(err, "ImportLayerNext", "") + } + return nil +} + +// AddLink adds a hard link to the layer. The target of the link must have already been added. +func (w *FilterLayerWriter) AddLink(name string, target string) error { + return errors.New("hard links not yet supported") +} + +// Remove removes a file from the layer. The file must have been present in the parent layer. +// +// name contains the file's relative path. +func (w *FilterLayerWriter) Remove(name string) error { + if name[0] != '\\' { + name = `\` + name + } + err := importLayerNext(w.context, name, nil) + if err != nil { + return makeError(err, "ImportLayerNext", "") + } + return nil +} + +// Write writes more backup stream data to the current file. +func (w *FilterLayerWriter) Write(b []byte) (int, error) { + err := importLayerWrite(w.context, b) + if err != nil { + err = makeError(err, "ImportLayerWrite", "") + return 0, err + } + return len(b), err +} + +// Close completes the layer write operation. The error must be checked to ensure that the +// operation was successful. +func (w *FilterLayerWriter) Close() (err error) { + if w.context != 0 { + err = importLayerEnd(w.context) + if err != nil { + err = makeError(err, "ImportLayerEnd", "") + } + w.context = 0 + } + return +} + +type legacyLayerWriterWrapper struct { + *legacyLayerWriter + info DriverInfo + layerID string + path string + parentLayerPaths []string +} + +func (r *legacyLayerWriterWrapper) Close() error { + defer os.RemoveAll(r.root) + err := r.legacyLayerWriter.Close() + if err != nil { + return err + } + + // Use the original path here because ImportLayer does not support long paths for the source in TP5. + // But do use a long path for the destination to work around another bug with directories + // with MAX_PATH - 12 < length < MAX_PATH. + info := r.info + fullPath, err := makeLongAbsPath(filepath.Join(info.HomeDir, r.layerID)) + if err != nil { + return err + } + + info.HomeDir = "" + if err = ImportLayer(info, fullPath, r.path, r.parentLayerPaths); err != nil { + return err + } + // Add any hard links that were collected. + for _, lnk := range r.PendingLinks { + if err = os.Remove(lnk.Path); err != nil && !os.IsNotExist(err) { + return err + } + if err = os.Link(lnk.Target, lnk.Path); err != nil { + return err + } + } + // Prepare the utility VM for use if one is present in the layer. + if r.HasUtilityVM { + err = ProcessUtilityVMImage(filepath.Join(fullPath, "UtilityVM")) + if err != nil { + return err + } + } + return nil +} + +// NewLayerWriter returns a new layer writer for creating a layer on disk. +// The caller must have taken the SeBackupPrivilege and SeRestorePrivilege privileges +// to call this and any methods on the resulting LayerWriter. +func NewLayerWriter(info DriverInfo, layerID string, parentLayerPaths []string) (LayerWriter, error) { + if len(parentLayerPaths) == 0 { + // This is a base layer. It gets imported differently. + return &baseLayerWriter{ + root: filepath.Join(info.HomeDir, layerID), + }, nil + } + + if procImportLayerBegin.Find() != nil { + // The new layer reader is not available on this Windows build. Fall back to the + // legacy export code path. + path, err := ioutil.TempDir("", "hcs") + if err != nil { + return nil, err + } + return &legacyLayerWriterWrapper{ + legacyLayerWriter: newLegacyLayerWriter(path, parentLayerPaths, filepath.Join(info.HomeDir, layerID)), + info: info, + layerID: layerID, + path: path, + parentLayerPaths: parentLayerPaths, + }, nil + } + layers, err := layerPathsToDescriptors(parentLayerPaths) + if err != nil { + return nil, err + } + + infop, err := convertDriverInfo(info) + if err != nil { + return nil, err + } + + w := &FilterLayerWriter{} + err = importLayerBegin(&infop, layerID, layers, &w.context) + if err != nil { + return nil, makeError(err, "ImportLayerStart", "") + } + return w, nil +} diff --git a/vendor/github.com/Microsoft/hcsshim/interface.go b/vendor/github.com/Microsoft/hcsshim/interface.go new file mode 100644 index 0000000000..9fc7852e41 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/interface.go @@ -0,0 +1,187 @@ +package hcsshim + +import ( + "encoding/json" + "io" + "time" +) + +// ProcessConfig is used as both the input of Container.CreateProcess +// and to convert the parameters to JSON for passing onto the HCS +type ProcessConfig struct { + ApplicationName string `json:",omitempty"` + CommandLine string `json:",omitempty"` + CommandArgs []string `json:",omitempty"` // Used by Linux Containers on Windows + User string `json:",omitempty"` + WorkingDirectory string `json:",omitempty"` + Environment map[string]string `json:",omitempty"` + EmulateConsole bool `json:",omitempty"` + CreateStdInPipe bool `json:",omitempty"` + CreateStdOutPipe bool `json:",omitempty"` + CreateStdErrPipe bool `json:",omitempty"` + ConsoleSize [2]uint `json:",omitempty"` + CreateInUtilityVm bool `json:",omitempty"` // Used by Linux Containers on Windows + OCISpecification *json.RawMessage `json:",omitempty"` // Used by Linux Containers on Windows +} + +type Layer struct { + ID string + Path string +} + +type MappedDir struct { + HostPath string + ContainerPath string + ReadOnly bool + BandwidthMaximum uint64 + IOPSMaximum uint64 +} + +type MappedPipe struct { + HostPath string + ContainerPipeName string +} + +type HvRuntime struct { + ImagePath string `json:",omitempty"` + SkipTemplate bool `json:",omitempty"` + LinuxInitrdFile string `json:",omitempty"` // File under ImagePath on host containing an initrd image for starting a Linux utility VM + LinuxKernelFile string `json:",omitempty"` // File under ImagePath on host containing a kernel for starting a Linux utility VM + LinuxBootParameters string `json:",omitempty"` // Additional boot parameters for starting a Linux Utility VM in initrd mode + BootSource string `json:",omitempty"` // "Vhd" for Linux Utility VM booting from VHD + WritableBootSource bool `json:",omitempty"` // Linux Utility VM booting from VHD +} + +type MappedVirtualDisk struct { + HostPath string `json:",omitempty"` // Path to VHD on the host + ContainerPath string // Platform-specific mount point path in the container + CreateInUtilityVM bool `json:",omitempty"` + ReadOnly bool `json:",omitempty"` + Cache string `json:",omitempty"` // "" (Unspecified); "Disabled"; "Enabled"; "Private"; "PrivateAllowSharing" + AttachOnly bool `json:",omitempty:` +} + +// ContainerConfig is used as both the input of CreateContainer +// and to convert the parameters to JSON for passing onto the HCS +type ContainerConfig struct { + SystemType string // HCS requires this to be hard-coded to "Container" + Name string // Name of the container. We use the docker ID. + Owner string `json:",omitempty"` // The management platform that created this container + VolumePath string `json:",omitempty"` // Windows volume path for scratch space. Used by Windows Server Containers only. Format \\?\\Volume{GUID} + IgnoreFlushesDuringBoot bool `json:",omitempty"` // Optimization hint for container startup in Windows + LayerFolderPath string `json:",omitempty"` // Where the layer folders are located. Used by Windows Server Containers only. Format %root%\windowsfilter\containerID + Layers []Layer // List of storage layers. Required for Windows Server and Hyper-V Containers. Format ID=GUID;Path=%root%\windowsfilter\layerID + Credentials string `json:",omitempty"` // Credentials information + ProcessorCount uint32 `json:",omitempty"` // Number of processors to assign to the container. + ProcessorWeight uint64 `json:",omitempty"` // CPU shares (relative weight to other containers with cpu shares). Range is from 1 to 10000. A value of 0 results in default shares. + ProcessorMaximum int64 `json:",omitempty"` // Specifies the portion of processor cycles that this container can use as a percentage times 100. Range is from 1 to 10000. A value of 0 results in no limit. + StorageIOPSMaximum uint64 `json:",omitempty"` // Maximum Storage IOPS + StorageBandwidthMaximum uint64 `json:",omitempty"` // Maximum Storage Bandwidth in bytes per second + StorageSandboxSize uint64 `json:",omitempty"` // Size in bytes that the container system drive should be expanded to if smaller + MemoryMaximumInMB int64 `json:",omitempty"` // Maximum memory available to the container in Megabytes + HostName string `json:",omitempty"` // Hostname + MappedDirectories []MappedDir `json:",omitempty"` // List of mapped directories (volumes/mounts) + MappedPipes []MappedPipe `json:",omitempty"` // List of mapped Windows named pipes + HvPartition bool // True if it a Hyper-V Container + NetworkSharedContainerName string `json:",omitempty"` // Name (ID) of the container that we will share the network stack with. + EndpointList []string `json:",omitempty"` // List of networking endpoints to be attached to container + HvRuntime *HvRuntime `json:",omitempty"` // Hyper-V container settings. Used by Hyper-V containers only. Format ImagePath=%root%\BaseLayerID\UtilityVM + Servicing bool `json:",omitempty"` // True if this container is for servicing + AllowUnqualifiedDNSQuery bool `json:",omitempty"` // True to allow unqualified DNS name resolution + DNSSearchList string `json:",omitempty"` // Comma seperated list of DNS suffixes to use for name resolution + ContainerType string `json:",omitempty"` // "Linux" for Linux containers on Windows. Omitted otherwise. + TerminateOnLastHandleClosed bool `json:",omitempty"` // Should HCS terminate the container once all handles have been closed + MappedVirtualDisks []MappedVirtualDisk `json:",omitempty"` // Array of virtual disks to mount at start +} + +type ComputeSystemQuery struct { + IDs []string `json:"Ids,omitempty"` + Types []string `json:",omitempty"` + Names []string `json:",omitempty"` + Owners []string `json:",omitempty"` +} + +// Container represents a created (but not necessarily running) container. +type Container interface { + // Start synchronously starts the container. + Start() error + + // Shutdown requests a container shutdown, but it may not actually be shutdown until Wait() succeeds. + Shutdown() error + + // Terminate requests a container terminate, but it may not actually be terminated until Wait() succeeds. + Terminate() error + + // Waits synchronously waits for the container to shutdown or terminate. + Wait() error + + // WaitTimeout synchronously waits for the container to terminate or the duration to elapse. It + // returns false if timeout occurs. + WaitTimeout(time.Duration) error + + // Pause pauses the execution of a container. + Pause() error + + // Resume resumes the execution of a container. + Resume() error + + // HasPendingUpdates returns true if the container has updates pending to install. + HasPendingUpdates() (bool, error) + + // Statistics returns statistics for a container. + Statistics() (Statistics, error) + + // ProcessList returns details for the processes in a container. + ProcessList() ([]ProcessListItem, error) + + // MappedVirtualDisks returns virtual disks mapped to a utility VM, indexed by controller + MappedVirtualDisks() (map[int]MappedVirtualDiskController, error) + + // CreateProcess launches a new process within the container. + CreateProcess(c *ProcessConfig) (Process, error) + + // OpenProcess gets an interface to an existing process within the container. + OpenProcess(pid int) (Process, error) + + // Close cleans up any state associated with the container but does not terminate or wait for it. + Close() error + + // Modify the System + Modify(config *ResourceModificationRequestResponse) error +} + +// Process represents a running or exited process. +type Process interface { + // Pid returns the process ID of the process within the container. + Pid() int + + // Kill signals the process to terminate but does not wait for it to finish terminating. + Kill() error + + // Wait waits for the process to exit. + Wait() error + + // WaitTimeout waits for the process to exit or the duration to elapse. It returns + // false if timeout occurs. + WaitTimeout(time.Duration) error + + // ExitCode returns the exit code of the process. The process must have + // already terminated. + ExitCode() (int, error) + + // ResizeConsole resizes the console of the process. + ResizeConsole(width, height uint16) error + + // Stdio returns the stdin, stdout, and stderr pipes, respectively. Closing + // these pipes does not close the underlying pipes; it should be possible to + // call this multiple times to get multiple interfaces. + Stdio() (io.WriteCloser, io.ReadCloser, io.ReadCloser, error) + + // CloseStdin closes the write side of the stdin pipe so that the process is + // notified on the read side that there is no more data in stdin. + CloseStdin() error + + // Close cleans up any state associated with the process but does not kill + // or wait on it. + Close() error +} diff --git a/vendor/github.com/Microsoft/hcsshim/layerexists.go b/vendor/github.com/Microsoft/hcsshim/layerexists.go new file mode 100644 index 0000000000..fe46f404c3 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/layerexists.go @@ -0,0 +1,30 @@ +package hcsshim + +import "github.com/sirupsen/logrus" + +// LayerExists will return true if a layer with the given id exists and is known +// to the system. +func LayerExists(info DriverInfo, id string) (bool, error) { + title := "hcsshim::LayerExists " + logrus.Debugf(title+"Flavour %d ID %s", info.Flavour, id) + + // Convert info to API calling convention + infop, err := convertDriverInfo(info) + if err != nil { + logrus.Error(err) + return false, err + } + + // Call the procedure itself. + var exists uint32 + + err = layerExists(&infop, id, &exists) + if err != nil { + err = makeErrorf(err, title, "id=%s flavour=%d", id, info.Flavour) + logrus.Error(err) + return false, err + } + + logrus.Debugf(title+"succeeded flavour=%d id=%s exists=%d", info.Flavour, id, exists) + return exists != 0, nil +} diff --git a/vendor/github.com/Microsoft/hcsshim/layerutils.go b/vendor/github.com/Microsoft/hcsshim/layerutils.go new file mode 100644 index 0000000000..c0e5503773 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/layerutils.go @@ -0,0 +1,111 @@ +package hcsshim + +// This file contains utility functions to support storage (graph) related +// functionality. + +import ( + "path/filepath" + "syscall" + + "github.com/sirupsen/logrus" +) + +/* To pass into syscall, we need a struct matching the following: +enum GraphDriverType +{ + DiffDriver, + FilterDriver +}; + +struct DriverInfo { + GraphDriverType Flavour; + LPCWSTR HomeDir; +}; +*/ +type DriverInfo struct { + Flavour int + HomeDir string +} + +type driverInfo struct { + Flavour int + HomeDirp *uint16 +} + +func convertDriverInfo(info DriverInfo) (driverInfo, error) { + homedirp, err := syscall.UTF16PtrFromString(info.HomeDir) + if err != nil { + logrus.Debugf("Failed conversion of home to pointer for driver info: %s", err.Error()) + return driverInfo{}, err + } + + return driverInfo{ + Flavour: info.Flavour, + HomeDirp: homedirp, + }, nil +} + +/* To pass into syscall, we need a struct matching the following: +typedef struct _WC_LAYER_DESCRIPTOR { + + // + // The ID of the layer + // + + GUID LayerId; + + // + // Additional flags + // + + union { + struct { + ULONG Reserved : 31; + ULONG Dirty : 1; // Created from sandbox as a result of snapshot + }; + ULONG Value; + } Flags; + + // + // Path to the layer root directory, null-terminated + // + + PCWSTR Path; + +} WC_LAYER_DESCRIPTOR, *PWC_LAYER_DESCRIPTOR; +*/ +type WC_LAYER_DESCRIPTOR struct { + LayerId GUID + Flags uint32 + Pathp *uint16 +} + +func layerPathsToDescriptors(parentLayerPaths []string) ([]WC_LAYER_DESCRIPTOR, error) { + // Array of descriptors that gets constructed. + var layers []WC_LAYER_DESCRIPTOR + + for i := 0; i < len(parentLayerPaths); i++ { + // Create a layer descriptor, using the folder name + // as the source for a GUID LayerId + _, folderName := filepath.Split(parentLayerPaths[i]) + g, err := NameToGuid(folderName) + if err != nil { + logrus.Debugf("Failed to convert name to guid %s", err) + return nil, err + } + + p, err := syscall.UTF16PtrFromString(parentLayerPaths[i]) + if err != nil { + logrus.Debugf("Failed conversion of parentLayerPath to pointer %s", err) + return nil, err + } + + layers = append(layers, WC_LAYER_DESCRIPTOR{ + LayerId: g, + Flags: 0, + Pathp: p, + }) + } + + return layers, nil +} diff --git a/vendor/github.com/Microsoft/hcsshim/legacy.go b/vendor/github.com/Microsoft/hcsshim/legacy.go new file mode 100644 index 0000000000..c7f6073ac3 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/legacy.go @@ -0,0 +1,741 @@ +package hcsshim + +import ( + "bufio" + "encoding/binary" + "errors" + "fmt" + "io" + "os" + "path/filepath" + "strings" + "syscall" + + "github.com/Microsoft/go-winio" +) + +var errorIterationCanceled = errors.New("") + +var mutatedUtilityVMFiles = map[string]bool{ + `EFI\Microsoft\Boot\BCD`: true, + `EFI\Microsoft\Boot\BCD.LOG`: true, + `EFI\Microsoft\Boot\BCD.LOG1`: true, + `EFI\Microsoft\Boot\BCD.LOG2`: true, +} + +const ( + filesPath = `Files` + hivesPath = `Hives` + utilityVMPath = `UtilityVM` + utilityVMFilesPath = `UtilityVM\Files` +) + +func openFileOrDir(path string, mode uint32, createDisposition uint32) (file *os.File, err error) { + return winio.OpenForBackup(path, mode, syscall.FILE_SHARE_READ, createDisposition) +} + +func makeLongAbsPath(path string) (string, error) { + if strings.HasPrefix(path, `\\?\`) || strings.HasPrefix(path, `\\.\`) { + return path, nil + } + if !filepath.IsAbs(path) { + absPath, err := filepath.Abs(path) + if err != nil { + return "", err + } + path = absPath + } + if strings.HasPrefix(path, `\\`) { + return `\\?\UNC\` + path[2:], nil + } + return `\\?\` + path, nil +} + +func hasPathPrefix(p, prefix string) bool { + return strings.HasPrefix(p, prefix) && len(p) > len(prefix) && p[len(prefix)] == '\\' +} + +type fileEntry struct { + path string + fi os.FileInfo + err error +} + +type legacyLayerReader struct { + root string + result chan *fileEntry + proceed chan bool + currentFile *os.File + backupReader *winio.BackupFileReader +} + +// newLegacyLayerReader returns a new LayerReader that can read the Windows +// container layer transport format from disk. +func newLegacyLayerReader(root string) *legacyLayerReader { + r := &legacyLayerReader{ + root: root, + result: make(chan *fileEntry), + proceed: make(chan bool), + } + go r.walk() + return r +} + +func readTombstones(path string) (map[string]([]string), error) { + tf, err := os.Open(filepath.Join(path, "tombstones.txt")) + if err != nil { + return nil, err + } + defer tf.Close() + s := bufio.NewScanner(tf) + if !s.Scan() || s.Text() != "\xef\xbb\xbfVersion 1.0" { + return nil, errors.New("Invalid tombstones file") + } + + ts := make(map[string]([]string)) + for s.Scan() { + t := filepath.Join(filesPath, s.Text()[1:]) // skip leading `\` + dir := filepath.Dir(t) + ts[dir] = append(ts[dir], t) + } + if err = s.Err(); err != nil { + return nil, err + } + + return ts, nil +} + +func (r *legacyLayerReader) walkUntilCancelled() error { + root, err := makeLongAbsPath(r.root) + if err != nil { + return err + } + + r.root = root + ts, err := readTombstones(r.root) + if err != nil { + return err + } + + err = filepath.Walk(r.root, func(path string, info os.FileInfo, err error) error { + if err != nil { + return err + } + if path == r.root || path == filepath.Join(r.root, "tombstones.txt") || strings.HasSuffix(path, ".$wcidirs$") { + return nil + } + + r.result <- &fileEntry{path, info, nil} + if !<-r.proceed { + return errorIterationCanceled + } + + // List all the tombstones. + if info.IsDir() { + relPath, err := filepath.Rel(r.root, path) + if err != nil { + return err + } + if dts, ok := ts[relPath]; ok { + for _, t := range dts { + r.result <- &fileEntry{filepath.Join(r.root, t), nil, nil} + if !<-r.proceed { + return errorIterationCanceled + } + } + } + } + return nil + }) + if err == errorIterationCanceled { + return nil + } + if err == nil { + return io.EOF + } + return err +} + +func (r *legacyLayerReader) walk() { + defer close(r.result) + if !<-r.proceed { + return + } + + err := r.walkUntilCancelled() + if err != nil { + for { + r.result <- &fileEntry{err: err} + if !<-r.proceed { + return + } + } + } +} + +func (r *legacyLayerReader) reset() { + if r.backupReader != nil { + r.backupReader.Close() + r.backupReader = nil + } + if r.currentFile != nil { + r.currentFile.Close() + r.currentFile = nil + } +} + +func findBackupStreamSize(r io.Reader) (int64, error) { + br := winio.NewBackupStreamReader(r) + for { + hdr, err := br.Next() + if err != nil { + if err == io.EOF { + err = nil + } + return 0, err + } + if hdr.Id == winio.BackupData { + return hdr.Size, nil + } + } +} + +func (r *legacyLayerReader) Next() (path string, size int64, fileInfo *winio.FileBasicInfo, err error) { + r.reset() + r.proceed <- true + fe := <-r.result + if fe == nil { + err = errors.New("LegacyLayerReader closed") + return + } + if fe.err != nil { + err = fe.err + return + } + + path, err = filepath.Rel(r.root, fe.path) + if err != nil { + return + } + + if fe.fi == nil { + // This is a tombstone. Return a nil fileInfo. + return + } + + if fe.fi.IsDir() && hasPathPrefix(path, filesPath) { + fe.path += ".$wcidirs$" + } + + f, err := openFileOrDir(fe.path, syscall.GENERIC_READ, syscall.OPEN_EXISTING) + if err != nil { + return + } + defer func() { + if f != nil { + f.Close() + } + }() + + fileInfo, err = winio.GetFileBasicInfo(f) + if err != nil { + return + } + + if !hasPathPrefix(path, filesPath) { + size = fe.fi.Size() + r.backupReader = winio.NewBackupFileReader(f, false) + if path == hivesPath || path == filesPath { + // The Hives directory has a non-deterministic file time because of the + // nature of the import process. Use the times from System_Delta. + var g *os.File + g, err = os.Open(filepath.Join(r.root, hivesPath, `System_Delta`)) + if err != nil { + return + } + attr := fileInfo.FileAttributes + fileInfo, err = winio.GetFileBasicInfo(g) + g.Close() + if err != nil { + return + } + fileInfo.FileAttributes = attr + } + + // The creation time and access time get reset for files outside of the Files path. + fileInfo.CreationTime = fileInfo.LastWriteTime + fileInfo.LastAccessTime = fileInfo.LastWriteTime + + } else { + // The file attributes are written before the backup stream. + var attr uint32 + err = binary.Read(f, binary.LittleEndian, &attr) + if err != nil { + return + } + fileInfo.FileAttributes = uintptr(attr) + beginning := int64(4) + + // Find the accurate file size. + if !fe.fi.IsDir() { + size, err = findBackupStreamSize(f) + if err != nil { + err = &os.PathError{Op: "findBackupStreamSize", Path: fe.path, Err: err} + return + } + } + + // Return back to the beginning of the backup stream. + _, err = f.Seek(beginning, 0) + if err != nil { + return + } + } + + r.currentFile = f + f = nil + return +} + +func (r *legacyLayerReader) Read(b []byte) (int, error) { + if r.backupReader == nil { + if r.currentFile == nil { + return 0, io.EOF + } + return r.currentFile.Read(b) + } + return r.backupReader.Read(b) +} + +func (r *legacyLayerReader) Seek(offset int64, whence int) (int64, error) { + if r.backupReader == nil { + if r.currentFile == nil { + return 0, errors.New("no current file") + } + return r.currentFile.Seek(offset, whence) + } + return 0, errors.New("seek not supported on this stream") +} + +func (r *legacyLayerReader) Close() error { + r.proceed <- false + <-r.result + r.reset() + return nil +} + +type pendingLink struct { + Path, Target string +} + +type legacyLayerWriter struct { + root string + parentRoots []string + destRoot string + currentFile *os.File + backupWriter *winio.BackupFileWriter + tombstones []string + pathFixed bool + HasUtilityVM bool + uvmDi []dirInfo + addedFiles map[string]bool + PendingLinks []pendingLink +} + +// newLegacyLayerWriter returns a LayerWriter that can write the contaler layer +// transport format to disk. +func newLegacyLayerWriter(root string, parentRoots []string, destRoot string) *legacyLayerWriter { + return &legacyLayerWriter{ + root: root, + parentRoots: parentRoots, + destRoot: destRoot, + addedFiles: make(map[string]bool), + } +} + +func (w *legacyLayerWriter) init() error { + if !w.pathFixed { + path, err := makeLongAbsPath(w.root) + if err != nil { + return err + } + for i, p := range w.parentRoots { + w.parentRoots[i], err = makeLongAbsPath(p) + if err != nil { + return err + } + } + destPath, err := makeLongAbsPath(w.destRoot) + if err != nil { + return err + } + w.root = path + w.destRoot = destPath + w.pathFixed = true + } + return nil +} + +func (w *legacyLayerWriter) initUtilityVM() error { + if !w.HasUtilityVM { + err := os.Mkdir(filepath.Join(w.destRoot, utilityVMPath), 0) + if err != nil { + return err + } + // Server 2016 does not support multiple layers for the utility VM, so + // clone the utility VM from the parent layer into this layer. Use hard + // links to avoid unnecessary copying, since most of the files are + // immutable. + err = cloneTree(filepath.Join(w.parentRoots[0], utilityVMFilesPath), filepath.Join(w.destRoot, utilityVMFilesPath), mutatedUtilityVMFiles) + if err != nil { + return fmt.Errorf("cloning the parent utility VM image failed: %s", err) + } + w.HasUtilityVM = true + } + return nil +} + +func (w *legacyLayerWriter) reset() { + if w.backupWriter != nil { + w.backupWriter.Close() + w.backupWriter = nil + } + if w.currentFile != nil { + w.currentFile.Close() + w.currentFile = nil + } +} + +// copyFileWithMetadata copies a file using the backup/restore APIs in order to preserve metadata +func copyFileWithMetadata(srcPath, destPath string, isDir bool) (fileInfo *winio.FileBasicInfo, err error) { + createDisposition := uint32(syscall.CREATE_NEW) + if isDir { + err = os.Mkdir(destPath, 0) + if err != nil { + return nil, err + } + createDisposition = syscall.OPEN_EXISTING + } + + src, err := openFileOrDir(srcPath, syscall.GENERIC_READ|winio.ACCESS_SYSTEM_SECURITY, syscall.OPEN_EXISTING) + if err != nil { + return nil, err + } + defer src.Close() + srcr := winio.NewBackupFileReader(src, true) + defer srcr.Close() + + fileInfo, err = winio.GetFileBasicInfo(src) + if err != nil { + return nil, err + } + + dest, err := openFileOrDir(destPath, syscall.GENERIC_READ|syscall.GENERIC_WRITE|winio.WRITE_DAC|winio.WRITE_OWNER|winio.ACCESS_SYSTEM_SECURITY, createDisposition) + if err != nil { + return nil, err + } + defer dest.Close() + + err = winio.SetFileBasicInfo(dest, fileInfo) + if err != nil { + return nil, err + } + + destw := winio.NewBackupFileWriter(dest, true) + defer func() { + cerr := destw.Close() + if err == nil { + err = cerr + } + }() + + _, err = io.Copy(destw, srcr) + if err != nil { + return nil, err + } + + return fileInfo, nil +} + +// cloneTree clones a directory tree using hard links. It skips hard links for +// the file names in the provided map and just copies those files. +func cloneTree(srcPath, destPath string, mutatedFiles map[string]bool) error { + var di []dirInfo + err := filepath.Walk(srcPath, func(srcFilePath string, info os.FileInfo, err error) error { + if err != nil { + return err + } + + relPath, err := filepath.Rel(srcPath, srcFilePath) + if err != nil { + return err + } + destFilePath := filepath.Join(destPath, relPath) + + // Directories, reparse points, and files that will be mutated during + // utility VM import must be copied. All other files can be hard linked. + isReparsePoint := info.Sys().(*syscall.Win32FileAttributeData).FileAttributes&syscall.FILE_ATTRIBUTE_REPARSE_POINT != 0 + if info.IsDir() || isReparsePoint || mutatedFiles[relPath] { + fi, err := copyFileWithMetadata(srcFilePath, destFilePath, info.IsDir()) + if err != nil { + return err + } + if info.IsDir() && !isReparsePoint { + di = append(di, dirInfo{path: destFilePath, fileInfo: *fi}) + } + } else { + err = os.Link(srcFilePath, destFilePath) + if err != nil { + return err + } + } + + // Don't recurse on reparse points. + if info.IsDir() && isReparsePoint { + return filepath.SkipDir + } + + return nil + }) + if err != nil { + return err + } + + return reapplyDirectoryTimes(di) +} + +func (w *legacyLayerWriter) Add(name string, fileInfo *winio.FileBasicInfo) error { + w.reset() + err := w.init() + if err != nil { + return err + } + + if name == utilityVMPath { + return w.initUtilityVM() + } + + if hasPathPrefix(name, utilityVMPath) { + if !w.HasUtilityVM { + return errors.New("missing UtilityVM directory") + } + if !hasPathPrefix(name, utilityVMFilesPath) && name != utilityVMFilesPath { + return errors.New("invalid UtilityVM layer") + } + path := filepath.Join(w.destRoot, name) + createDisposition := uint32(syscall.OPEN_EXISTING) + if (fileInfo.FileAttributes & syscall.FILE_ATTRIBUTE_DIRECTORY) != 0 { + st, err := os.Lstat(path) + if err != nil && !os.IsNotExist(err) { + return err + } + if st != nil { + // Delete the existing file/directory if it is not the same type as this directory. + existingAttr := st.Sys().(*syscall.Win32FileAttributeData).FileAttributes + if (uint32(fileInfo.FileAttributes)^existingAttr)&(syscall.FILE_ATTRIBUTE_DIRECTORY|syscall.FILE_ATTRIBUTE_REPARSE_POINT) != 0 { + if err = os.RemoveAll(path); err != nil { + return err + } + st = nil + } + } + if st == nil { + if err = os.Mkdir(path, 0); err != nil { + return err + } + } + if fileInfo.FileAttributes&syscall.FILE_ATTRIBUTE_REPARSE_POINT == 0 { + w.uvmDi = append(w.uvmDi, dirInfo{path: path, fileInfo: *fileInfo}) + } + } else { + // Overwrite any existing hard link. + err = os.Remove(path) + if err != nil && !os.IsNotExist(err) { + return err + } + createDisposition = syscall.CREATE_NEW + } + + f, err := openFileOrDir(path, syscall.GENERIC_READ|syscall.GENERIC_WRITE|winio.WRITE_DAC|winio.WRITE_OWNER|winio.ACCESS_SYSTEM_SECURITY, createDisposition) + if err != nil { + return err + } + defer func() { + if f != nil { + f.Close() + os.Remove(path) + } + }() + + err = winio.SetFileBasicInfo(f, fileInfo) + if err != nil { + return err + } + + w.backupWriter = winio.NewBackupFileWriter(f, true) + w.currentFile = f + w.addedFiles[name] = true + f = nil + return nil + } + + path := filepath.Join(w.root, name) + if (fileInfo.FileAttributes & syscall.FILE_ATTRIBUTE_DIRECTORY) != 0 { + err := os.Mkdir(path, 0) + if err != nil { + return err + } + path += ".$wcidirs$" + } + + f, err := openFileOrDir(path, syscall.GENERIC_READ|syscall.GENERIC_WRITE, syscall.CREATE_NEW) + if err != nil { + return err + } + defer func() { + if f != nil { + f.Close() + os.Remove(path) + } + }() + + strippedFi := *fileInfo + strippedFi.FileAttributes = 0 + err = winio.SetFileBasicInfo(f, &strippedFi) + if err != nil { + return err + } + + if hasPathPrefix(name, hivesPath) { + w.backupWriter = winio.NewBackupFileWriter(f, false) + } else { + // The file attributes are written before the stream. + err = binary.Write(f, binary.LittleEndian, uint32(fileInfo.FileAttributes)) + if err != nil { + return err + } + } + + w.currentFile = f + w.addedFiles[name] = true + f = nil + return nil +} + +func (w *legacyLayerWriter) AddLink(name string, target string) error { + w.reset() + err := w.init() + if err != nil { + return err + } + + var roots []string + if hasPathPrefix(target, filesPath) { + // Look for cross-layer hard link targets in the parent layers, since + // nothing is in the destination path yet. + roots = w.parentRoots + } else if hasPathPrefix(target, utilityVMFilesPath) { + // Since the utility VM is fully cloned into the destination path + // already, look for cross-layer hard link targets directly in the + // destination path. + roots = []string{w.destRoot} + } + + if roots == nil || (!hasPathPrefix(name, filesPath) && !hasPathPrefix(name, utilityVMFilesPath)) { + return errors.New("invalid hard link in layer") + } + + // Find to try the target of the link in a previously added file. If that + // fails, search in parent layers. + var selectedRoot string + if _, ok := w.addedFiles[target]; ok { + selectedRoot = w.destRoot + } else { + for _, r := range roots { + if _, err = os.Lstat(filepath.Join(r, target)); err != nil { + if !os.IsNotExist(err) { + return err + } + } else { + selectedRoot = r + break + } + } + if selectedRoot == "" { + return fmt.Errorf("failed to find link target for '%s' -> '%s'", name, target) + } + } + // The link can't be written until after the ImportLayer call. + w.PendingLinks = append(w.PendingLinks, pendingLink{ + Path: filepath.Join(w.destRoot, name), + Target: filepath.Join(selectedRoot, target), + }) + w.addedFiles[name] = true + return nil +} + +func (w *legacyLayerWriter) Remove(name string) error { + if hasPathPrefix(name, filesPath) { + w.tombstones = append(w.tombstones, name[len(filesPath)+1:]) + } else if hasPathPrefix(name, utilityVMFilesPath) { + err := w.initUtilityVM() + if err != nil { + return err + } + // Make sure the path exists; os.RemoveAll will not fail if the file is + // already gone, and this needs to be a fatal error for diagnostics + // purposes. + path := filepath.Join(w.destRoot, name) + if _, err := os.Lstat(path); err != nil { + return err + } + err = os.RemoveAll(path) + if err != nil { + return err + } + } else { + return fmt.Errorf("invalid tombstone %s", name) + } + + return nil +} + +func (w *legacyLayerWriter) Write(b []byte) (int, error) { + if w.backupWriter == nil { + if w.currentFile == nil { + return 0, errors.New("closed") + } + return w.currentFile.Write(b) + } + return w.backupWriter.Write(b) +} + +func (w *legacyLayerWriter) Close() error { + w.reset() + err := w.init() + if err != nil { + return err + } + tf, err := os.Create(filepath.Join(w.root, "tombstones.txt")) + if err != nil { + return err + } + defer tf.Close() + _, err = tf.Write([]byte("\xef\xbb\xbfVersion 1.0\n")) + if err != nil { + return err + } + for _, t := range w.tombstones { + _, err = tf.Write([]byte(filepath.Join(`\`, t) + "\n")) + if err != nil { + return err + } + } + if w.HasUtilityVM { + err = reapplyDirectoryTimes(w.uvmDi) + if err != nil { + return err + } + } + return nil +} diff --git a/vendor/github.com/Microsoft/hcsshim/mksyscall_windows.go b/vendor/github.com/Microsoft/hcsshim/mksyscall_windows.go new file mode 100644 index 0000000000..82393ca367 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/mksyscall_windows.go @@ -0,0 +1,934 @@ +// Copyright 2013 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +// +build ignore + +/* +mksyscall_windows generates windows system call bodies + +It parses all files specified on command line containing function +prototypes (like syscall_windows.go) and prints system call bodies +to standard output. + +The prototypes are marked by lines beginning with "//sys" and read +like func declarations if //sys is replaced by func, but: + +* The parameter lists must give a name for each argument. This + includes return parameters. + +* The parameter lists must give a type for each argument: + the (x, y, z int) shorthand is not allowed. + +* If the return parameter is an error number, it must be named err. + +* If go func name needs to be different from it's winapi dll name, + the winapi name could be specified at the end, after "=" sign, like + //sys LoadLibrary(libname string) (handle uint32, err error) = LoadLibraryA + +* Each function that returns err needs to supply a condition, that + return value of winapi will be tested against to detect failure. + This would set err to windows "last-error", otherwise it will be nil. + The value can be provided at end of //sys declaration, like + //sys LoadLibrary(libname string) (handle uint32, err error) [failretval==-1] = LoadLibraryA + and is [failretval==0] by default. + +Usage: + mksyscall_windows [flags] [path ...] + +The flags are: + -output + Specify output file name (outputs to console if blank). + -trace + Generate print statement after every syscall. +*/ +package main + +import ( + "bufio" + "bytes" + "errors" + "flag" + "fmt" + "go/format" + "go/parser" + "go/token" + "io" + "io/ioutil" + "log" + "os" + "path/filepath" + "runtime" + "sort" + "strconv" + "strings" + "text/template" +) + +var ( + filename = flag.String("output", "", "output file name (standard output if omitted)") + printTraceFlag = flag.Bool("trace", false, "generate print statement after every syscall") + systemDLL = flag.Bool("systemdll", true, "whether all DLLs should be loaded from the Windows system directory") +) + +func trim(s string) string { + return strings.Trim(s, " \t") +} + +var packageName string + +func packagename() string { + return packageName +} + +func syscalldot() string { + if packageName == "syscall" { + return "" + } + return "syscall." +} + +// Param is function parameter +type Param struct { + Name string + Type string + fn *Fn + tmpVarIdx int +} + +// tmpVar returns temp variable name that will be used to represent p during syscall. +func (p *Param) tmpVar() string { + if p.tmpVarIdx < 0 { + p.tmpVarIdx = p.fn.curTmpVarIdx + p.fn.curTmpVarIdx++ + } + return fmt.Sprintf("_p%d", p.tmpVarIdx) +} + +// BoolTmpVarCode returns source code for bool temp variable. +func (p *Param) BoolTmpVarCode() string { + const code = `var %s uint32 + if %s { + %s = 1 + } else { + %s = 0 + }` + tmp := p.tmpVar() + return fmt.Sprintf(code, tmp, p.Name, tmp, tmp) +} + +// SliceTmpVarCode returns source code for slice temp variable. +func (p *Param) SliceTmpVarCode() string { + const code = `var %s *%s + if len(%s) > 0 { + %s = &%s[0] + }` + tmp := p.tmpVar() + return fmt.Sprintf(code, tmp, p.Type[2:], p.Name, tmp, p.Name) +} + +// StringTmpVarCode returns source code for string temp variable. +func (p *Param) StringTmpVarCode() string { + errvar := p.fn.Rets.ErrorVarName() + if errvar == "" { + errvar = "_" + } + tmp := p.tmpVar() + const code = `var %s %s + %s, %s = %s(%s)` + s := fmt.Sprintf(code, tmp, p.fn.StrconvType(), tmp, errvar, p.fn.StrconvFunc(), p.Name) + if errvar == "-" { + return s + } + const morecode = ` + if %s != nil { + return + }` + return s + fmt.Sprintf(morecode, errvar) +} + +// TmpVarCode returns source code for temp variable. +func (p *Param) TmpVarCode() string { + switch { + case p.Type == "bool": + return p.BoolTmpVarCode() + case strings.HasPrefix(p.Type, "[]"): + return p.SliceTmpVarCode() + default: + return "" + } +} + +// TmpVarHelperCode returns source code for helper's temp variable. +func (p *Param) TmpVarHelperCode() string { + if p.Type != "string" { + return "" + } + return p.StringTmpVarCode() +} + +// SyscallArgList returns source code fragments representing p parameter +// in syscall. Slices are translated into 2 syscall parameters: pointer to +// the first element and length. +func (p *Param) SyscallArgList() []string { + t := p.HelperType() + var s string + switch { + case t[0] == '*': + s = fmt.Sprintf("unsafe.Pointer(%s)", p.Name) + case t == "bool": + s = p.tmpVar() + case strings.HasPrefix(t, "[]"): + return []string{ + fmt.Sprintf("uintptr(unsafe.Pointer(%s))", p.tmpVar()), + fmt.Sprintf("uintptr(len(%s))", p.Name), + } + default: + s = p.Name + } + return []string{fmt.Sprintf("uintptr(%s)", s)} +} + +// IsError determines if p parameter is used to return error. +func (p *Param) IsError() bool { + return p.Name == "err" && p.Type == "error" +} + +// HelperType returns type of parameter p used in helper function. +func (p *Param) HelperType() string { + if p.Type == "string" { + return p.fn.StrconvType() + } + return p.Type +} + +// join concatenates parameters ps into a string with sep separator. +// Each parameter is converted into string by applying fn to it +// before conversion. +func join(ps []*Param, fn func(*Param) string, sep string) string { + if len(ps) == 0 { + return "" + } + a := make([]string, 0) + for _, p := range ps { + a = append(a, fn(p)) + } + return strings.Join(a, sep) +} + +// Rets describes function return parameters. +type Rets struct { + Name string + Type string + ReturnsError bool + FailCond string +} + +// ErrorVarName returns error variable name for r. +func (r *Rets) ErrorVarName() string { + if r.ReturnsError { + return "err" + } + if r.Type == "error" { + return r.Name + } + return "" +} + +// ToParams converts r into slice of *Param. +func (r *Rets) ToParams() []*Param { + ps := make([]*Param, 0) + if len(r.Name) > 0 { + ps = append(ps, &Param{Name: r.Name, Type: r.Type}) + } + if r.ReturnsError { + ps = append(ps, &Param{Name: "err", Type: "error"}) + } + return ps +} + +// List returns source code of syscall return parameters. +func (r *Rets) List() string { + s := join(r.ToParams(), func(p *Param) string { return p.Name + " " + p.Type }, ", ") + if len(s) > 0 { + s = "(" + s + ")" + } + return s +} + +// PrintList returns source code of trace printing part correspondent +// to syscall return values. +func (r *Rets) PrintList() string { + return join(r.ToParams(), func(p *Param) string { return fmt.Sprintf(`"%s=", %s, `, p.Name, p.Name) }, `", ", `) +} + +// SetReturnValuesCode returns source code that accepts syscall return values. +func (r *Rets) SetReturnValuesCode() string { + if r.Name == "" && !r.ReturnsError { + return "" + } + retvar := "r0" + if r.Name == "" { + retvar = "r1" + } + errvar := "_" + if r.ReturnsError { + errvar = "e1" + } + return fmt.Sprintf("%s, _, %s := ", retvar, errvar) +} + +func (r *Rets) useLongHandleErrorCode(retvar string) string { + const code = `if %s { + if e1 != 0 { + err = errnoErr(e1) + } else { + err = %sEINVAL + } + }` + cond := retvar + " == 0" + if r.FailCond != "" { + cond = strings.Replace(r.FailCond, "failretval", retvar, 1) + } + return fmt.Sprintf(code, cond, syscalldot()) +} + +// SetErrorCode returns source code that sets return parameters. +func (r *Rets) SetErrorCode() string { + const code = `if r0 != 0 { + %s = %sErrno(r0) + }` + const hrCode = `if int32(r0) < 0 { + %s = %sErrno(win32FromHresult(r0)) + }` + if r.Name == "" && !r.ReturnsError { + return "" + } + if r.Name == "" { + return r.useLongHandleErrorCode("r1") + } + if r.Type == "error" { + if r.Name == "hr" { + return fmt.Sprintf(hrCode, r.Name, syscalldot()) + } else { + return fmt.Sprintf(code, r.Name, syscalldot()) + } + } + s := "" + switch { + case r.Type[0] == '*': + s = fmt.Sprintf("%s = (%s)(unsafe.Pointer(r0))", r.Name, r.Type) + case r.Type == "bool": + s = fmt.Sprintf("%s = r0 != 0", r.Name) + default: + s = fmt.Sprintf("%s = %s(r0)", r.Name, r.Type) + } + if !r.ReturnsError { + return s + } + return s + "\n\t" + r.useLongHandleErrorCode(r.Name) +} + +// Fn describes syscall function. +type Fn struct { + Name string + Params []*Param + Rets *Rets + PrintTrace bool + confirmproc bool + dllname string + dllfuncname string + src string + // TODO: get rid of this field and just use parameter index instead + curTmpVarIdx int // insure tmp variables have uniq names +} + +// extractParams parses s to extract function parameters. +func extractParams(s string, f *Fn) ([]*Param, error) { + s = trim(s) + if s == "" { + return nil, nil + } + a := strings.Split(s, ",") + ps := make([]*Param, len(a)) + for i := range ps { + s2 := trim(a[i]) + b := strings.Split(s2, " ") + if len(b) != 2 { + b = strings.Split(s2, "\t") + if len(b) != 2 { + return nil, errors.New("Could not extract function parameter from \"" + s2 + "\"") + } + } + ps[i] = &Param{ + Name: trim(b[0]), + Type: trim(b[1]), + fn: f, + tmpVarIdx: -1, + } + } + return ps, nil +} + +// extractSection extracts text out of string s starting after start +// and ending just before end. found return value will indicate success, +// and prefix, body and suffix will contain correspondent parts of string s. +func extractSection(s string, start, end rune) (prefix, body, suffix string, found bool) { + s = trim(s) + if strings.HasPrefix(s, string(start)) { + // no prefix + body = s[1:] + } else { + a := strings.SplitN(s, string(start), 2) + if len(a) != 2 { + return "", "", s, false + } + prefix = a[0] + body = a[1] + } + a := strings.SplitN(body, string(end), 2) + if len(a) != 2 { + return "", "", "", false + } + return prefix, a[0], a[1], true +} + +// newFn parses string s and return created function Fn. +func newFn(s string) (*Fn, error) { + s = trim(s) + f := &Fn{ + Rets: &Rets{}, + src: s, + PrintTrace: *printTraceFlag, + } + // function name and args + prefix, body, s, found := extractSection(s, '(', ')') + if !found || prefix == "" { + return nil, errors.New("Could not extract function name and parameters from \"" + f.src + "\"") + } + f.Name = prefix + var err error + f.Params, err = extractParams(body, f) + if err != nil { + return nil, err + } + // return values + _, body, s, found = extractSection(s, '(', ')') + if found { + r, err := extractParams(body, f) + if err != nil { + return nil, err + } + switch len(r) { + case 0: + case 1: + if r[0].IsError() { + f.Rets.ReturnsError = true + } else { + f.Rets.Name = r[0].Name + f.Rets.Type = r[0].Type + } + case 2: + if !r[1].IsError() { + return nil, errors.New("Only last windows error is allowed as second return value in \"" + f.src + "\"") + } + f.Rets.ReturnsError = true + f.Rets.Name = r[0].Name + f.Rets.Type = r[0].Type + default: + return nil, errors.New("Too many return values in \"" + f.src + "\"") + } + } + // fail condition + _, body, s, found = extractSection(s, '[', ']') + if found { + f.Rets.FailCond = body + } + // dll and dll function names + s = trim(s) + if s == "" { + return f, nil + } + if !strings.HasPrefix(s, "=") { + return nil, errors.New("Could not extract dll name from \"" + f.src + "\"") + } + s = trim(s[1:]) + a := strings.Split(s, ".") + switch len(a) { + case 1: + f.dllfuncname = a[0] + case 2: + f.dllname = a[0] + f.dllfuncname = a[1] + default: + return nil, errors.New("Could not extract dll name from \"" + f.src + "\"") + } + if f.dllfuncname[len(f.dllfuncname)-1] == '?' { + f.confirmproc = true + f.dllfuncname = f.dllfuncname[0 : len(f.dllfuncname)-1] + } + return f, nil +} + +// DLLName returns DLL name for function f. +func (f *Fn) DLLName() string { + if f.dllname == "" { + return "kernel32" + } + return f.dllname +} + +// DLLName returns DLL function name for function f. +func (f *Fn) DLLFuncName() string { + if f.dllfuncname == "" { + return f.Name + } + return f.dllfuncname +} + +func (f *Fn) ConfirmProc() bool { + return f.confirmproc +} + +// ParamList returns source code for function f parameters. +func (f *Fn) ParamList() string { + return join(f.Params, func(p *Param) string { return p.Name + " " + p.Type }, ", ") +} + +// HelperParamList returns source code for helper function f parameters. +func (f *Fn) HelperParamList() string { + return join(f.Params, func(p *Param) string { return p.Name + " " + p.HelperType() }, ", ") +} + +// ParamPrintList returns source code of trace printing part correspondent +// to syscall input parameters. +func (f *Fn) ParamPrintList() string { + return join(f.Params, func(p *Param) string { return fmt.Sprintf(`"%s=", %s, `, p.Name, p.Name) }, `", ", `) +} + +// ParamCount return number of syscall parameters for function f. +func (f *Fn) ParamCount() int { + n := 0 + for _, p := range f.Params { + n += len(p.SyscallArgList()) + } + return n +} + +// SyscallParamCount determines which version of Syscall/Syscall6/Syscall9/... +// to use. It returns parameter count for correspondent SyscallX function. +func (f *Fn) SyscallParamCount() int { + n := f.ParamCount() + switch { + case n <= 3: + return 3 + case n <= 6: + return 6 + case n <= 9: + return 9 + case n <= 12: + return 12 + case n <= 15: + return 15 + default: + panic("too many arguments to system call") + } +} + +// Syscall determines which SyscallX function to use for function f. +func (f *Fn) Syscall() string { + c := f.SyscallParamCount() + if c == 3 { + return syscalldot() + "Syscall" + } + return syscalldot() + "Syscall" + strconv.Itoa(c) +} + +// SyscallParamList returns source code for SyscallX parameters for function f. +func (f *Fn) SyscallParamList() string { + a := make([]string, 0) + for _, p := range f.Params { + a = append(a, p.SyscallArgList()...) + } + for len(a) < f.SyscallParamCount() { + a = append(a, "0") + } + return strings.Join(a, ", ") +} + +// HelperCallParamList returns source code of call into function f helper. +func (f *Fn) HelperCallParamList() string { + a := make([]string, 0, len(f.Params)) + for _, p := range f.Params { + s := p.Name + if p.Type == "string" { + s = p.tmpVar() + } + a = append(a, s) + } + return strings.Join(a, ", ") +} + +// IsUTF16 is true, if f is W (utf16) function. It is false +// for all A (ascii) functions. +func (_ *Fn) IsUTF16() bool { + return true +} + +// StrconvFunc returns name of Go string to OS string function for f. +func (f *Fn) StrconvFunc() string { + if f.IsUTF16() { + return syscalldot() + "UTF16PtrFromString" + } + return syscalldot() + "BytePtrFromString" +} + +// StrconvType returns Go type name used for OS string for f. +func (f *Fn) StrconvType() string { + if f.IsUTF16() { + return "*uint16" + } + return "*byte" +} + +// HasStringParam is true, if f has at least one string parameter. +// Otherwise it is false. +func (f *Fn) HasStringParam() bool { + for _, p := range f.Params { + if p.Type == "string" { + return true + } + } + return false +} + +var uniqDllFuncName = make(map[string]bool) + +// IsNotDuplicate is true if f is not a duplicated function +func (f *Fn) IsNotDuplicate() bool { + funcName := f.DLLFuncName() + if uniqDllFuncName[funcName] == false { + uniqDllFuncName[funcName] = true + return true + } + return false +} + +// HelperName returns name of function f helper. +func (f *Fn) HelperName() string { + if !f.HasStringParam() { + return f.Name + } + return "_" + f.Name +} + +// Source files and functions. +type Source struct { + Funcs []*Fn + Files []string + StdLibImports []string + ExternalImports []string +} + +func (src *Source) Import(pkg string) { + src.StdLibImports = append(src.StdLibImports, pkg) + sort.Strings(src.StdLibImports) +} + +func (src *Source) ExternalImport(pkg string) { + src.ExternalImports = append(src.ExternalImports, pkg) + sort.Strings(src.ExternalImports) +} + +// ParseFiles parses files listed in fs and extracts all syscall +// functions listed in sys comments. It returns source files +// and functions collection *Source if successful. +func ParseFiles(fs []string) (*Source, error) { + src := &Source{ + Funcs: make([]*Fn, 0), + Files: make([]string, 0), + StdLibImports: []string{ + "unsafe", + }, + ExternalImports: make([]string, 0), + } + for _, file := range fs { + if err := src.ParseFile(file); err != nil { + return nil, err + } + } + return src, nil +} + +// DLLs return dll names for a source set src. +func (src *Source) DLLs() []string { + uniq := make(map[string]bool) + r := make([]string, 0) + for _, f := range src.Funcs { + name := f.DLLName() + if _, found := uniq[name]; !found { + uniq[name] = true + r = append(r, name) + } + } + return r +} + +// ParseFile adds additional file path to a source set src. +func (src *Source) ParseFile(path string) error { + file, err := os.Open(path) + if err != nil { + return err + } + defer file.Close() + + s := bufio.NewScanner(file) + for s.Scan() { + t := trim(s.Text()) + if len(t) < 7 { + continue + } + if !strings.HasPrefix(t, "//sys") { + continue + } + t = t[5:] + if !(t[0] == ' ' || t[0] == '\t') { + continue + } + f, err := newFn(t[1:]) + if err != nil { + return err + } + src.Funcs = append(src.Funcs, f) + } + if err := s.Err(); err != nil { + return err + } + src.Files = append(src.Files, path) + + // get package name + fset := token.NewFileSet() + _, err = file.Seek(0, 0) + if err != nil { + return err + } + pkg, err := parser.ParseFile(fset, "", file, parser.PackageClauseOnly) + if err != nil { + return err + } + packageName = pkg.Name.Name + + return nil +} + +// IsStdRepo returns true if src is part of standard library. +func (src *Source) IsStdRepo() (bool, error) { + if len(src.Files) == 0 { + return false, errors.New("no input files provided") + } + abspath, err := filepath.Abs(src.Files[0]) + if err != nil { + return false, err + } + goroot := runtime.GOROOT() + if runtime.GOOS == "windows" { + abspath = strings.ToLower(abspath) + goroot = strings.ToLower(goroot) + } + sep := string(os.PathSeparator) + if !strings.HasSuffix(goroot, sep) { + goroot += sep + } + return strings.HasPrefix(abspath, goroot), nil +} + +// Generate output source file from a source set src. +func (src *Source) Generate(w io.Writer) error { + const ( + pkgStd = iota // any package in std library + pkgXSysWindows // x/sys/windows package + pkgOther + ) + isStdRepo, err := src.IsStdRepo() + if err != nil { + return err + } + var pkgtype int + switch { + case isStdRepo: + pkgtype = pkgStd + case packageName == "windows": + // TODO: this needs better logic than just using package name + pkgtype = pkgXSysWindows + default: + pkgtype = pkgOther + } + if *systemDLL { + switch pkgtype { + case pkgStd: + src.Import("internal/syscall/windows/sysdll") + case pkgXSysWindows: + default: + src.ExternalImport("golang.org/x/sys/windows") + } + } + src.ExternalImport("github.com/Microsoft/go-winio") + if packageName != "syscall" { + src.Import("syscall") + } + funcMap := template.FuncMap{ + "packagename": packagename, + "syscalldot": syscalldot, + "newlazydll": func(dll string) string { + arg := "\"" + dll + ".dll\"" + if !*systemDLL { + return syscalldot() + "NewLazyDLL(" + arg + ")" + } + switch pkgtype { + case pkgStd: + return syscalldot() + "NewLazyDLL(sysdll.Add(" + arg + "))" + case pkgXSysWindows: + return "NewLazySystemDLL(" + arg + ")" + default: + return "windows.NewLazySystemDLL(" + arg + ")" + } + }, + } + t := template.Must(template.New("main").Funcs(funcMap).Parse(srcTemplate)) + err = t.Execute(w, src) + if err != nil { + return errors.New("Failed to execute template: " + err.Error()) + } + return nil +} + +func usage() { + fmt.Fprintf(os.Stderr, "usage: mksyscall_windows [flags] [path ...]\n") + flag.PrintDefaults() + os.Exit(1) +} + +func main() { + flag.Usage = usage + flag.Parse() + if len(flag.Args()) <= 0 { + fmt.Fprintf(os.Stderr, "no files to parse provided\n") + usage() + } + + src, err := ParseFiles(flag.Args()) + if err != nil { + log.Fatal(err) + } + + var buf bytes.Buffer + if err := src.Generate(&buf); err != nil { + log.Fatal(err) + } + + data, err := format.Source(buf.Bytes()) + if err != nil { + log.Fatal(err) + } + if *filename == "" { + _, err = os.Stdout.Write(data) + } else { + err = ioutil.WriteFile(*filename, data, 0644) + } + if err != nil { + log.Fatal(err) + } +} + +// TODO: use println instead to print in the following template +const srcTemplate = ` + +{{define "main"}}// MACHINE GENERATED BY 'go generate' COMMAND; DO NOT EDIT + +package {{packagename}} + +import ( +{{range .StdLibImports}}"{{.}}" +{{end}} + +{{range .ExternalImports}}"{{.}}" +{{end}} +) + +var _ unsafe.Pointer + +// Do the interface allocations only once for common +// Errno values. +const ( + errnoERROR_IO_PENDING = 997 +) + +var ( + errERROR_IO_PENDING error = {{syscalldot}}Errno(errnoERROR_IO_PENDING) +) + +// errnoErr returns common boxed Errno values, to prevent +// allocations at runtime. +func errnoErr(e {{syscalldot}}Errno) error { + switch e { + case 0: + return nil + case errnoERROR_IO_PENDING: + return errERROR_IO_PENDING + } + // TODO: add more here, after collecting data on the common + // error values see on Windows. (perhaps when running + // all.bat?) + return e +} + +var ( +{{template "dlls" .}} +{{template "funcnames" .}}) +{{range .Funcs}}{{if .HasStringParam}}{{template "helperbody" .}}{{end}}{{template "funcbody" .}}{{end}} +{{end}} + +{{/* help functions */}} + +{{define "dlls"}}{{range .DLLs}} mod{{.}} = {{newlazydll .}} +{{end}}{{end}} + +{{define "funcnames"}}{{range .Funcs}}{{if .IsNotDuplicate}} proc{{.DLLFuncName}} = mod{{.DLLName}}.NewProc("{{.DLLFuncName}}"){{end}} +{{end}}{{end}} + +{{define "helperbody"}} +func {{.Name}}({{.ParamList}}) {{template "results" .}}{ +{{template "helpertmpvars" .}} return {{.HelperName}}({{.HelperCallParamList}}) +} +{{end}} + +{{define "funcbody"}} +func {{.HelperName}}({{.HelperParamList}}) {{template "results" .}}{ +{{template "tmpvars" .}} {{template "syscallcheck" .}}{{template "syscall" .}} +{{template "seterror" .}}{{template "printtrace" .}} return +} +{{end}} + +{{define "helpertmpvars"}}{{range .Params}}{{if .TmpVarHelperCode}} {{.TmpVarHelperCode}} +{{end}}{{end}}{{end}} + +{{define "tmpvars"}}{{range .Params}}{{if .TmpVarCode}} {{.TmpVarCode}} +{{end}}{{end}}{{end}} + +{{define "results"}}{{if .Rets.List}}{{.Rets.List}} {{end}}{{end}} + +{{define "syscall"}}{{.Rets.SetReturnValuesCode}}{{.Syscall}}(proc{{.DLLFuncName}}.Addr(), {{.ParamCount}}, {{.SyscallParamList}}){{end}} + +{{define "syscallcheck"}}{{if .ConfirmProc}}if {{.Rets.ErrorVarName}} = proc{{.DLLFuncName}}.Find(); {{.Rets.ErrorVarName}} != nil { + return +} +{{end}}{{end}} + + +{{define "seterror"}}{{if .Rets.SetErrorCode}} {{.Rets.SetErrorCode}} +{{end}}{{end}} + +{{define "printtrace"}}{{if .PrintTrace}} print("SYSCALL: {{.Name}}(", {{.ParamPrintList}}") (", {{.Rets.PrintList}}")\n") +{{end}}{{end}} + +` diff --git a/vendor/github.com/Microsoft/hcsshim/nametoguid.go b/vendor/github.com/Microsoft/hcsshim/nametoguid.go new file mode 100644 index 0000000000..b7c6d020c6 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/nametoguid.go @@ -0,0 +1,20 @@ +package hcsshim + +import "github.com/sirupsen/logrus" + +// NameToGuid converts the given string into a GUID using the algorithm in the +// Host Compute Service, ensuring GUIDs generated with the same string are common +// across all clients. +func NameToGuid(name string) (id GUID, err error) { + title := "hcsshim::NameToGuid " + logrus.Debugf(title+"Name %s", name) + + err = nameToGuid(name, &id) + if err != nil { + err = makeErrorf(err, title, "name=%s", name) + logrus.Error(err) + return + } + + return +} diff --git a/vendor/github.com/Microsoft/hcsshim/preparelayer.go b/vendor/github.com/Microsoft/hcsshim/preparelayer.go new file mode 100644 index 0000000000..5c5b618411 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/preparelayer.go @@ -0,0 +1,46 @@ +package hcsshim + +import ( + "sync" + + "github.com/sirupsen/logrus" +) + +var prepareLayerLock sync.Mutex + +// PrepareLayer finds a mounted read-write layer matching layerId and enables the +// the filesystem filter for use on that layer. This requires the paths to all +// parent layers, and is necessary in order to view or interact with the layer +// as an actual filesystem (reading and writing files, creating directories, etc). +// Disabling the filter must be done via UnprepareLayer. +func PrepareLayer(info DriverInfo, layerId string, parentLayerPaths []string) error { + title := "hcsshim::PrepareLayer " + logrus.Debugf(title+"flavour %d layerId %s", info.Flavour, layerId) + + // Generate layer descriptors + layers, err := layerPathsToDescriptors(parentLayerPaths) + if err != nil { + return err + } + + // Convert info to API calling convention + infop, err := convertDriverInfo(info) + if err != nil { + logrus.Error(err) + return err + } + + // This lock is a temporary workaround for a Windows bug. Only allowing one + // call to prepareLayer at a time vastly reduces the chance of a timeout. + prepareLayerLock.Lock() + defer prepareLayerLock.Unlock() + err = prepareLayer(&infop, layerId, layers) + if err != nil { + err = makeErrorf(err, title, "layerId=%s flavour=%d", layerId, info.Flavour) + logrus.Error(err) + return err + } + + logrus.Debugf(title+"succeeded flavour=%d layerId=%s", info.Flavour, layerId) + return nil +} diff --git a/vendor/github.com/Microsoft/hcsshim/process.go b/vendor/github.com/Microsoft/hcsshim/process.go new file mode 100644 index 0000000000..faee2cfeeb --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/process.go @@ -0,0 +1,384 @@ +package hcsshim + +import ( + "encoding/json" + "io" + "sync" + "syscall" + "time" + + "github.com/sirupsen/logrus" +) + +// ContainerError is an error encountered in HCS +type process struct { + handleLock sync.RWMutex + handle hcsProcess + processID int + container *container + cachedPipes *cachedPipes + callbackNumber uintptr +} + +type cachedPipes struct { + stdIn syscall.Handle + stdOut syscall.Handle + stdErr syscall.Handle +} + +type processModifyRequest struct { + Operation string + ConsoleSize *consoleSize `json:",omitempty"` + CloseHandle *closeHandle `json:",omitempty"` +} + +type consoleSize struct { + Height uint16 + Width uint16 +} + +type closeHandle struct { + Handle string +} + +type processStatus struct { + ProcessID uint32 + Exited bool + ExitCode uint32 + LastWaitResult int32 +} + +const ( + stdIn string = "StdIn" + stdOut string = "StdOut" + stdErr string = "StdErr" +) + +const ( + modifyConsoleSize string = "ConsoleSize" + modifyCloseHandle string = "CloseHandle" +) + +// Pid returns the process ID of the process within the container. +func (process *process) Pid() int { + return process.processID +} + +// Kill signals the process to terminate but does not wait for it to finish terminating. +func (process *process) Kill() error { + process.handleLock.RLock() + defer process.handleLock.RUnlock() + operation := "Kill" + title := "HCSShim::Process::" + operation + logrus.Debugf(title+" processid=%d", process.processID) + + if process.handle == 0 { + return makeProcessError(process, operation, "", ErrAlreadyClosed) + } + + var resultp *uint16 + err := hcsTerminateProcess(process.handle, &resultp) + err = processHcsResult(err, resultp) + if err != nil { + return makeProcessError(process, operation, "", err) + } + + logrus.Debugf(title+" succeeded processid=%d", process.processID) + return nil +} + +// Wait waits for the process to exit. +func (process *process) Wait() error { + operation := "Wait" + title := "HCSShim::Process::" + operation + logrus.Debugf(title+" processid=%d", process.processID) + + err := waitForNotification(process.callbackNumber, hcsNotificationProcessExited, nil) + if err != nil { + return makeProcessError(process, operation, "", err) + } + + logrus.Debugf(title+" succeeded processid=%d", process.processID) + return nil +} + +// WaitTimeout waits for the process to exit or the duration to elapse. It returns +// false if timeout occurs. +func (process *process) WaitTimeout(timeout time.Duration) error { + operation := "WaitTimeout" + title := "HCSShim::Process::" + operation + logrus.Debugf(title+" processid=%d", process.processID) + + err := waitForNotification(process.callbackNumber, hcsNotificationProcessExited, &timeout) + if err != nil { + return makeProcessError(process, operation, "", err) + } + + logrus.Debugf(title+" succeeded processid=%d", process.processID) + return nil +} + +// ExitCode returns the exit code of the process. The process must have +// already terminated. +func (process *process) ExitCode() (int, error) { + process.handleLock.RLock() + defer process.handleLock.RUnlock() + operation := "ExitCode" + title := "HCSShim::Process::" + operation + logrus.Debugf(title+" processid=%d", process.processID) + + if process.handle == 0 { + return 0, makeProcessError(process, operation, "", ErrAlreadyClosed) + } + + properties, err := process.properties() + if err != nil { + return 0, makeProcessError(process, operation, "", err) + } + + if properties.Exited == false { + return 0, makeProcessError(process, operation, "", ErrInvalidProcessState) + } + + if properties.LastWaitResult != 0 { + return 0, makeProcessError(process, operation, "", syscall.Errno(properties.LastWaitResult)) + } + + logrus.Debugf(title+" succeeded processid=%d exitCode=%d", process.processID, properties.ExitCode) + return int(properties.ExitCode), nil +} + +// ResizeConsole resizes the console of the process. +func (process *process) ResizeConsole(width, height uint16) error { + process.handleLock.RLock() + defer process.handleLock.RUnlock() + operation := "ResizeConsole" + title := "HCSShim::Process::" + operation + logrus.Debugf(title+" processid=%d", process.processID) + + if process.handle == 0 { + return makeProcessError(process, operation, "", ErrAlreadyClosed) + } + + modifyRequest := processModifyRequest{ + Operation: modifyConsoleSize, + ConsoleSize: &consoleSize{ + Height: height, + Width: width, + }, + } + + modifyRequestb, err := json.Marshal(modifyRequest) + if err != nil { + return err + } + + modifyRequestStr := string(modifyRequestb) + + var resultp *uint16 + err = hcsModifyProcess(process.handle, modifyRequestStr, &resultp) + err = processHcsResult(err, resultp) + if err != nil { + return makeProcessError(process, operation, "", err) + } + + logrus.Debugf(title+" succeeded processid=%d", process.processID) + return nil +} + +func (process *process) properties() (*processStatus, error) { + operation := "properties" + title := "HCSShim::Process::" + operation + logrus.Debugf(title+" processid=%d", process.processID) + + var ( + resultp *uint16 + propertiesp *uint16 + ) + err := hcsGetProcessProperties(process.handle, &propertiesp, &resultp) + err = processHcsResult(err, resultp) + if err != nil { + return nil, err + } + + if propertiesp == nil { + return nil, ErrUnexpectedValue + } + propertiesRaw := convertAndFreeCoTaskMemBytes(propertiesp) + + properties := &processStatus{} + if err := json.Unmarshal(propertiesRaw, properties); err != nil { + return nil, err + } + + logrus.Debugf(title+" succeeded processid=%d, properties=%s", process.processID, propertiesRaw) + return properties, nil +} + +// Stdio returns the stdin, stdout, and stderr pipes, respectively. Closing +// these pipes does not close the underlying pipes; it should be possible to +// call this multiple times to get multiple interfaces. +func (process *process) Stdio() (io.WriteCloser, io.ReadCloser, io.ReadCloser, error) { + process.handleLock.RLock() + defer process.handleLock.RUnlock() + operation := "Stdio" + title := "HCSShim::Process::" + operation + logrus.Debugf(title+" processid=%d", process.processID) + + if process.handle == 0 { + return nil, nil, nil, makeProcessError(process, operation, "", ErrAlreadyClosed) + } + + var stdIn, stdOut, stdErr syscall.Handle + + if process.cachedPipes == nil { + var ( + processInfo hcsProcessInformation + resultp *uint16 + ) + err := hcsGetProcessInfo(process.handle, &processInfo, &resultp) + err = processHcsResult(err, resultp) + if err != nil { + return nil, nil, nil, makeProcessError(process, operation, "", err) + } + + stdIn, stdOut, stdErr = processInfo.StdInput, processInfo.StdOutput, processInfo.StdError + } else { + // Use cached pipes + stdIn, stdOut, stdErr = process.cachedPipes.stdIn, process.cachedPipes.stdOut, process.cachedPipes.stdErr + + // Invalidate the cache + process.cachedPipes = nil + } + + pipes, err := makeOpenFiles([]syscall.Handle{stdIn, stdOut, stdErr}) + if err != nil { + return nil, nil, nil, makeProcessError(process, operation, "", err) + } + + logrus.Debugf(title+" succeeded processid=%d", process.processID) + return pipes[0], pipes[1], pipes[2], nil +} + +// CloseStdin closes the write side of the stdin pipe so that the process is +// notified on the read side that there is no more data in stdin. +func (process *process) CloseStdin() error { + process.handleLock.RLock() + defer process.handleLock.RUnlock() + operation := "CloseStdin" + title := "HCSShim::Process::" + operation + logrus.Debugf(title+" processid=%d", process.processID) + + if process.handle == 0 { + return makeProcessError(process, operation, "", ErrAlreadyClosed) + } + + modifyRequest := processModifyRequest{ + Operation: modifyCloseHandle, + CloseHandle: &closeHandle{ + Handle: stdIn, + }, + } + + modifyRequestb, err := json.Marshal(modifyRequest) + if err != nil { + return err + } + + modifyRequestStr := string(modifyRequestb) + + var resultp *uint16 + err = hcsModifyProcess(process.handle, modifyRequestStr, &resultp) + err = processHcsResult(err, resultp) + if err != nil { + return makeProcessError(process, operation, "", err) + } + + logrus.Debugf(title+" succeeded processid=%d", process.processID) + return nil +} + +// Close cleans up any state associated with the process but does not kill +// or wait on it. +func (process *process) Close() error { + process.handleLock.Lock() + defer process.handleLock.Unlock() + operation := "Close" + title := "HCSShim::Process::" + operation + logrus.Debugf(title+" processid=%d", process.processID) + + // Don't double free this + if process.handle == 0 { + return nil + } + + if err := process.unregisterCallback(); err != nil { + return makeProcessError(process, operation, "", err) + } + + if err := hcsCloseProcess(process.handle); err != nil { + return makeProcessError(process, operation, "", err) + } + + process.handle = 0 + + logrus.Debugf(title+" succeeded processid=%d", process.processID) + return nil +} + +func (process *process) registerCallback() error { + context := ¬ifcationWatcherContext{ + channels: newChannels(), + } + + callbackMapLock.Lock() + callbackNumber := nextCallback + nextCallback++ + callbackMap[callbackNumber] = context + callbackMapLock.Unlock() + + var callbackHandle hcsCallback + err := hcsRegisterProcessCallback(process.handle, notificationWatcherCallback, callbackNumber, &callbackHandle) + if err != nil { + return err + } + context.handle = callbackHandle + process.callbackNumber = callbackNumber + + return nil +} + +func (process *process) unregisterCallback() error { + callbackNumber := process.callbackNumber + + callbackMapLock.RLock() + context := callbackMap[callbackNumber] + callbackMapLock.RUnlock() + + if context == nil { + return nil + } + + handle := context.handle + + if handle == 0 { + return nil + } + + // hcsUnregisterProcessCallback has its own syncronization + // to wait for all callbacks to complete. We must NOT hold the callbackMapLock. + err := hcsUnregisterProcessCallback(handle) + if err != nil { + return err + } + + closeChannels(context.channels) + + callbackMapLock.Lock() + callbackMap[callbackNumber] = nil + callbackMapLock.Unlock() + + handle = 0 + + return nil +} diff --git a/vendor/github.com/Microsoft/hcsshim/processimage.go b/vendor/github.com/Microsoft/hcsshim/processimage.go new file mode 100644 index 0000000000..fadb1b92c5 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/processimage.go @@ -0,0 +1,23 @@ +package hcsshim + +import "os" + +// ProcessBaseLayer post-processes a base layer that has had its files extracted. +// The files should have been extracted to \Files. +func ProcessBaseLayer(path string) error { + err := processBaseImage(path) + if err != nil { + return &os.PathError{Op: "ProcessBaseLayer", Path: path, Err: err} + } + return nil +} + +// ProcessUtilityVMImage post-processes a utility VM image that has had its files extracted. +// The files should have been extracted to \Files. +func ProcessUtilityVMImage(path string) error { + err := processUtilityImage(path) + if err != nil { + return &os.PathError{Op: "ProcessUtilityVMImage", Path: path, Err: err} + } + return nil +} diff --git a/vendor/github.com/Microsoft/hcsshim/unpreparelayer.go b/vendor/github.com/Microsoft/hcsshim/unpreparelayer.go new file mode 100644 index 0000000000..e8a3b507bf --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/unpreparelayer.go @@ -0,0 +1,27 @@ +package hcsshim + +import "github.com/sirupsen/logrus" + +// UnprepareLayer disables the filesystem filter for the read-write layer with +// the given id. +func UnprepareLayer(info DriverInfo, layerId string) error { + title := "hcsshim::UnprepareLayer " + logrus.Debugf(title+"flavour %d layerId %s", info.Flavour, layerId) + + // Convert info to API calling convention + infop, err := convertDriverInfo(info) + if err != nil { + logrus.Error(err) + return err + } + + err = unprepareLayer(&infop, layerId) + if err != nil { + err = makeErrorf(err, title, "layerId=%s flavour=%d", layerId, info.Flavour) + logrus.Error(err) + return err + } + + logrus.Debugf(title+"succeeded flavour %d layerId=%s", info.Flavour, layerId) + return nil +} diff --git a/vendor/github.com/Microsoft/hcsshim/utils.go b/vendor/github.com/Microsoft/hcsshim/utils.go new file mode 100644 index 0000000000..bd6e2d94ab --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/utils.go @@ -0,0 +1,33 @@ +package hcsshim + +import ( + "io" + "syscall" + + "github.com/Microsoft/go-winio" +) + +// makeOpenFiles calls winio.MakeOpenFile for each handle in a slice but closes all the handles +// if there is an error. +func makeOpenFiles(hs []syscall.Handle) (_ []io.ReadWriteCloser, err error) { + fs := make([]io.ReadWriteCloser, len(hs)) + for i, h := range hs { + if h != syscall.Handle(0) { + if err == nil { + fs[i], err = winio.MakeOpenFile(h) + } + if err != nil { + syscall.Close(h) + } + } + } + if err != nil { + for _, f := range fs { + if f != nil { + f.Close() + } + } + return nil, err + } + return fs, nil +} diff --git a/vendor/github.com/Microsoft/hcsshim/version.go b/vendor/github.com/Microsoft/hcsshim/version.go new file mode 100644 index 0000000000..ae10c23d42 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/version.go @@ -0,0 +1,7 @@ +package hcsshim + +// IsTP4 returns whether the currently running Windows build is at least TP4. +func IsTP4() bool { + // HNSCall was not present in TP4 + return procHNSCall.Find() != nil +} diff --git a/vendor/github.com/Microsoft/hcsshim/waithelper.go b/vendor/github.com/Microsoft/hcsshim/waithelper.go new file mode 100644 index 0000000000..b7be20ea0c --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/waithelper.go @@ -0,0 +1,63 @@ +package hcsshim + +import ( + "time" + + "github.com/sirupsen/logrus" +) + +func processAsyncHcsResult(err error, resultp *uint16, callbackNumber uintptr, expectedNotification hcsNotification, timeout *time.Duration) error { + err = processHcsResult(err, resultp) + if IsPending(err) { + return waitForNotification(callbackNumber, expectedNotification, timeout) + } + + return err +} + +func waitForNotification(callbackNumber uintptr, expectedNotification hcsNotification, timeout *time.Duration) error { + callbackMapLock.RLock() + channels := callbackMap[callbackNumber].channels + callbackMapLock.RUnlock() + + expectedChannel := channels[expectedNotification] + if expectedChannel == nil { + logrus.Errorf("unknown notification type in waitForNotification %x", expectedNotification) + return ErrInvalidNotificationType + } + + var c <-chan time.Time + if timeout != nil { + timer := time.NewTimer(*timeout) + c = timer.C + defer timer.Stop() + } + + select { + case err, ok := <-expectedChannel: + if !ok { + return ErrHandleClose + } + return err + case err, ok := <-channels[hcsNotificationSystemExited]: + if !ok { + return ErrHandleClose + } + // If the expected notification is hcsNotificationSystemExited which of the two selects + // chosen is random. Return the raw error if hcsNotificationSystemExited is expected + if channels[hcsNotificationSystemExited] == expectedChannel { + return err + } + return ErrUnexpectedContainerExit + case _, ok := <-channels[hcsNotificationServiceDisconnect]: + if !ok { + return ErrHandleClose + } + // hcsNotificationServiceDisconnect should never be an expected notification + // it does not need the same handling as hcsNotificationSystemExited + return ErrUnexpectedProcessAbort + case <-c: + return ErrTimeout + } + return nil +} diff --git a/vendor/github.com/Microsoft/hcsshim/zhcsshim.go b/vendor/github.com/Microsoft/hcsshim/zhcsshim.go new file mode 100644 index 0000000000..5d1a851ae8 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/zhcsshim.go @@ -0,0 +1,1042 @@ +// MACHINE GENERATED BY 'go generate' COMMAND; DO NOT EDIT + +package hcsshim + +import ( + "syscall" + "unsafe" + + "github.com/Microsoft/go-winio" + "golang.org/x/sys/windows" +) + +var _ unsafe.Pointer + +// Do the interface allocations only once for common +// Errno values. +const ( + errnoERROR_IO_PENDING = 997 +) + +var ( + errERROR_IO_PENDING error = syscall.Errno(errnoERROR_IO_PENDING) +) + +// errnoErr returns common boxed Errno values, to prevent +// allocations at runtime. +func errnoErr(e syscall.Errno) error { + switch e { + case 0: + return nil + case errnoERROR_IO_PENDING: + return errERROR_IO_PENDING + } + // TODO: add more here, after collecting data on the common + // error values see on Windows. (perhaps when running + // all.bat?) + return e +} + +var ( + modole32 = windows.NewLazySystemDLL("ole32.dll") + modiphlpapi = windows.NewLazySystemDLL("iphlpapi.dll") + modvmcompute = windows.NewLazySystemDLL("vmcompute.dll") + + procCoTaskMemFree = modole32.NewProc("CoTaskMemFree") + procSetCurrentThreadCompartmentId = modiphlpapi.NewProc("SetCurrentThreadCompartmentId") + procActivateLayer = modvmcompute.NewProc("ActivateLayer") + procCopyLayer = modvmcompute.NewProc("CopyLayer") + procCreateLayer = modvmcompute.NewProc("CreateLayer") + procCreateSandboxLayer = modvmcompute.NewProc("CreateSandboxLayer") + procExpandSandboxSize = modvmcompute.NewProc("ExpandSandboxSize") + procDeactivateLayer = modvmcompute.NewProc("DeactivateLayer") + procDestroyLayer = modvmcompute.NewProc("DestroyLayer") + procExportLayer = modvmcompute.NewProc("ExportLayer") + procGetLayerMountPath = modvmcompute.NewProc("GetLayerMountPath") + procGetBaseImages = modvmcompute.NewProc("GetBaseImages") + procImportLayer = modvmcompute.NewProc("ImportLayer") + procLayerExists = modvmcompute.NewProc("LayerExists") + procNameToGuid = modvmcompute.NewProc("NameToGuid") + procPrepareLayer = modvmcompute.NewProc("PrepareLayer") + procUnprepareLayer = modvmcompute.NewProc("UnprepareLayer") + procProcessBaseImage = modvmcompute.NewProc("ProcessBaseImage") + procProcessUtilityImage = modvmcompute.NewProc("ProcessUtilityImage") + procImportLayerBegin = modvmcompute.NewProc("ImportLayerBegin") + procImportLayerNext = modvmcompute.NewProc("ImportLayerNext") + procImportLayerWrite = modvmcompute.NewProc("ImportLayerWrite") + procImportLayerEnd = modvmcompute.NewProc("ImportLayerEnd") + procExportLayerBegin = modvmcompute.NewProc("ExportLayerBegin") + procExportLayerNext = modvmcompute.NewProc("ExportLayerNext") + procExportLayerRead = modvmcompute.NewProc("ExportLayerRead") + procExportLayerEnd = modvmcompute.NewProc("ExportLayerEnd") + procHcsEnumerateComputeSystems = modvmcompute.NewProc("HcsEnumerateComputeSystems") + procHcsCreateComputeSystem = modvmcompute.NewProc("HcsCreateComputeSystem") + procHcsOpenComputeSystem = modvmcompute.NewProc("HcsOpenComputeSystem") + procHcsCloseComputeSystem = modvmcompute.NewProc("HcsCloseComputeSystem") + procHcsStartComputeSystem = modvmcompute.NewProc("HcsStartComputeSystem") + procHcsShutdownComputeSystem = modvmcompute.NewProc("HcsShutdownComputeSystem") + procHcsTerminateComputeSystem = modvmcompute.NewProc("HcsTerminateComputeSystem") + procHcsPauseComputeSystem = modvmcompute.NewProc("HcsPauseComputeSystem") + procHcsResumeComputeSystem = modvmcompute.NewProc("HcsResumeComputeSystem") + procHcsGetComputeSystemProperties = modvmcompute.NewProc("HcsGetComputeSystemProperties") + procHcsModifyComputeSystem = modvmcompute.NewProc("HcsModifyComputeSystem") + procHcsRegisterComputeSystemCallback = modvmcompute.NewProc("HcsRegisterComputeSystemCallback") + procHcsUnregisterComputeSystemCallback = modvmcompute.NewProc("HcsUnregisterComputeSystemCallback") + procHcsCreateProcess = modvmcompute.NewProc("HcsCreateProcess") + procHcsOpenProcess = modvmcompute.NewProc("HcsOpenProcess") + procHcsCloseProcess = modvmcompute.NewProc("HcsCloseProcess") + procHcsTerminateProcess = modvmcompute.NewProc("HcsTerminateProcess") + procHcsGetProcessInfo = modvmcompute.NewProc("HcsGetProcessInfo") + procHcsGetProcessProperties = modvmcompute.NewProc("HcsGetProcessProperties") + procHcsModifyProcess = modvmcompute.NewProc("HcsModifyProcess") + procHcsGetServiceProperties = modvmcompute.NewProc("HcsGetServiceProperties") + procHcsRegisterProcessCallback = modvmcompute.NewProc("HcsRegisterProcessCallback") + procHcsUnregisterProcessCallback = modvmcompute.NewProc("HcsUnregisterProcessCallback") + procHcsModifyServiceSettings = modvmcompute.NewProc("HcsModifyServiceSettings") + procHNSCall = modvmcompute.NewProc("HNSCall") +) + +func coTaskMemFree(buffer unsafe.Pointer) { + syscall.Syscall(procCoTaskMemFree.Addr(), 1, uintptr(buffer), 0, 0) + return +} + +func SetCurrentThreadCompartmentId(compartmentId uint32) (hr error) { + r0, _, _ := syscall.Syscall(procSetCurrentThreadCompartmentId.Addr(), 1, uintptr(compartmentId), 0, 0) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func activateLayer(info *driverInfo, id string) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(id) + if hr != nil { + return + } + return _activateLayer(info, _p0) +} + +func _activateLayer(info *driverInfo, id *uint16) (hr error) { + if hr = procActivateLayer.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procActivateLayer.Addr(), 2, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), 0) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func copyLayer(info *driverInfo, srcId string, dstId string, descriptors []WC_LAYER_DESCRIPTOR) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(srcId) + if hr != nil { + return + } + var _p1 *uint16 + _p1, hr = syscall.UTF16PtrFromString(dstId) + if hr != nil { + return + } + return _copyLayer(info, _p0, _p1, descriptors) +} + +func _copyLayer(info *driverInfo, srcId *uint16, dstId *uint16, descriptors []WC_LAYER_DESCRIPTOR) (hr error) { + var _p2 *WC_LAYER_DESCRIPTOR + if len(descriptors) > 0 { + _p2 = &descriptors[0] + } + if hr = procCopyLayer.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall6(procCopyLayer.Addr(), 5, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(srcId)), uintptr(unsafe.Pointer(dstId)), uintptr(unsafe.Pointer(_p2)), uintptr(len(descriptors)), 0) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func createLayer(info *driverInfo, id string, parent string) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(id) + if hr != nil { + return + } + var _p1 *uint16 + _p1, hr = syscall.UTF16PtrFromString(parent) + if hr != nil { + return + } + return _createLayer(info, _p0, _p1) +} + +func _createLayer(info *driverInfo, id *uint16, parent *uint16) (hr error) { + if hr = procCreateLayer.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procCreateLayer.Addr(), 3, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(parent))) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func createSandboxLayer(info *driverInfo, id string, parent string, descriptors []WC_LAYER_DESCRIPTOR) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(id) + if hr != nil { + return + } + var _p1 *uint16 + _p1, hr = syscall.UTF16PtrFromString(parent) + if hr != nil { + return + } + return _createSandboxLayer(info, _p0, _p1, descriptors) +} + +func _createSandboxLayer(info *driverInfo, id *uint16, parent *uint16, descriptors []WC_LAYER_DESCRIPTOR) (hr error) { + var _p2 *WC_LAYER_DESCRIPTOR + if len(descriptors) > 0 { + _p2 = &descriptors[0] + } + if hr = procCreateSandboxLayer.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall6(procCreateSandboxLayer.Addr(), 5, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(parent)), uintptr(unsafe.Pointer(_p2)), uintptr(len(descriptors)), 0) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func expandSandboxSize(info *driverInfo, id string, size uint64) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(id) + if hr != nil { + return + } + return _expandSandboxSize(info, _p0, size) +} + +func _expandSandboxSize(info *driverInfo, id *uint16, size uint64) (hr error) { + if hr = procExpandSandboxSize.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procExpandSandboxSize.Addr(), 3, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), uintptr(size)) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func deactivateLayer(info *driverInfo, id string) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(id) + if hr != nil { + return + } + return _deactivateLayer(info, _p0) +} + +func _deactivateLayer(info *driverInfo, id *uint16) (hr error) { + if hr = procDeactivateLayer.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procDeactivateLayer.Addr(), 2, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), 0) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func destroyLayer(info *driverInfo, id string) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(id) + if hr != nil { + return + } + return _destroyLayer(info, _p0) +} + +func _destroyLayer(info *driverInfo, id *uint16) (hr error) { + if hr = procDestroyLayer.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procDestroyLayer.Addr(), 2, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), 0) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func exportLayer(info *driverInfo, id string, path string, descriptors []WC_LAYER_DESCRIPTOR) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(id) + if hr != nil { + return + } + var _p1 *uint16 + _p1, hr = syscall.UTF16PtrFromString(path) + if hr != nil { + return + } + return _exportLayer(info, _p0, _p1, descriptors) +} + +func _exportLayer(info *driverInfo, id *uint16, path *uint16, descriptors []WC_LAYER_DESCRIPTOR) (hr error) { + var _p2 *WC_LAYER_DESCRIPTOR + if len(descriptors) > 0 { + _p2 = &descriptors[0] + } + if hr = procExportLayer.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall6(procExportLayer.Addr(), 5, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(path)), uintptr(unsafe.Pointer(_p2)), uintptr(len(descriptors)), 0) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func getLayerMountPath(info *driverInfo, id string, length *uintptr, buffer *uint16) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(id) + if hr != nil { + return + } + return _getLayerMountPath(info, _p0, length, buffer) +} + +func _getLayerMountPath(info *driverInfo, id *uint16, length *uintptr, buffer *uint16) (hr error) { + if hr = procGetLayerMountPath.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall6(procGetLayerMountPath.Addr(), 4, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(length)), uintptr(unsafe.Pointer(buffer)), 0, 0) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func getBaseImages(buffer **uint16) (hr error) { + if hr = procGetBaseImages.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procGetBaseImages.Addr(), 1, uintptr(unsafe.Pointer(buffer)), 0, 0) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func importLayer(info *driverInfo, id string, path string, descriptors []WC_LAYER_DESCRIPTOR) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(id) + if hr != nil { + return + } + var _p1 *uint16 + _p1, hr = syscall.UTF16PtrFromString(path) + if hr != nil { + return + } + return _importLayer(info, _p0, _p1, descriptors) +} + +func _importLayer(info *driverInfo, id *uint16, path *uint16, descriptors []WC_LAYER_DESCRIPTOR) (hr error) { + var _p2 *WC_LAYER_DESCRIPTOR + if len(descriptors) > 0 { + _p2 = &descriptors[0] + } + if hr = procImportLayer.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall6(procImportLayer.Addr(), 5, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(path)), uintptr(unsafe.Pointer(_p2)), uintptr(len(descriptors)), 0) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func layerExists(info *driverInfo, id string, exists *uint32) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(id) + if hr != nil { + return + } + return _layerExists(info, _p0, exists) +} + +func _layerExists(info *driverInfo, id *uint16, exists *uint32) (hr error) { + if hr = procLayerExists.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procLayerExists.Addr(), 3, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(exists))) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func nameToGuid(name string, guid *GUID) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(name) + if hr != nil { + return + } + return _nameToGuid(_p0, guid) +} + +func _nameToGuid(name *uint16, guid *GUID) (hr error) { + if hr = procNameToGuid.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procNameToGuid.Addr(), 2, uintptr(unsafe.Pointer(name)), uintptr(unsafe.Pointer(guid)), 0) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func prepareLayer(info *driverInfo, id string, descriptors []WC_LAYER_DESCRIPTOR) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(id) + if hr != nil { + return + } + return _prepareLayer(info, _p0, descriptors) +} + +func _prepareLayer(info *driverInfo, id *uint16, descriptors []WC_LAYER_DESCRIPTOR) (hr error) { + var _p1 *WC_LAYER_DESCRIPTOR + if len(descriptors) > 0 { + _p1 = &descriptors[0] + } + if hr = procPrepareLayer.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall6(procPrepareLayer.Addr(), 4, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(_p1)), uintptr(len(descriptors)), 0, 0) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func unprepareLayer(info *driverInfo, id string) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(id) + if hr != nil { + return + } + return _unprepareLayer(info, _p0) +} + +func _unprepareLayer(info *driverInfo, id *uint16) (hr error) { + if hr = procUnprepareLayer.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procUnprepareLayer.Addr(), 2, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), 0) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func processBaseImage(path string) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(path) + if hr != nil { + return + } + return _processBaseImage(_p0) +} + +func _processBaseImage(path *uint16) (hr error) { + if hr = procProcessBaseImage.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procProcessBaseImage.Addr(), 1, uintptr(unsafe.Pointer(path)), 0, 0) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func processUtilityImage(path string) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(path) + if hr != nil { + return + } + return _processUtilityImage(_p0) +} + +func _processUtilityImage(path *uint16) (hr error) { + if hr = procProcessUtilityImage.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procProcessUtilityImage.Addr(), 1, uintptr(unsafe.Pointer(path)), 0, 0) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func importLayerBegin(info *driverInfo, id string, descriptors []WC_LAYER_DESCRIPTOR, context *uintptr) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(id) + if hr != nil { + return + } + return _importLayerBegin(info, _p0, descriptors, context) +} + +func _importLayerBegin(info *driverInfo, id *uint16, descriptors []WC_LAYER_DESCRIPTOR, context *uintptr) (hr error) { + var _p1 *WC_LAYER_DESCRIPTOR + if len(descriptors) > 0 { + _p1 = &descriptors[0] + } + if hr = procImportLayerBegin.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall6(procImportLayerBegin.Addr(), 5, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(_p1)), uintptr(len(descriptors)), uintptr(unsafe.Pointer(context)), 0) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func importLayerNext(context uintptr, fileName string, fileInfo *winio.FileBasicInfo) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(fileName) + if hr != nil { + return + } + return _importLayerNext(context, _p0, fileInfo) +} + +func _importLayerNext(context uintptr, fileName *uint16, fileInfo *winio.FileBasicInfo) (hr error) { + if hr = procImportLayerNext.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procImportLayerNext.Addr(), 3, uintptr(context), uintptr(unsafe.Pointer(fileName)), uintptr(unsafe.Pointer(fileInfo))) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func importLayerWrite(context uintptr, buffer []byte) (hr error) { + var _p0 *byte + if len(buffer) > 0 { + _p0 = &buffer[0] + } + if hr = procImportLayerWrite.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procImportLayerWrite.Addr(), 3, uintptr(context), uintptr(unsafe.Pointer(_p0)), uintptr(len(buffer))) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func importLayerEnd(context uintptr) (hr error) { + if hr = procImportLayerEnd.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procImportLayerEnd.Addr(), 1, uintptr(context), 0, 0) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func exportLayerBegin(info *driverInfo, id string, descriptors []WC_LAYER_DESCRIPTOR, context *uintptr) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(id) + if hr != nil { + return + } + return _exportLayerBegin(info, _p0, descriptors, context) +} + +func _exportLayerBegin(info *driverInfo, id *uint16, descriptors []WC_LAYER_DESCRIPTOR, context *uintptr) (hr error) { + var _p1 *WC_LAYER_DESCRIPTOR + if len(descriptors) > 0 { + _p1 = &descriptors[0] + } + if hr = procExportLayerBegin.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall6(procExportLayerBegin.Addr(), 5, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(_p1)), uintptr(len(descriptors)), uintptr(unsafe.Pointer(context)), 0) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func exportLayerNext(context uintptr, fileName **uint16, fileInfo *winio.FileBasicInfo, fileSize *int64, deleted *uint32) (hr error) { + if hr = procExportLayerNext.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall6(procExportLayerNext.Addr(), 5, uintptr(context), uintptr(unsafe.Pointer(fileName)), uintptr(unsafe.Pointer(fileInfo)), uintptr(unsafe.Pointer(fileSize)), uintptr(unsafe.Pointer(deleted)), 0) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func exportLayerRead(context uintptr, buffer []byte, bytesRead *uint32) (hr error) { + var _p0 *byte + if len(buffer) > 0 { + _p0 = &buffer[0] + } + if hr = procExportLayerRead.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall6(procExportLayerRead.Addr(), 4, uintptr(context), uintptr(unsafe.Pointer(_p0)), uintptr(len(buffer)), uintptr(unsafe.Pointer(bytesRead)), 0, 0) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func exportLayerEnd(context uintptr) (hr error) { + if hr = procExportLayerEnd.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procExportLayerEnd.Addr(), 1, uintptr(context), 0, 0) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func hcsEnumerateComputeSystems(query string, computeSystems **uint16, result **uint16) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(query) + if hr != nil { + return + } + return _hcsEnumerateComputeSystems(_p0, computeSystems, result) +} + +func _hcsEnumerateComputeSystems(query *uint16, computeSystems **uint16, result **uint16) (hr error) { + if hr = procHcsEnumerateComputeSystems.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcsEnumerateComputeSystems.Addr(), 3, uintptr(unsafe.Pointer(query)), uintptr(unsafe.Pointer(computeSystems)), uintptr(unsafe.Pointer(result))) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func hcsCreateComputeSystem(id string, configuration string, identity syscall.Handle, computeSystem *hcsSystem, result **uint16) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(id) + if hr != nil { + return + } + var _p1 *uint16 + _p1, hr = syscall.UTF16PtrFromString(configuration) + if hr != nil { + return + } + return _hcsCreateComputeSystem(_p0, _p1, identity, computeSystem, result) +} + +func _hcsCreateComputeSystem(id *uint16, configuration *uint16, identity syscall.Handle, computeSystem *hcsSystem, result **uint16) (hr error) { + if hr = procHcsCreateComputeSystem.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall6(procHcsCreateComputeSystem.Addr(), 5, uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(configuration)), uintptr(identity), uintptr(unsafe.Pointer(computeSystem)), uintptr(unsafe.Pointer(result)), 0) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func hcsOpenComputeSystem(id string, computeSystem *hcsSystem, result **uint16) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(id) + if hr != nil { + return + } + return _hcsOpenComputeSystem(_p0, computeSystem, result) +} + +func _hcsOpenComputeSystem(id *uint16, computeSystem *hcsSystem, result **uint16) (hr error) { + if hr = procHcsOpenComputeSystem.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcsOpenComputeSystem.Addr(), 3, uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(computeSystem)), uintptr(unsafe.Pointer(result))) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func hcsCloseComputeSystem(computeSystem hcsSystem) (hr error) { + if hr = procHcsCloseComputeSystem.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcsCloseComputeSystem.Addr(), 1, uintptr(computeSystem), 0, 0) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func hcsStartComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(options) + if hr != nil { + return + } + return _hcsStartComputeSystem(computeSystem, _p0, result) +} + +func _hcsStartComputeSystem(computeSystem hcsSystem, options *uint16, result **uint16) (hr error) { + if hr = procHcsStartComputeSystem.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcsStartComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result))) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func hcsShutdownComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(options) + if hr != nil { + return + } + return _hcsShutdownComputeSystem(computeSystem, _p0, result) +} + +func _hcsShutdownComputeSystem(computeSystem hcsSystem, options *uint16, result **uint16) (hr error) { + if hr = procHcsShutdownComputeSystem.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcsShutdownComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result))) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func hcsTerminateComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(options) + if hr != nil { + return + } + return _hcsTerminateComputeSystem(computeSystem, _p0, result) +} + +func _hcsTerminateComputeSystem(computeSystem hcsSystem, options *uint16, result **uint16) (hr error) { + if hr = procHcsTerminateComputeSystem.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcsTerminateComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result))) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func hcsPauseComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(options) + if hr != nil { + return + } + return _hcsPauseComputeSystem(computeSystem, _p0, result) +} + +func _hcsPauseComputeSystem(computeSystem hcsSystem, options *uint16, result **uint16) (hr error) { + if hr = procHcsPauseComputeSystem.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcsPauseComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result))) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func hcsResumeComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(options) + if hr != nil { + return + } + return _hcsResumeComputeSystem(computeSystem, _p0, result) +} + +func _hcsResumeComputeSystem(computeSystem hcsSystem, options *uint16, result **uint16) (hr error) { + if hr = procHcsResumeComputeSystem.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcsResumeComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result))) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func hcsGetComputeSystemProperties(computeSystem hcsSystem, propertyQuery string, properties **uint16, result **uint16) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(propertyQuery) + if hr != nil { + return + } + return _hcsGetComputeSystemProperties(computeSystem, _p0, properties, result) +} + +func _hcsGetComputeSystemProperties(computeSystem hcsSystem, propertyQuery *uint16, properties **uint16, result **uint16) (hr error) { + if hr = procHcsGetComputeSystemProperties.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall6(procHcsGetComputeSystemProperties.Addr(), 4, uintptr(computeSystem), uintptr(unsafe.Pointer(propertyQuery)), uintptr(unsafe.Pointer(properties)), uintptr(unsafe.Pointer(result)), 0, 0) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func hcsModifyComputeSystem(computeSystem hcsSystem, configuration string, result **uint16) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(configuration) + if hr != nil { + return + } + return _hcsModifyComputeSystem(computeSystem, _p0, result) +} + +func _hcsModifyComputeSystem(computeSystem hcsSystem, configuration *uint16, result **uint16) (hr error) { + if hr = procHcsModifyComputeSystem.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcsModifyComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(configuration)), uintptr(unsafe.Pointer(result))) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func hcsRegisterComputeSystemCallback(computeSystem hcsSystem, callback uintptr, context uintptr, callbackHandle *hcsCallback) (hr error) { + if hr = procHcsRegisterComputeSystemCallback.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall6(procHcsRegisterComputeSystemCallback.Addr(), 4, uintptr(computeSystem), uintptr(callback), uintptr(context), uintptr(unsafe.Pointer(callbackHandle)), 0, 0) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func hcsUnregisterComputeSystemCallback(callbackHandle hcsCallback) (hr error) { + if hr = procHcsUnregisterComputeSystemCallback.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcsUnregisterComputeSystemCallback.Addr(), 1, uintptr(callbackHandle), 0, 0) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func hcsCreateProcess(computeSystem hcsSystem, processParameters string, processInformation *hcsProcessInformation, process *hcsProcess, result **uint16) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(processParameters) + if hr != nil { + return + } + return _hcsCreateProcess(computeSystem, _p0, processInformation, process, result) +} + +func _hcsCreateProcess(computeSystem hcsSystem, processParameters *uint16, processInformation *hcsProcessInformation, process *hcsProcess, result **uint16) (hr error) { + if hr = procHcsCreateProcess.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall6(procHcsCreateProcess.Addr(), 5, uintptr(computeSystem), uintptr(unsafe.Pointer(processParameters)), uintptr(unsafe.Pointer(processInformation)), uintptr(unsafe.Pointer(process)), uintptr(unsafe.Pointer(result)), 0) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func hcsOpenProcess(computeSystem hcsSystem, pid uint32, process *hcsProcess, result **uint16) (hr error) { + if hr = procHcsOpenProcess.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall6(procHcsOpenProcess.Addr(), 4, uintptr(computeSystem), uintptr(pid), uintptr(unsafe.Pointer(process)), uintptr(unsafe.Pointer(result)), 0, 0) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func hcsCloseProcess(process hcsProcess) (hr error) { + if hr = procHcsCloseProcess.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcsCloseProcess.Addr(), 1, uintptr(process), 0, 0) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func hcsTerminateProcess(process hcsProcess, result **uint16) (hr error) { + if hr = procHcsTerminateProcess.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcsTerminateProcess.Addr(), 2, uintptr(process), uintptr(unsafe.Pointer(result)), 0) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func hcsGetProcessInfo(process hcsProcess, processInformation *hcsProcessInformation, result **uint16) (hr error) { + if hr = procHcsGetProcessInfo.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcsGetProcessInfo.Addr(), 3, uintptr(process), uintptr(unsafe.Pointer(processInformation)), uintptr(unsafe.Pointer(result))) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func hcsGetProcessProperties(process hcsProcess, processProperties **uint16, result **uint16) (hr error) { + if hr = procHcsGetProcessProperties.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcsGetProcessProperties.Addr(), 3, uintptr(process), uintptr(unsafe.Pointer(processProperties)), uintptr(unsafe.Pointer(result))) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func hcsModifyProcess(process hcsProcess, settings string, result **uint16) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(settings) + if hr != nil { + return + } + return _hcsModifyProcess(process, _p0, result) +} + +func _hcsModifyProcess(process hcsProcess, settings *uint16, result **uint16) (hr error) { + if hr = procHcsModifyProcess.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcsModifyProcess.Addr(), 3, uintptr(process), uintptr(unsafe.Pointer(settings)), uintptr(unsafe.Pointer(result))) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func hcsGetServiceProperties(propertyQuery string, properties **uint16, result **uint16) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(propertyQuery) + if hr != nil { + return + } + return _hcsGetServiceProperties(_p0, properties, result) +} + +func _hcsGetServiceProperties(propertyQuery *uint16, properties **uint16, result **uint16) (hr error) { + if hr = procHcsGetServiceProperties.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcsGetServiceProperties.Addr(), 3, uintptr(unsafe.Pointer(propertyQuery)), uintptr(unsafe.Pointer(properties)), uintptr(unsafe.Pointer(result))) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func hcsRegisterProcessCallback(process hcsProcess, callback uintptr, context uintptr, callbackHandle *hcsCallback) (hr error) { + if hr = procHcsRegisterProcessCallback.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall6(procHcsRegisterProcessCallback.Addr(), 4, uintptr(process), uintptr(callback), uintptr(context), uintptr(unsafe.Pointer(callbackHandle)), 0, 0) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func hcsUnregisterProcessCallback(callbackHandle hcsCallback) (hr error) { + if hr = procHcsUnregisterProcessCallback.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcsUnregisterProcessCallback.Addr(), 1, uintptr(callbackHandle), 0, 0) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func hcsModifyServiceSettings(settings string, result **uint16) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(settings) + if hr != nil { + return + } + return _hcsModifyServiceSettings(_p0, result) +} + +func _hcsModifyServiceSettings(settings *uint16, result **uint16) (hr error) { + if hr = procHcsModifyServiceSettings.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcsModifyServiceSettings.Addr(), 2, uintptr(unsafe.Pointer(settings)), uintptr(unsafe.Pointer(result)), 0) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func _hnsCall(method string, path string, object string, response **uint16) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(method) + if hr != nil { + return + } + var _p1 *uint16 + _p1, hr = syscall.UTF16PtrFromString(path) + if hr != nil { + return + } + var _p2 *uint16 + _p2, hr = syscall.UTF16PtrFromString(object) + if hr != nil { + return + } + return __hnsCall(_p0, _p1, _p2, response) +} + +func __hnsCall(method *uint16, path *uint16, object *uint16, response **uint16) (hr error) { + if hr = procHNSCall.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall6(procHNSCall.Addr(), 4, uintptr(unsafe.Pointer(method)), uintptr(unsafe.Pointer(path)), uintptr(unsafe.Pointer(object)), uintptr(unsafe.Pointer(response)), 0, 0) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +}